Add extracted source directory and README navigation

extracted-source/node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/checkUrl.js

@@ -0,0 +1,46 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.checkUrl = void 0;
+const property_provider_1 = require("@smithy/property-provider");
+const LOOPBACK_CIDR_IPv4 = "127.0.0.0/8";
+const LOOPBACK_CIDR_IPv6 = "::1/128";
+const ECS_CONTAINER_HOST = "169.254.170.2";
+const EKS_CONTAINER_HOST_IPv4 = "169.254.170.23";
+const EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]";
+const checkUrl = (url, logger) => {
+    if (url.protocol === "https:") {
+        return;
+    }
+    if (url.hostname === ECS_CONTAINER_HOST ||
+        url.hostname === EKS_CONTAINER_HOST_IPv4 ||
+        url.hostname === EKS_CONTAINER_HOST_IPv6) {
+        return;
+    }
+    if (url.hostname.includes("[")) {
+        if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") {
+            return;
+        }
+    }
+    else {
+        if (url.hostname === "localhost") {
+            return;
+        }
+        const ipComponents = url.hostname.split(".");
+        const inRange = (component) => {
+            const num = parseInt(component, 10);
+            return 0 <= num && num <= 255;
+        };
+        if (ipComponents[0] === "127" &&
+            inRange(ipComponents[1]) &&
+            inRange(ipComponents[2]) &&
+            inRange(ipComponents[3]) &&
+            ipComponents.length === 4) {
+            return;
+        }
+    }
+    throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following:
+  - loopback CIDR 127.0.0.0/8 or [::1/128]
+  - ECS container host 169.254.170.2
+  - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger });
+};
+exports.checkUrl = checkUrl;

extracted-source/node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/fromHttp.js

@@ -0,0 +1,70 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.fromHttp = void 0;
+const tslib_1 = require("tslib");
+const client_1 = require("@aws-sdk/core/client");
+const node_http_handler_1 = require("@smithy/node-http-handler");
+const property_provider_1 = require("@smithy/property-provider");
+const promises_1 = tslib_1.__importDefault(require("fs/promises"));
+const checkUrl_1 = require("./checkUrl");
+const requestHelpers_1 = require("./requestHelpers");
+const retry_wrapper_1 = require("./retry-wrapper");
+const AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI";
+const DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2";
+const AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI";
+const AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE";
+const AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN";
+const fromHttp = (options = {}) => {
+    options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp");
+    let host;
+    const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI];
+    const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI];
+    const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN];
+    const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE];
+    const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger?.warn
+        ? console.warn
+        : options.logger.warn.bind(options.logger);
+    if (relative && full) {
+        warn("@aws-sdk/credential-provider-http: " +
+            "you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri.");
+        warn("awsContainerCredentialsFullUri will take precedence.");
+    }
+    if (token && tokenFile) {
+        warn("@aws-sdk/credential-provider-http: " +
+            "you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile.");
+        warn("awsContainerAuthorizationToken will take precedence.");
+    }
+    if (full) {
+        host = full;
+    }
+    else if (relative) {
+        host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`;
+    }
+    else {
+        throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided.
+Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger });
+    }
+    const url = new URL(host);
+    (0, checkUrl_1.checkUrl)(url, options.logger);
+    const requestHandler = node_http_handler_1.NodeHttpHandler.create({
+        requestTimeout: options.timeout ?? 1000,
+        connectionTimeout: options.timeout ?? 1000,
+    });
+    return (0, retry_wrapper_1.retryWrapper)(async () => {
+        const request = (0, requestHelpers_1.createGetRequest)(url);
+        if (token) {
+            request.headers.Authorization = token;
+        }
+        else if (tokenFile) {
+            request.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString();
+        }
+        try {
+            const result = await requestHandler.handle(request);
+            return (0, requestHelpers_1.getCredentials)(result.response).then((creds) => (0, client_1.setCredentialFeature)(creds, "CREDENTIALS_HTTP", "z"));
+        }
+        catch (e) {
+            throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger });
+        }
+    }, options.maxRetries ?? 3, options.timeout ?? 1000);
+};
+exports.fromHttp = fromHttp;

extracted-source/node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/requestHelpers.js

