Add extracted source directory and README navigation

extracted-source/node_modules/@aws-sdk/core/dist-cjs/submodules/client/index.js

@@ -0,0 +1,51 @@
+'use strict';
+
+const state = {
+    warningEmitted: false,
+};
+const emitWarningIfUnsupportedVersion = (version) => {
+    if (version && !state.warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) {
+        state.warningEmitted = true;
+        process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will
+no longer support Node.js 16.x on January 6, 2025.
+
+To continue receiving updates to AWS services, bug fixes, and security
+updates please upgrade to a supported Node.js LTS version.
+
+More information can be found at: https://a.co/74kJMmI`);
+    }
+};
+
+function setCredentialFeature(credentials, feature, value) {
+    if (!credentials.$source) {
+        credentials.$source = {};
+    }
+    credentials.$source[feature] = value;
+    return credentials;
+}
+
+function setFeature(context, feature, value) {
+    if (!context.__aws_sdk_context) {
+        context.__aws_sdk_context = {
+            features: {},
+        };
+    }
+    else if (!context.__aws_sdk_context.features) {
+        context.__aws_sdk_context.features = {};
+    }
+    context.__aws_sdk_context.features[feature] = value;
+}
+
+function setTokenFeature(token, feature, value) {
+    if (!token.$source) {
+        token.$source = {};
+    }
+    token.$source[feature] = value;
+    return token;
+}
+
+exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
+exports.setCredentialFeature = setCredentialFeature;
+exports.setFeature = setFeature;
+exports.setTokenFeature = setTokenFeature;
+exports.state = state;

extracted-source/node_modules/@aws-sdk/core/dist-cjs/submodules/httpAuthSchemes/index.js

@@ -0,0 +1,299 @@
+'use strict';
+
+var protocolHttp = require('@smithy/protocol-http');
+var core = require('@smithy/core');
+var propertyProvider = require('@smithy/property-provider');
+var client = require('@aws-sdk/core/client');
+var signatureV4 = require('@smithy/signature-v4');
+
+const getDateHeader = (response) => protocolHttp.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : undefined;
+
+const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset);
+
+const isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 300000;
+
+const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => {
+    const clockTimeInMs = Date.parse(clockTime);
+    if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) {
+        return clockTimeInMs - Date.now();
+    }
+    return currentSystemClockOffset;
+};
+
+const throwSigningPropertyError = (name, property) => {
+    if (!property) {
+        throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`);
+    }
+    return property;
+};
+const validateSigningProperties = async (signingProperties) => {
+    const context = throwSigningPropertyError("context", signingProperties.context);
+    const config = throwSigningPropertyError("config", signingProperties.config);
+    const authScheme = context.endpointV2?.properties?.authSchemes?.[0];
+    const signerFunction = throwSigningPropertyError("signer", config.signer);
+    const signer = await signerFunction(authScheme);
+    const signingRegion = signingProperties?.signingRegion;
+    const signingRegionSet = signingProperties?.signingRegionSet;
+    const signingName = signingProperties?.signingName;
+    return {
+        config,
+        signer,
+        signingRegion,
+        signingRegionSet,
+        signingName,
+    };
+};
+class AwsSdkSigV4Signer {
+    async sign(httpRequest, identity, signingProperties) {
+        if (!protocolHttp.HttpRequest.isInstance(httpRequest)) {
+            throw new Error("The request is not an instance of `HttpRequest` and cannot be signed");
+        }
+        const validatedProps = await validateSigningProperties(signingProperties);
+        const { config, signer } = validatedProps;
+        let { signingRegion, signingName } = validatedProps;
+        const handlerExecutionContext = signingProperties.context;
+        if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) {
+            const [first, second] = handlerExecutionContext.authSchemes;
+            if (first?.name === "sigv4a" && second?.name === "sigv4") {
+                signingRegion = second?.signingRegion ?? signingRegion;
+                signingName = second?.signingName ?? signingName;
+            }
+        }
+        const signedRequest = await signer.sign(httpRequest, {
+            signingDate: getSkewCorrectedDate(config.systemClockOffset),
+            signingRegion: signingRegion,
+            signingService: signingName,
+        });
+        return signedRequest;
+    }
+    errorHandler(signingProperties) {
+        return (error) => {
+            const serverTime = error.ServerTime ?? getDateHeader(error.$response);
+            if (serverTime) {
+                const config = throwSigningPropertyError("config", signingProperties.config);
+                const initialSystemClockOffset = config.systemClockOffset;
+                config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset);
+                const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset;
+                if (clockSkewCorrected && error.$metadata) {
+                    error.$metadata.clockSkewCorrected = true;
+                }
+            }
+            throw error;
+        };
+    }
+    successHandler(httpResponse, signingProperties) {
+        const dateHeader = getDateHeader(httpResponse);
+        if (dateHeader) {
+            const config = throwSigningPropertyError("config", signingProperties.config);
+            config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset);
+        }
+    }
+}
+const AWSSDKSigV4Signer = AwsSdkSigV4Signer;
+
+class AwsSdkSigV4ASigner extends AwsSdkSigV4Signer {
+    async sign(httpRequest, identity, signingProperties) {
+        if (!protocolHttp.HttpRequest.isInstance(httpRequest)) {
+            throw new Error("The request is not an instance of `HttpRequest` and cannot be signed");
+        }
+        const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties);
+        const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.();
+        const multiRegionOverride = (configResolvedSigningRegionSet ??
+            signingRegionSet ?? [signingRegion]).join(",");
+        const signedRequest = await signer.sign(httpRequest, {
+            signingDate: getSkewCorrectedDate(config.systemClockOffset),
+            signingRegion: multiRegionOverride,
+            signingService: signingName,
+        });
+        return signedRequest;
+    }
+}
+
+const getArrayForCommaSeparatedString = (str) => typeof str === "string" && str.length > 0 ? str.split(",").map((item) => item.trim()) : [];
+
+const getBearerTokenEnvKey = (signingName) => `AWS_BEARER_TOKEN_${signingName.replace(/[\s-]/g, "_").toUpperCase()}`;
+
+const NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY = "AWS_AUTH_SCHEME_PREFERENCE";
+const NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY = "auth_scheme_preference";
+const NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = {
+    environmentVariableSelector: (env, options) => {
+        if (options?.signingName) {
+            const bearerTokenKey = getBearerTokenEnvKey(options.signingName);
+            if (bearerTokenKey in env)
+                return ["httpBearerAuth"];
+        }
+        if (!(NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY in env))
+            return undefined;
+        return getArrayForCommaSeparatedString(env[NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY]);
+    },
+    configFileSelector: (profile) => {
+        if (!(NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY in profile))
+            return undefined;
+        return getArrayForCommaSeparatedString(profile[NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY]);
+    },
+    default: [],
+};
+
+const resolveAwsSdkSigV4AConfig = (config) => {
+    config.sigv4aSigningRegionSet = core.normalizeProvider(config.sigv4aSigningRegionSet);
+    return config;
+};
+const NODE_SIGV4A_CONFIG_OPTIONS = {
+    environmentVariableSelector(env) {
+        if (env.AWS_SIGV4A_SIGNING_REGION_SET) {
+            return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim());
+        }
+        throw new propertyProvider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", {
+            tryNextLink: true,
+        });
+    },
+    configFileSelector(profile) {
+        if (profile.sigv4a_signing_region_set) {
+            return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim());
+        }
+        throw new propertyProvider.ProviderError("sigv4a_signing_region_set not set in profile.", {
+            tryNextLink: true,
+        });
+    },
+    default: undefined,
+};
+
+const resolveAwsSdkSigV4Config = (config) => {
+    let inputCredentials = config.credentials;
+    let isUserSupplied = !!config.credentials;
+    let resolvedCredentials = undefined;
+    Object.defineProperty(config, "credentials", {
+        set(credentials) {
+            if (credentials && credentials !== inputCredentials && credentials !== resolvedCredentials) {
+                isUserSupplied = true;
+            }
+            inputCredentials = credentials;
+            const memoizedProvider = normalizeCredentialProvider(config, {
+                credentials: inputCredentials,
+                credentialDefaultProvider: config.credentialDefaultProvider,
+            });
+            const boundProvider = bindCallerConfig(config, memoizedProvider);
+            if (isUserSupplied && !boundProvider.attributed) {
+                resolvedCredentials = async (options) => boundProvider(options).then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_CODE", "e"));
+                resolvedCredentials.memoized = boundProvider.memoized;
+                resolvedCredentials.configBound = boundProvider.configBound;
+                resolvedCredentials.attributed = true;
+            }
+            else {
+                resolvedCredentials = boundProvider;
+            }
+        },
+        get() {
+            return resolvedCredentials;
+        },
+        enumerable: true,
+        configurable: true,
+    });
+    config.credentials = inputCredentials;
+    const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256, } = config;
+    let signer;
+    if (config.signer) {
+        signer = core.normalizeProvider(config.signer);
+    }
+    else if (config.regionInfoProvider) {
+        signer = () => core.normalizeProvider(config.region)()
+            .then(async (region) => [
+            (await config.regionInfoProvider(region, {
+                useFipsEndpoint: await config.useFipsEndpoint(),
+                useDualstackEndpoint: await config.useDualstackEndpoint(),
+            })) || {},
+            region,
+        ])
+            .then(([regionInfo, region]) => {
+            const { signingRegion, signingService } = regionInfo;
+            config.signingRegion = config.signingRegion || signingRegion || region;
+            config.signingName = config.signingName || signingService || config.serviceId;
+            const params = {
+                ...config,
+                credentials: config.credentials,
+                region: config.signingRegion,
+                service: config.signingName,
+                sha256,
+                uriEscapePath: signingEscapePath,
+            };
+            const SignerCtor = config.signerConstructor || signatureV4.SignatureV4;
+            return new SignerCtor(params);
+        });
+    }
+    else {
+        signer = async (authScheme) => {
+            authScheme = Object.assign({}, {
+                name: "sigv4",
+                signingName: config.signingName || config.defaultSigningName,
+                signingRegion: await core.normalizeProvider(config.region)(),