@@ -0,0 +1,53 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.createGetRequest = createGetRequest;
+exports.getCredentials = getCredentials;
+const property_provider_1 = require("@smithy/property-provider");
+const protocol_http_1 = require("@smithy/protocol-http");
+const smithy_client_1 = require("@smithy/smithy-client");
+const util_stream_1 = require("@smithy/util-stream");
+function createGetRequest(url) {
+    return new protocol_http_1.HttpRequest({
+        protocol: url.protocol,
+        hostname: url.hostname,
+        port: Number(url.port),
+        path: url.pathname,
+        query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => {
+            acc[k] = v;
+            return acc;
+        }, {}),
+        fragment: url.hash,
+    });
+}
+async function getCredentials(response, logger) {
+    const stream = (0, util_stream_1.sdkStreamMixin)(response.body);
+    const str = await stream.transformToString();
+    if (response.statusCode === 200) {
+        const parsed = JSON.parse(str);
+        if (typeof parsed.AccessKeyId !== "string" ||
+            typeof parsed.SecretAccessKey !== "string" ||
+            typeof parsed.Token !== "string" ||
+            typeof parsed.Expiration !== "string") {
+            throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: " +
+                "{ AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger });
+        }
+        return {
+            accessKeyId: parsed.AccessKeyId,
+            secretAccessKey: parsed.SecretAccessKey,
+            sessionToken: parsed.Token,
+            expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration),
+        };
+    }
+    if (response.statusCode >= 400 && response.statusCode < 500) {
+        let parsedBody = {};
+        try {
+            parsedBody = JSON.parse(str);
+        }
+        catch (e) { }
+        throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), {
+            Code: parsedBody.Code,
+            Message: parsedBody.Message,
+        });
+    }
+    throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger });
+}

extracted-source/node_modules/@aws-sdk/credential-provider-http/dist-cjs/fromHttp/retry-wrapper.js

@@ -0,0 +1,17 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.retryWrapper = void 0;
+const retryWrapper = (toRetry, maxRetries, delayMs) => {
+    return async () => {
+        for (let i = 0; i < maxRetries; ++i) {
+            try {
+                return await toRetry();
+            }
+            catch (e) {
+                await new Promise((resolve) => setTimeout(resolve, delayMs));
+            }
+        }
+        return await toRetry();
+    };
+};
+exports.retryWrapper = retryWrapper;

extracted-source/node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js

@@ -0,0 +1,5 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.fromHttp = void 0;
+var fromHttp_1 = require("./fromHttp/fromHttp");
+Object.defineProperty(exports, "fromHttp", { enumerable: true, get: function () { return fromHttp_1.fromHttp; } });

extracted-source/node_modules/@aws-sdk/credential-provider-http/node_modules/@smithy/protocol-http/dist-cjs/index.js

@@ -0,0 +1,169 @@
+'use strict';
+
+var types = require('@smithy/types');
+
+const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
+    return {
+        setHttpHandler(handler) {
+            runtimeConfig.httpHandler = handler;
+        },
+        httpHandler() {
+            return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+            runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+            return runtimeConfig.httpHandler.httpHandlerConfigs();
+        },
+    };
+};
+const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
+    return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
+    };
+};
+
+class Field {
+    name;
+    kind;
+    values;
+    constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+    }
+    add(value) {
+        this.values.push(value);
+    }
+    set(values) {
+        this.values = values;
+    }
+    remove(value) {
+        this.values = this.values.filter((v) => v !== value);
+    }
+    toString() {
+        return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
+    }
+    get() {
+        return this.values;
+    }
+}
+
+class Fields {
+    entries = {};
+    encoding;
+    constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+    }
+    setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+    }
+    getField(name) {
+        return this.entries[name.toLowerCase()];
+    }
+    removeField(name) {
+        delete this.entries[name.toLowerCase()];
+    }
+    getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+    }
+}
+
+class HttpRequest {
+    method;
+    protocol;
+    hostname;
+    port;
+    path;
+    query;
+    headers;
+    username;
+    password;
+    fragment;
+    body;
+    constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol
+            ? options.protocol.slice(-1) !== ":"
+                ? `${options.protocol}:`
+                : options.protocol
+            : "https:";
+        this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+    }
+    static clone(request) {
+        const cloned = new HttpRequest({
+            ...request,
+            headers: { ...request.headers },
+        });
+        if (cloned.query) {
+            cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+    }
+    static isInstance(request) {
+        if (!request) {
+            return false;
+        }
+        const req = request;
+        return ("method" in req &&
+            "protocol" in req &&
+            "hostname" in req &&
+            "path" in req &&
+            typeof req["query"] === "object" &&
+            typeof req["headers"] === "object");
+    }
+    clone() {
+        return HttpRequest.clone(this);
+    }
+}
+function cloneQuery(query) {
+    return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+            ...carry,
+            [paramName]: Array.isArray(param) ? [...param] : param,
+        };
+    }, {});
+}
+
+class HttpResponse {
+    statusCode;
+    reason;
+    headers;
+    body;
+    constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+    }
+    static isInstance(response) {
+        if (!response)
+            return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+    }
+}
+
+function isValidHostname(hostname) {
+    const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+    return hostPattern.test(hostname);
+}
+
+exports.Field = Field;
+exports.Fields = Fields;
+exports.HttpRequest = HttpRequest;
+exports.HttpResponse = HttpResponse;
+exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
+exports.isValidHostname = isValidHostname;
+exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;

extracted-source/node_modules/@aws-sdk/credential-provider-http/node_modules/@smithy/smithy-client/dist-cjs/index.js