+                properties: {},
+            }, authScheme);
+            const signingRegion = authScheme.signingRegion;
+            const signingService = authScheme.signingName;
+            config.signingRegion = config.signingRegion || signingRegion;
+            config.signingName = config.signingName || signingService || config.serviceId;
+            const params = {
+                ...config,
+                credentials: config.credentials,
+                region: config.signingRegion,
+                service: config.signingName,
+                sha256,
+                uriEscapePath: signingEscapePath,
+            };
+            const SignerCtor = config.signerConstructor || signatureV4.SignatureV4;
+            return new SignerCtor(params);
+        };
+    }
+    const resolvedConfig = Object.assign(config, {
+        systemClockOffset,
+        signingEscapePath,
+        signer,
+    });
+    return resolvedConfig;
+};
+const resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config;
+function normalizeCredentialProvider(config, { credentials, credentialDefaultProvider, }) {
+    let credentialsProvider;
+    if (credentials) {
+        if (!credentials?.memoized) {
+            credentialsProvider = core.memoizeIdentityProvider(credentials, core.isIdentityExpired, core.doesIdentityRequireRefresh);
+        }
+        else {
+            credentialsProvider = credentials;
+        }
+    }
+    else {
+        if (credentialDefaultProvider) {
+            credentialsProvider = core.normalizeProvider(credentialDefaultProvider(Object.assign({}, config, {
+                parentClientConfig: config,
+            })));
+        }
+        else {
+            credentialsProvider = async () => {
+                throw new Error("@aws-sdk/core::resolveAwsSdkSigV4Config - `credentials` not provided and no credentialDefaultProvider was configured.");
+            };
+        }
+    }
+    credentialsProvider.memoized = true;
+    return credentialsProvider;
+}
+function bindCallerConfig(config, credentialsProvider) {
+    if (credentialsProvider.configBound) {
+        return credentialsProvider;
+    }
+    const fn = async (options) => credentialsProvider({ ...options, callerClientConfig: config });
+    fn.memoized = credentialsProvider.memoized;
+    fn.configBound = true;
+    return fn;
+}
+
+exports.AWSSDKSigV4Signer = AWSSDKSigV4Signer;
+exports.AwsSdkSigV4ASigner = AwsSdkSigV4ASigner;
+exports.AwsSdkSigV4Signer = AwsSdkSigV4Signer;
+exports.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = NODE_AUTH_SCHEME_PREFERENCE_OPTIONS;
+exports.NODE_SIGV4A_CONFIG_OPTIONS = NODE_SIGV4A_CONFIG_OPTIONS;
+exports.getBearerTokenEnvKey = getBearerTokenEnvKey;
+exports.resolveAWSSDKSigV4Config = resolveAWSSDKSigV4Config;
+exports.resolveAwsSdkSigV4AConfig = resolveAwsSdkSigV4AConfig;
+exports.resolveAwsSdkSigV4Config = resolveAwsSdkSigV4Config;
+exports.validateSigningProperties = validateSigningProperties;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/protocol-http/dist-cjs/index.js

@@ -0,0 +1,169 @@
+'use strict';
+
+var types = require('@smithy/types');
+
+const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
+    return {
+        setHttpHandler(handler) {
+            runtimeConfig.httpHandler = handler;
+        },
+        httpHandler() {
+            return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+            runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+            return runtimeConfig.httpHandler.httpHandlerConfigs();
+        },
+    };
+};
+const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
+    return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
+    };
+};
+
+class Field {
+    name;
+    kind;
+    values;
+    constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+    }
+    add(value) {
+        this.values.push(value);
+    }
+    set(values) {
+        this.values = values;
+    }
+    remove(value) {
+        this.values = this.values.filter((v) => v !== value);
+    }
+    toString() {
+        return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
+    }
+    get() {
+        return this.values;
+    }
+}
+
+class Fields {
+    entries = {};
+    encoding;
+    constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+    }
+    setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+    }
+    getField(name) {
+        return this.entries[name.toLowerCase()];
+    }
+    removeField(name) {
+        delete this.entries[name.toLowerCase()];
+    }
+    getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+    }
+}
+
+class HttpRequest {
+    method;
+    protocol;
+    hostname;
+    port;
+    path;
+    query;
+    headers;
+    username;
+    password;
+    fragment;
+    body;
+    constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol
+            ? options.protocol.slice(-1) !== ":"
+                ? `${options.protocol}:`
+                : options.protocol
+            : "https:";
+        this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+    }
+    static clone(request) {
+        const cloned = new HttpRequest({
+            ...request,
+            headers: { ...request.headers },
+        });
+        if (cloned.query) {
+            cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+    }
+    static isInstance(request) {
+        if (!request) {
+            return false;
+        }
+        const req = request;
+        return ("method" in req &&
+            "protocol" in req &&
+            "hostname" in req &&
+            "path" in req &&
+            typeof req["query"] === "object" &&