@@ -0,0 +1,589 @@
+'use strict';
+
+var middlewareStack = require('@smithy/middleware-stack');
+var protocols = require('@smithy/core/protocols');
+var types = require('@smithy/types');
+var schema = require('@smithy/core/schema');
+var serde = require('@smithy/core/serde');
+
+class Client {
+    config;
+    middlewareStack = middlewareStack.constructStack();
+    initConfig;
+    handlers;
+    constructor(config) {
+        this.config = config;
+    }
+    send(command, optionsOrCb, cb) {
+        const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
+        const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
+        const useHandlerCache = options === undefined && this.config.cacheMiddleware === true;
+        let handler;
+        if (useHandlerCache) {
+            if (!this.handlers) {
+                this.handlers = new WeakMap();
+            }
+            const handlers = this.handlers;
+            if (handlers.has(command.constructor)) {
+                handler = handlers.get(command.constructor);
+            }
+            else {
+                handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+                handlers.set(command.constructor, handler);
+            }
+        }
+        else {
+            delete this.handlers;
+            handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+        }
+        if (callback) {
+            handler(command)
+                .then((result) => callback(null, result.output), (err) => callback(err))
+                .catch(() => { });
+        }
+        else {
+            return handler(command).then((result) => result.output);
+        }
+    }
+    destroy() {
+        this.config?.requestHandler?.destroy?.();
+        delete this.handlers;
+    }
+}
+
+const SENSITIVE_STRING$1 = "***SensitiveInformation***";
+function schemaLogFilter(schema$1, data) {
+    if (data == null) {
+        return data;
+    }
+    const ns = schema.NormalizedSchema.of(schema$1);
+    if (ns.getMergedTraits().sensitive) {
+        return SENSITIVE_STRING$1;
+    }
+    if (ns.isListSchema()) {
+        const isSensitive = !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isMapSchema()) {
+        const isSensitive = !!ns.getKeySchema().getMergedTraits().sensitive || !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isStructSchema() && typeof data === "object") {
+        const object = data;
+        const newObject = {};
+        for (const [member, memberNs] of ns.structIterator()) {
+            if (object[member] != null) {
+                newObject[member] = schemaLogFilter(memberNs, object[member]);
+            }
+        }
+        return newObject;
+    }
+    return data;
+}
+
+class Command {
+    middlewareStack = middlewareStack.constructStack();
+    schema;
+    static classBuilder() {
+        return new ClassBuilder();
+    }
+    resolveMiddlewareWithContext(clientStack, configuration, options, { middlewareFn, clientName, commandName, inputFilterSensitiveLog, outputFilterSensitiveLog, smithyContext, additionalContext, CommandCtor, }) {
+        for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) {
+            this.middlewareStack.use(mw);
+        }
+        const stack = clientStack.concat(this.middlewareStack);
+        const { logger } = configuration;
+        const handlerExecutionContext = {
+            logger,
+            clientName,
+            commandName,
+            inputFilterSensitiveLog,
+            outputFilterSensitiveLog,
+            [types.SMITHY_CONTEXT_KEY]: {
+                commandInstance: this,
+                ...smithyContext,
+            },
+            ...additionalContext,
+        };
+        const { requestHandler } = configuration;
+        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
+    }
+}
+class ClassBuilder {
+    _init = () => { };
+    _ep = {};
+    _middlewareFn = () => [];
+    _commandName = "";
+    _clientName = "";
+    _additionalContext = {};
+    _smithyContext = {};
+    _inputFilterSensitiveLog = undefined;
+    _outputFilterSensitiveLog = undefined;
+    _serializer = null;
+    _deserializer = null;
+    _operationSchema;
+    init(cb) {
+        this._init = cb;
+    }
+    ep(endpointParameterInstructions) {
+        this._ep = endpointParameterInstructions;
+        return this;
+    }
+    m(middlewareSupplier) {
+        this._middlewareFn = middlewareSupplier;
+        return this;
+    }
+    s(service, operation, smithyContext = {}) {
+        this._smithyContext = {
+            service,
+            operation,
+            ...smithyContext,
+        };
+        return this;
+    }
+    c(additionalContext = {}) {
+        this._additionalContext = additionalContext;
+        return this;
+    }
+    n(clientName, commandName) {
+        this._clientName = clientName;
+        this._commandName = commandName;
+        return this;
+    }
+    f(inputFilter = (_) => _, outputFilter = (_) => _) {
+        this._inputFilterSensitiveLog = inputFilter;
+        this._outputFilterSensitiveLog = outputFilter;
+        return this;
+    }
+    ser(serializer) {
+        this._serializer = serializer;
+        return this;
+    }
+    de(deserializer) {
+        this._deserializer = deserializer;
+        return this;
+    }
+    sc(operation) {
+        this._operationSchema = operation;
+        this._smithyContext.operationSchema = operation;
+        return this;
+    }
+    build() {
+        const closure = this;
+        let CommandRef;
+        return (CommandRef = class extends Command {
+            input;
+            static getEndpointParameterInstructions() {
+                return closure._ep;
+            }
+            constructor(...[input]) {
+                super();
+                this.input = input ?? {};
+                closure._init(this);
+                this.schema = closure._operationSchema;
+            }
+            resolveMiddleware(stack, configuration, options) {
+                const op = closure._operationSchema;
+                const input = op?.[4] ?? op?.input;
+                const output = op?.[5] ?? op?.output;