+            typeof req["headers"] === "object");
+    }
+    clone() {
+        return HttpRequest.clone(this);
+    }
+}
+function cloneQuery(query) {
+    return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+            ...carry,
+            [paramName]: Array.isArray(param) ? [...param] : param,
+        };
+    }, {});
+}
+
+class HttpResponse {
+    statusCode;
+    reason;
+    headers;
+    body;
+    constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+    }
+    static isInstance(response) {
+        if (!response)
+            return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+    }
+}
+
+function isValidHostname(hostname) {
+    const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+    return hostPattern.test(hostname);
+}
+
+exports.Field = Field;
+exports.Fields = Fields;
+exports.HttpRequest = HttpRequest;
+exports.HttpResponse = HttpResponse;
+exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
+exports.isValidHostname = isValidHostname;
+exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/signature-v4/dist-cjs/index.js

@@ -0,0 +1,556 @@
+'use strict';
+
+var utilHexEncoding = require('@smithy/util-hex-encoding');
+var utilUtf8 = require('@smithy/util-utf8');
+var isArrayBuffer = require('@smithy/is-array-buffer');
+var protocolHttp = require('@smithy/protocol-http');
+var utilMiddleware = require('@smithy/util-middleware');
+var utilUriEscape = require('@smithy/util-uri-escape');
+
+const ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm";
+const CREDENTIAL_QUERY_PARAM = "X-Amz-Credential";
+const AMZ_DATE_QUERY_PARAM = "X-Amz-Date";
+const SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders";
+const EXPIRES_QUERY_PARAM = "X-Amz-Expires";
+const SIGNATURE_QUERY_PARAM = "X-Amz-Signature";
+const TOKEN_QUERY_PARAM = "X-Amz-Security-Token";
+const REGION_SET_PARAM = "X-Amz-Region-Set";
+const AUTH_HEADER = "authorization";
+const AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase();
+const DATE_HEADER = "date";
+const GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER];
+const SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase();
+const SHA256_HEADER = "x-amz-content-sha256";
+const TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase();
+const HOST_HEADER = "host";
+const ALWAYS_UNSIGNABLE_HEADERS = {
+    authorization: true,
+    "cache-control": true,
+    connection: true,
+    expect: true,
+    from: true,
+    "keep-alive": true,
+    "max-forwards": true,
+    pragma: true,
+    referer: true,
+    te: true,
+    trailer: true,
+    "transfer-encoding": true,
+    upgrade: true,
+    "user-agent": true,
+    "x-amzn-trace-id": true,
+};
+const PROXY_HEADER_PATTERN = /^proxy-/;
+const SEC_HEADER_PATTERN = /^sec-/;
+const UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i];
+const ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256";
+const ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256";
+const EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD";
+const UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD";
+const MAX_CACHE_SIZE = 50;
+const KEY_TYPE_IDENTIFIER = "aws4_request";
+const MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7;
+
+const signingKeyCache = {};
+const cacheQueue = [];
+const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`;
+const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => {
+    const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId);
+    const cacheKey = `${shortDate}:${region}:${service}:${utilHexEncoding.toHex(credsHash)}:${credentials.sessionToken}`;
+    if (cacheKey in signingKeyCache) {
+        return signingKeyCache[cacheKey];
+    }
+    cacheQueue.push(cacheKey);
+    while (cacheQueue.length > MAX_CACHE_SIZE) {
+        delete signingKeyCache[cacheQueue.shift()];
+    }
+    let key = `AWS4${credentials.secretAccessKey}`;
+    for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) {
+        key = await hmac(sha256Constructor, key, signable);
+    }
+    return (signingKeyCache[cacheKey] = key);
+};
+const clearCredentialCache = () => {
+    cacheQueue.length = 0;
+    Object.keys(signingKeyCache).forEach((cacheKey) => {
+        delete signingKeyCache[cacheKey];
+    });
+};
+const hmac = (ctor, secret, data) => {
+    const hash = new ctor(secret);
+    hash.update(utilUtf8.toUint8Array(data));
+    return hash.digest();
+};
+
+const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => {
+    const canonical = {};
+    for (const headerName of Object.keys(headers).sort()) {
+        if (headers[headerName] == undefined) {
+            continue;
+        }
+        const canonicalHeaderName = headerName.toLowerCase();
+        if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS ||
+            unsignableHeaders?.has(canonicalHeaderName) ||
+            PROXY_HEADER_PATTERN.test(canonicalHeaderName) ||
+            SEC_HEADER_PATTERN.test(canonicalHeaderName)) {
+            if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) {
+                continue;
+            }
+        }
+        canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " ");
+    }
+    return canonical;
+};
+
+const getPayloadHash = async ({ headers, body }, hashConstructor) => {
+    for (const headerName of Object.keys(headers)) {
+        if (headerName.toLowerCase() === SHA256_HEADER) {
+            return headers[headerName];
+        }
+    }
+    if (body == undefined) {
+        return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855";
+    }
+    else if (typeof body === "string" || ArrayBuffer.isView(body) || isArrayBuffer.isArrayBuffer(body)) {
+        const hashCtor = new hashConstructor();
+        hashCtor.update(utilUtf8.toUint8Array(body));
+        return utilHexEncoding.toHex(await hashCtor.digest());
+    }
+    return UNSIGNED_PAYLOAD;
+};
+
+class HeaderFormatter {
+    format(headers) {
+        const chunks = [];
+        for (const headerName of Object.keys(headers)) {
+            const bytes = utilUtf8.fromUtf8(headerName);
+            chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName]));
+        }
+        const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0));
+        let position = 0;
+        for (const chunk of chunks) {
+            out.set(chunk, position);
+            position += chunk.byteLength;
+        }
+        return out;
+    }
+    formatHeaderValue(header) {
+        switch (header.type) {
+            case "boolean":
+                return Uint8Array.from([header.value ? 0 : 1]);
+            case "byte":
+                return Uint8Array.from([2, header.value]);
+            case "short":
+                const shortView = new DataView(new ArrayBuffer(3));
+                shortView.setUint8(0, 3);
+                shortView.setInt16(1, header.value, false);
+                return new Uint8Array(shortView.buffer);
+            case "integer":
+                const intView = new DataView(new ArrayBuffer(5));
+                intView.setUint8(0, 4);
+                intView.setInt32(1, header.value, false);
+                return new Uint8Array(intView.buffer);
+            case "long":
+                const longBytes = new Uint8Array(9);
+                longBytes[0] = 5;
+                longBytes.set(header.value.bytes, 1);
+                return longBytes;
+            case "binary":
+                const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength));
+                binView.setUint8(0, 6);
+                binView.setUint16(1, header.value.byteLength, false);
+                const binBytes = new Uint8Array(binView.buffer);
+                binBytes.set(header.value, 3);
+                return binBytes;
+            case "string":
+                const utf8Bytes = utilUtf8.fromUtf8(header.value);
+                const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength));
+                strView.setUint8(0, 7);
+                strView.setUint16(1, utf8Bytes.byteLength, false);
+                const strBytes = new Uint8Array(strView.buffer);
+                strBytes.set(utf8Bytes, 3);
+                return strBytes;
+            case "timestamp":
+                const tsBytes = new Uint8Array(9);
+                tsBytes[0] = 8;
+                tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1);
+                return tsBytes;
+            case "uuid":
+                if (!UUID_PATTERN.test(header.value)) {
+                    throw new Error(`Invalid UUID received: ${header.value}`);
+                }
+                const uuidBytes = new Uint8Array(17);
+                uuidBytes[0] = 9;
+                uuidBytes.set(utilHexEncoding.fromHex(header.value.replace(/\-/g, "")), 1);
+                return uuidBytes;
+        }
+    }
+}
+const UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/;
+class Int64 {
+    bytes;
+    constructor(bytes) {
+        this.bytes = bytes;
+        if (bytes.byteLength !== 8) {
+            throw new Error("Int64 buffers must be exactly 8 bytes");
+        }
+    }
+    static fromNumber(number) {
+        if (number > 9_223_372_036_854_775_807 || number < -9223372036854776e3) {
+            throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`);
+        }
+        const bytes = new Uint8Array(8);
+        for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) {
+            bytes[i] = remaining;
+        }
+        if (number < 0) {
+            negate(bytes);
+        }
+        return new Int64(bytes);
+    }
+    valueOf() {
+        const bytes = this.bytes.slice(0);
+        const negative = bytes[0] & 0b10000000;
+        if (negative) {
+            negate(bytes);
+        }
+        return parseInt(utilHexEncoding.toHex(bytes), 16) * (negative ? -1 : 1);
+    }
+    toString() {
+        return String(this.valueOf());
+    }
+}
+function negate(bytes) {
+    for (let i = 0; i < 8; i++) {
+        bytes[i] ^= 0xff;
+    }
+    for (let i = 7; i > -1; i--) {
+        bytes[i]++;
+        if (bytes[i] !== 0)
+            break;
+    }
+}
+
+const hasHeader = (soughtHeader, headers) => {
+    soughtHeader = soughtHeader.toLowerCase();
+    for (const headerName of Object.keys(headers)) {
+        if (soughtHeader === headerName.toLowerCase()) {
+            return true;
+        }
+    }
+    return false;
+};
+
+const moveHeadersToQuery = (request, options = {}) => {
+    const { headers, query = {} } = protocolHttp.HttpRequest.clone(request);
+    for (const name of Object.keys(headers)) {
+        const lname = name.toLowerCase();
+        if ((lname.slice(0, 6) === "x-amz-" && !options.unhoistableHeaders?.has(lname)) ||
+            options.hoistableHeaders?.has(lname)) {
+            query[name] = headers[name];
+            delete headers[name];
+        }
+    }
+    return {
+        ...request,
+        headers,
+        query,
+    };
+};
+
+const prepareRequest = (request) => {
+    request = protocolHttp.HttpRequest.clone(request);
+    for (const headerName of Object.keys(request.headers)) {
+        if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) {
+            delete request.headers[headerName];
+        }
+    }
+    return request;
+};
+
+const getCanonicalQuery = ({ query = {} }) => {
+    const keys = [];