+                return this.resolveMiddlewareWithContext(stack, configuration, options, {
+                    CommandCtor: CommandRef,
+                    middlewareFn: closure._middlewareFn,
+                    clientName: closure._clientName,
+                    commandName: closure._commandName,
+                    inputFilterSensitiveLog: closure._inputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, input) : (_) => _),
+                    outputFilterSensitiveLog: closure._outputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, output) : (_) => _),
+                    smithyContext: closure._smithyContext,
+                    additionalContext: closure._additionalContext,
+                });
+            }
+            serialize = closure._serializer;
+            deserialize = closure._deserializer;
+        });
+    }
+}
+
+const SENSITIVE_STRING = "***SensitiveInformation***";
+
+const createAggregatedClient = (commands, Client) => {
+    for (const command of Object.keys(commands)) {
+        const CommandCtor = commands[command];
+        const methodImpl = async function (args, optionsOrCb, cb) {
+            const command = new CommandCtor(args);
+            if (typeof optionsOrCb === "function") {
+                this.send(command, optionsOrCb);
+            }
+            else if (typeof cb === "function") {
+                if (typeof optionsOrCb !== "object")
+                    throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
+                this.send(command, optionsOrCb || {}, cb);
+            }
+            else {
+                return this.send(command, optionsOrCb);
+            }
+        };
+        const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
+        Client.prototype[methodName] = methodImpl;
+    }
+};
+
+class ServiceException extends Error {
+    $fault;
+    $response;
+    $retryable;
+    $metadata;
+    constructor(options) {
+        super(options.message);
+        Object.setPrototypeOf(this, Object.getPrototypeOf(this).constructor.prototype);
+        this.name = options.name;
+        this.$fault = options.$fault;
+        this.$metadata = options.$metadata;
+    }
+    static isInstance(value) {
+        if (!value)
+            return false;
+        const candidate = value;
+        return (ServiceException.prototype.isPrototypeOf(candidate) ||
+            (Boolean(candidate.$fault) &&
+                Boolean(candidate.$metadata) &&
+                (candidate.$fault === "client" || candidate.$fault === "server")));
+    }
+    static [Symbol.hasInstance](instance) {
+        if (!instance)
+            return false;
+        const candidate = instance;
+        if (this === ServiceException) {
+            return ServiceException.isInstance(instance);
+        }
+        if (ServiceException.isInstance(instance)) {
+            if (candidate.name && this.name) {
+                return this.prototype.isPrototypeOf(instance) || candidate.name === this.name;
+            }
+            return this.prototype.isPrototypeOf(instance);
+        }
+        return false;
+    }
+}
+const decorateServiceException = (exception, additions = {}) => {
+    Object.entries(additions)
+        .filter(([, v]) => v !== undefined)
+        .forEach(([k, v]) => {
+        if (exception[k] == undefined || exception[k] === "") {
+            exception[k] = v;
+        }
+    });
+    const message = exception.message || exception.Message || "UnknownError";
+    exception.message = message;
+    delete exception.Message;
+    return exception;
+};
+
+const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
+    const $metadata = deserializeMetadata(output);
+    const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
+    const response = new exceptionCtor({
+        name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || "UnknownError",
+        $fault: "client",
+        $metadata,
+    });
+    throw decorateServiceException(response, parsedBody);
+};
+const withBaseException = (ExceptionCtor) => {
+    return ({ output, parsedBody, errorCode }) => {
+        throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
+    };
+};
+const deserializeMetadata = (output) => ({
+    httpStatusCode: output.statusCode,
+    requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
+    extendedRequestId: output.headers["x-amz-id-2"],
+    cfId: output.headers["x-amz-cf-id"],
+});
+
+const loadConfigsForDefaultMode = (mode) => {
+    switch (mode) {
+        case "standard":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "in-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 1100,
+            };
+        case "cross-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "mobile":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 30000,
+            };
+        default:
+            return {};
+    }
+};
+
+let warningEmitted = false;
+const emitWarningIfUnsupportedVersion = (version) => {
+    if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
+        warningEmitted = true;
+    }
+};
+
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    for (const id in types.AlgorithmId) {
+        const algorithmId = types.AlgorithmId[id];
+        if (runtimeConfig[algorithmId] === undefined) {
+            continue;
+        }
+        checksumAlgorithms.push({
+            algorithmId: () => algorithmId,
+            checksumConstructor: () => runtimeConfig[algorithmId],
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getRetryConfiguration = (runtimeConfig) => {
+    return {
+        setRetryStrategy(retryStrategy) {
+            runtimeConfig.retryStrategy = retryStrategy;
+        },
+        retryStrategy() {
+            return runtimeConfig.retryStrategy;
+        },
+    };
+};
+const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
+    const runtimeConfig = {};
+    runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
+    return runtimeConfig;
+};
+
+const getDefaultExtensionConfiguration = (runtimeConfig) => {
+    return Object.assign(getChecksumConfiguration(runtimeConfig), getRetryConfiguration(runtimeConfig));