+    const serialized = {};
+    for (const key of Object.keys(query)) {
+        if (key.toLowerCase() === SIGNATURE_HEADER) {
+            continue;
+        }
+        const encodedKey = utilUriEscape.escapeUri(key);
+        keys.push(encodedKey);
+        const value = query[key];
+        if (typeof value === "string") {
+            serialized[encodedKey] = `${encodedKey}=${utilUriEscape.escapeUri(value)}`;
+        }
+        else if (Array.isArray(value)) {
+            serialized[encodedKey] = value
+                .slice(0)
+                .reduce((encoded, value) => encoded.concat([`${encodedKey}=${utilUriEscape.escapeUri(value)}`]), [])
+                .sort()
+                .join("&");
+        }
+    }
+    return keys
+        .sort()
+        .map((key) => serialized[key])
+        .filter((serialized) => serialized)
+        .join("&");
+};
+
+const iso8601 = (time) => toDate(time)
+    .toISOString()
+    .replace(/\.\d{3}Z$/, "Z");
+const toDate = (time) => {
+    if (typeof time === "number") {
+        return new Date(time * 1000);
+    }
+    if (typeof time === "string") {
+        if (Number(time)) {
+            return new Date(Number(time) * 1000);
+        }
+        return new Date(time);
+    }
+    return time;
+};
+
+class SignatureV4Base {
+    service;
+    regionProvider;
+    credentialProvider;
+    sha256;
+    uriEscapePath;
+    applyChecksum;
+    constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) {
+        this.service = service;
+        this.sha256 = sha256;
+        this.uriEscapePath = uriEscapePath;
+        this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true;
+        this.regionProvider = utilMiddleware.normalizeProvider(region);
+        this.credentialProvider = utilMiddleware.normalizeProvider(credentials);
+    }
+    createCanonicalRequest(request, canonicalHeaders, payloadHash) {
+        const sortedHeaders = Object.keys(canonicalHeaders).sort();
+        return `${request.method}
+${this.getCanonicalPath(request)}
+${getCanonicalQuery(request)}
+${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")}
+
+${sortedHeaders.join(";")}
+${payloadHash}`;
+    }
+    async createStringToSign(longDate, credentialScope, canonicalRequest, algorithmIdentifier) {
+        const hash = new this.sha256();
+        hash.update(utilUtf8.toUint8Array(canonicalRequest));
+        const hashedRequest = await hash.digest();
+        return `${algorithmIdentifier}
+${longDate}
+${credentialScope}
+${utilHexEncoding.toHex(hashedRequest)}`;
+    }
+    getCanonicalPath({ path }) {
+        if (this.uriEscapePath) {
+            const normalizedPathSegments = [];
+            for (const pathSegment of path.split("/")) {
+                if (pathSegment?.length === 0)
+                    continue;
+                if (pathSegment === ".")
+                    continue;
+                if (pathSegment === "..") {
+                    normalizedPathSegments.pop();
+                }
+                else {
+                    normalizedPathSegments.push(pathSegment);
+                }
+            }
+            const normalizedPath = `${path?.startsWith("/") ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && path?.endsWith("/") ? "/" : ""}`;
+            const doubleEncoded = utilUriEscape.escapeUri(normalizedPath);
+            return doubleEncoded.replace(/%2F/g, "/");
+        }
+        return path;
+    }
+    validateResolvedCredentials(credentials) {
+        if (typeof credentials !== "object" ||
+            typeof credentials.accessKeyId !== "string" ||
+            typeof credentials.secretAccessKey !== "string") {
+            throw new Error("Resolved credential object is not valid");
+        }
+    }
+    formatDate(now) {
+        const longDate = iso8601(now).replace(/[\-:]/g, "");
+        return {
+            longDate,
+            shortDate: longDate.slice(0, 8),
+        };
+    }
+    getCanonicalHeaderList(headers) {
+        return Object.keys(headers).sort().join(";");
+    }
+}
+
+class SignatureV4 extends SignatureV4Base {
+    headerFormatter = new HeaderFormatter();
+    constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) {
+        super({
+            applyChecksum,
+            credentials,
+            region,
+            service,
+            sha256,
+            uriEscapePath,
+        });
+    }
+    async presign(originalRequest, options = {}) {
+        const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, hoistableHeaders, signingRegion, signingService, } = options;
+        const credentials = await this.credentialProvider();
+        this.validateResolvedCredentials(credentials);
+        const region = signingRegion ?? (await this.regionProvider());
+        const { longDate, shortDate } = this.formatDate(signingDate);
+        if (expiresIn > MAX_PRESIGNED_TTL) {
+            return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future");
+        }
+        const scope = createScope(shortDate, region, signingService ?? this.service);
+        const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders });
+        if (credentials.sessionToken) {
+            request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken;
+        }
+        request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER;
+        request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`;
+        request.query[AMZ_DATE_QUERY_PARAM] = longDate;
+        request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10);
+        const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders);
+        request.query[SIGNED_HEADERS_QUERY_PARAM] = this.getCanonicalHeaderList(canonicalHeaders);
+        request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)));
+        return request;
+    }
+    async sign(toSign, options) {
+        if (typeof toSign === "string") {
+            return this.signString(toSign, options);
+        }
+        else if (toSign.headers && toSign.payload) {
+            return this.signEvent(toSign, options);
+        }
+        else if (toSign.message) {
+            return this.signMessage(toSign, options);
+        }
+        else {
+            return this.signRequest(toSign, options);
+        }
+    }
+    async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) {
+        const region = signingRegion ?? (await this.regionProvider());
+        const { shortDate, longDate } = this.formatDate(signingDate);
+        const scope = createScope(shortDate, region, signingService ?? this.service);
+        const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256);
+        const hash = new this.sha256();
+        hash.update(headers);
+        const hashedHeaders = utilHexEncoding.toHex(await hash.digest());
+        const stringToSign = [
+            EVENT_ALGORITHM_IDENTIFIER,
+            longDate,
+            scope,
+            priorSignature,
+            hashedHeaders,
+            hashedPayload,
+        ].join("\n");
+        return this.signString(stringToSign, { signingDate, signingRegion: region, signingService });
+    }
+    async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) {
+        const promise = this.signEvent({
+            headers: this.headerFormatter.format(signableMessage.message.headers),
+            payload: signableMessage.message.body,
+        }, {
+            signingDate,
+            signingRegion,
+            signingService,
+            priorSignature: signableMessage.priorSignature,
+        });
+        return promise.then((signature) => {
+            return { message: signableMessage.message, signature };
+        });
+    }
+    async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) {
+        const credentials = await this.credentialProvider();
+        this.validateResolvedCredentials(credentials);
+        const region = signingRegion ?? (await this.regionProvider());
+        const { shortDate } = this.formatDate(signingDate);
+        const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService));
+        hash.update(utilUtf8.toUint8Array(stringToSign));
+        return utilHexEncoding.toHex(await hash.digest());
+    }
+    async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) {
+        const credentials = await this.credentialProvider();
+        this.validateResolvedCredentials(credentials);
+        const region = signingRegion ?? (await this.regionProvider());
+        const request = prepareRequest(requestToSign);
+        const { longDate, shortDate } = this.formatDate(signingDate);
+        const scope = createScope(shortDate, region, signingService ?? this.service);
+        request.headers[AMZ_DATE_HEADER] = longDate;
+        if (credentials.sessionToken) {
+            request.headers[TOKEN_HEADER] = credentials.sessionToken;
+        }
+        const payloadHash = await getPayloadHash(request, this.sha256);
+        if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) {
+            request.headers[SHA256_HEADER] = payloadHash;
+        }
+        const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders);
+        const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash));
+        request.headers[AUTH_HEADER] =
+            `${ALGORITHM_IDENTIFIER} ` +
+                `Credential=${credentials.accessKeyId}/${scope}, ` +
+                `SignedHeaders=${this.getCanonicalHeaderList(canonicalHeaders)}, ` +
+                `Signature=${signature}`;
+        return request;
+    }
+    async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) {
+        const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest, ALGORITHM_IDENTIFIER);
+        const hash = new this.sha256(await keyPromise);
+        hash.update(utilUtf8.toUint8Array(stringToSign));
+        return utilHexEncoding.toHex(await hash.digest());
+    }
+    getSigningKey(credentials, region, shortDate, service) {
+        return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service);
+    }
+}
+
+const signatureV4aContainer = {
+    SignatureV4a: null,
+};
+
+exports.ALGORITHM_IDENTIFIER = ALGORITHM_IDENTIFIER;
+exports.ALGORITHM_IDENTIFIER_V4A = ALGORITHM_IDENTIFIER_V4A;
+exports.ALGORITHM_QUERY_PARAM = ALGORITHM_QUERY_PARAM;
+exports.ALWAYS_UNSIGNABLE_HEADERS = ALWAYS_UNSIGNABLE_HEADERS;
+exports.AMZ_DATE_HEADER = AMZ_DATE_HEADER;
+exports.AMZ_DATE_QUERY_PARAM = AMZ_DATE_QUERY_PARAM;
+exports.AUTH_HEADER = AUTH_HEADER;
+exports.CREDENTIAL_QUERY_PARAM = CREDENTIAL_QUERY_PARAM;
+exports.DATE_HEADER = DATE_HEADER;
+exports.EVENT_ALGORITHM_IDENTIFIER = EVENT_ALGORITHM_IDENTIFIER;
+exports.EXPIRES_QUERY_PARAM = EXPIRES_QUERY_PARAM;
+exports.GENERATED_HEADERS = GENERATED_HEADERS;
+exports.HOST_HEADER = HOST_HEADER;
+exports.KEY_TYPE_IDENTIFIER = KEY_TYPE_IDENTIFIER;
+exports.MAX_CACHE_SIZE = MAX_CACHE_SIZE;
+exports.MAX_PRESIGNED_TTL = MAX_PRESIGNED_TTL;
+exports.PROXY_HEADER_PATTERN = PROXY_HEADER_PATTERN;
+exports.REGION_SET_PARAM = REGION_SET_PARAM;
+exports.SEC_HEADER_PATTERN = SEC_HEADER_PATTERN;
+exports.SHA256_HEADER = SHA256_HEADER;
+exports.SIGNATURE_HEADER = SIGNATURE_HEADER;
+exports.SIGNATURE_QUERY_PARAM = SIGNATURE_QUERY_PARAM;
+exports.SIGNED_HEADERS_QUERY_PARAM = SIGNED_HEADERS_QUERY_PARAM;
+exports.SignatureV4 = SignatureV4;