+};
+const getDefaultClientConfiguration = getDefaultExtensionConfiguration;
+const resolveDefaultRuntimeConfig = (config) => {
+    return Object.assign(resolveChecksumRuntimeConfig(config), resolveRetryRuntimeConfig(config));
+};
+
+const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
+
+const getValueFromTextNode = (obj) => {
+    const textNodeName = "#text";
+    for (const key in obj) {
+        if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
+            obj[key] = obj[key][textNodeName];
+        }
+        else if (typeof obj[key] === "object" && obj[key] !== null) {
+            obj[key] = getValueFromTextNode(obj[key]);
+        }
+    }
+    return obj;
+};
+
+const isSerializableHeaderValue = (value) => {
+    return value != null;
+};
+
+class NoOpLogger {
+    trace() { }
+    debug() { }
+    info() { }
+    warn() { }
+    error() { }
+}
+
+function map(arg0, arg1, arg2) {
+    let target;
+    let filter;
+    let instructions;
+    if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
+        target = {};
+        instructions = arg0;
+    }
+    else {
+        target = arg0;
+        if (typeof arg1 === "function") {
+            filter = arg1;
+            instructions = arg2;
+            return mapWithFilter(target, filter, instructions);
+        }
+        else {
+            instructions = arg1;
+        }
+    }
+    for (const key of Object.keys(instructions)) {
+        if (!Array.isArray(instructions[key])) {
+            target[key] = instructions[key];
+            continue;
+        }
+        applyInstruction(target, null, instructions, key);
+    }
+    return target;
+}
+const convertMap = (target) => {
+    const output = {};
+    for (const [k, v] of Object.entries(target || {})) {
+        output[k] = [, v];
+    }
+    return output;
+};
+const take = (source, instructions) => {
+    const out = {};
+    for (const key in instructions) {
+        applyInstruction(out, source, instructions, key);
+    }
+    return out;
+};
+const mapWithFilter = (target, filter, instructions) => {
+    return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
+        if (Array.isArray(value)) {
+            _instructions[key] = value;
+        }
+        else {
+            if (typeof value === "function") {
+                _instructions[key] = [filter, value()];
+            }
+            else {
+                _instructions[key] = [filter, value];
+            }
+        }
+        return _instructions;
+    }, {}));
+};
+const applyInstruction = (target, source, instructions, targetKey) => {
+    if (source !== null) {
+        let instruction = instructions[targetKey];
+        if (typeof instruction === "function") {
+            instruction = [, instruction];
+        }
+        const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
+        if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
+            target[targetKey] = valueFn(source[sourceKey]);
+        }
+        return;
+    }
+    let [filter, value] = instructions[targetKey];
+    if (typeof value === "function") {
+        let _value;
+        const defaultFilterPassed = filter === undefined && (_value = value()) != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed) {
+            target[targetKey] = _value;
+        }
+        else if (customFilterPassed) {
+            target[targetKey] = value();
+        }
+    }
+    else {
+        const defaultFilterPassed = filter === undefined && value != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed || customFilterPassed) {
+            target[targetKey] = value;
+        }
+    }
+};
+const nonNullish = (_) => _ != null;
+const pass = (_) => _;
+
+const serializeFloat = (value) => {
+    if (value !== value) {
+        return "NaN";
+    }
+    switch (value) {
+        case Infinity:
+            return "Infinity";
+        case -Infinity:
+            return "-Infinity";
+        default:
+            return value;
+    }
+};
+const serializeDateTime = (date) => date.toISOString().replace(".000Z", "Z");
+
+const _json = (obj) => {
+    if (obj == null) {
+        return {};
+    }
+    if (Array.isArray(obj)) {
+        return obj.filter((_) => _ != null).map(_json);
+    }
+    if (typeof obj === "object") {
+        const target = {};
+        for (const key of Object.keys(obj)) {
+            if (obj[key] == null) {
+                continue;
+            }
+            target[key] = _json(obj[key]);
+        }
+        return target;
+    }
+    return obj;
+};
+
+Object.defineProperty(exports, "collectBody", {
+    enumerable: true,
+    get: function () { return protocols.collectBody; }
+});
+Object.defineProperty(exports, "extendedEncodeURIComponent", {
+    enumerable: true,
+    get: function () { return protocols.extendedEncodeURIComponent; }
+});
+Object.defineProperty(exports, "resolvedPath", {
+    enumerable: true,
+    get: function () { return protocols.resolvedPath; }
+});
+exports.Client = Client;
+exports.Command = Command;
+exports.NoOpLogger = NoOpLogger;
+exports.SENSITIVE_STRING = SENSITIVE_STRING;
+exports.ServiceException = ServiceException;
+exports._json = _json;
+exports.convertMap = convertMap;
+exports.createAggregatedClient = createAggregatedClient;
+exports.decorateServiceException = decorateServiceException;
+exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
+exports.getArrayIfSingleItem = getArrayIfSingleItem;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
+exports.getValueFromTextNode = getValueFromTextNode;
+exports.isSerializableHeaderValue = isSerializableHeaderValue;
+exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
+exports.map = map;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
+exports.serializeDateTime = serializeDateTime;
+exports.serializeFloat = serializeFloat;
+exports.take = take;
+exports.throwDefaultError = throwDefaultError;
+exports.withBaseException = withBaseException;
+Object.keys(serde).forEach(function (k) {
+    if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+        enumerable: true,
+        get: function () { return serde[k]; }
+    });
+});

extracted-source/node_modules/@aws-sdk/credential-provider-http/node_modules/@smithy/types/dist-cjs/index.js

@@ -0,0 +1,91 @@
+'use strict';
+
+exports.HttpAuthLocation = void 0;
+(function (HttpAuthLocation) {
+    HttpAuthLocation["HEADER"] = "header";
+    HttpAuthLocation["QUERY"] = "query";
+})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
+
+exports.HttpApiKeyAuthLocation = void 0;
+(function (HttpApiKeyAuthLocation) {
+    HttpApiKeyAuthLocation["HEADER"] = "header";
+    HttpApiKeyAuthLocation["QUERY"] = "query";
+})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
+
+exports.EndpointURLScheme = void 0;
+(function (EndpointURLScheme) {
+    EndpointURLScheme["HTTP"] = "http";
+    EndpointURLScheme["HTTPS"] = "https";
+})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
+
+exports.AlgorithmId = void 0;
+(function (AlgorithmId) {
+    AlgorithmId["MD5"] = "md5";
+    AlgorithmId["CRC32"] = "crc32";
+    AlgorithmId["CRC32C"] = "crc32c";
+    AlgorithmId["SHA1"] = "sha1";
+    AlgorithmId["SHA256"] = "sha256";
+})(exports.AlgorithmId || (exports.AlgorithmId = {}));
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    if (runtimeConfig.sha256 !== undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.SHA256,
+            checksumConstructor: () => runtimeConfig.sha256,
+        });
+    }
+    if (runtimeConfig.md5 != undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.MD5,
+            checksumConstructor: () => runtimeConfig.md5,
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getDefaultClientConfiguration = (runtimeConfig) => {
+    return getChecksumConfiguration(runtimeConfig);
+};
+const resolveDefaultRuntimeConfig = (config) => {
+    return resolveChecksumRuntimeConfig(config);
+};
+
+exports.FieldPosition = void 0;
+(function (FieldPosition) {
+    FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
+    FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
+})(exports.FieldPosition || (exports.FieldPosition = {}));
+
+const SMITHY_CONTEXT_KEY = "__smithy_context";
+
+exports.IniSectionType = void 0;
+(function (IniSectionType) {
+    IniSectionType["PROFILE"] = "profile";
+    IniSectionType["SSO_SESSION"] = "sso-session";
+    IniSectionType["SERVICES"] = "services";
+})(exports.IniSectionType || (exports.IniSectionType = {}));
+
+exports.RequestHandlerProtocol = void 0;
+(function (RequestHandlerProtocol) {
+    RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
+    RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
+    RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
+})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
+
+exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;