+exports.SignatureV4Base = SignatureV4Base;
+exports.TOKEN_HEADER = TOKEN_HEADER;
+exports.TOKEN_QUERY_PARAM = TOKEN_QUERY_PARAM;
+exports.UNSIGNABLE_PATTERNS = UNSIGNABLE_PATTERNS;
+exports.UNSIGNED_PAYLOAD = UNSIGNED_PAYLOAD;
+exports.clearCredentialCache = clearCredentialCache;
+exports.createScope = createScope;
+exports.getCanonicalHeaders = getCanonicalHeaders;
+exports.getCanonicalQuery = getCanonicalQuery;
+exports.getPayloadHash = getPayloadHash;
+exports.getSigningKey = getSigningKey;
+exports.hasHeader = hasHeader;
+exports.moveHeadersToQuery = moveHeadersToQuery;
+exports.prepareRequest = prepareRequest;
+exports.signatureV4aContainer = signatureV4aContainer;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/signature-v4/node_modules/@smithy/is-array-buffer/dist-cjs/index.js

@@ -0,0 +1,6 @@
+'use strict';
+
+const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
+    Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
+
+exports.isArrayBuffer = isArrayBuffer;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/signature-v4/node_modules/@smithy/util-hex-encoding/dist-cjs/index.js

@@ -0,0 +1,38 @@
+'use strict';
+
+const SHORT_TO_HEX = {};
+const HEX_TO_SHORT = {};
+for (let i = 0; i < 256; i++) {
+    let encodedByte = i.toString(16).toLowerCase();
+    if (encodedByte.length === 1) {
+        encodedByte = `0${encodedByte}`;
+    }
+    SHORT_TO_HEX[i] = encodedByte;
+    HEX_TO_SHORT[encodedByte] = i;
+}
+function fromHex(encoded) {
+    if (encoded.length % 2 !== 0) {
+        throw new Error("Hex encoded strings must have an even number length");
+    }
+    const out = new Uint8Array(encoded.length / 2);
+    for (let i = 0; i < encoded.length; i += 2) {
+        const encodedByte = encoded.slice(i, i + 2).toLowerCase();
+        if (encodedByte in HEX_TO_SHORT) {
+            out[i / 2] = HEX_TO_SHORT[encodedByte];
+        }
+        else {
+            throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`);
+        }
+    }
+    return out;
+}
+function toHex(bytes) {
+    let out = "";
+    for (let i = 0; i < bytes.byteLength; i++) {
+        out += SHORT_TO_HEX[bytes[i]];
+    }
+    return out;
+}
+
+exports.fromHex = fromHex;
+exports.toHex = toHex;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/signature-v4/node_modules/@smithy/util-uri-escape/dist-cjs/index.js

@@ -0,0 +1,9 @@
+'use strict';
+
+const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode);
+const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`;
+
+const escapeUriPath = (uri) => uri.split("/").map(escapeUri).join("/");
+
+exports.escapeUri = escapeUri;
+exports.escapeUriPath = escapeUriPath;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/smithy-client/dist-cjs/index.js

@@ -0,0 +1,589 @@
+'use strict';
+
+var middlewareStack = require('@smithy/middleware-stack');
+var protocols = require('@smithy/core/protocols');
+var types = require('@smithy/types');
+var schema = require('@smithy/core/schema');
+var serde = require('@smithy/core/serde');
+
+class Client {
+    config;
+    middlewareStack = middlewareStack.constructStack();
+    initConfig;
+    handlers;
+    constructor(config) {
+        this.config = config;
+    }
+    send(command, optionsOrCb, cb) {
+        const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
+        const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
+        const useHandlerCache = options === undefined && this.config.cacheMiddleware === true;
+        let handler;
+        if (useHandlerCache) {
+            if (!this.handlers) {
+                this.handlers = new WeakMap();
+            }
+            const handlers = this.handlers;
+            if (handlers.has(command.constructor)) {
+                handler = handlers.get(command.constructor);
+            }
+            else {
+                handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+                handlers.set(command.constructor, handler);
+            }
+        }
+        else {
+            delete this.handlers;
+            handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+        }
+        if (callback) {
+            handler(command)
+                .then((result) => callback(null, result.output), (err) => callback(err))
+                .catch(() => { });
+        }
+        else {
+            return handler(command).then((result) => result.output);
+        }
+    }
+    destroy() {
+        this.config?.requestHandler?.destroy?.();
+        delete this.handlers;
+    }
+}
+
+const SENSITIVE_STRING$1 = "***SensitiveInformation***";
+function schemaLogFilter(schema$1, data) {
+    if (data == null) {
+        return data;
+    }
+    const ns = schema.NormalizedSchema.of(schema$1);
+    if (ns.getMergedTraits().sensitive) {
+        return SENSITIVE_STRING$1;
+    }
+    if (ns.isListSchema()) {
+        const isSensitive = !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isMapSchema()) {
+        const isSensitive = !!ns.getKeySchema().getMergedTraits().sensitive || !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isStructSchema() && typeof data === "object") {
+        const object = data;
+        const newObject = {};
+        for (const [member, memberNs] of ns.structIterator()) {
+            if (object[member] != null) {
+                newObject[member] = schemaLogFilter(memberNs, object[member]);
+            }
+        }
+        return newObject;
+    }
+    return data;
+}
+
+class Command {
+    middlewareStack = middlewareStack.constructStack();
+    schema;
+    static classBuilder() {
+        return new ClassBuilder();
+    }
+    resolveMiddlewareWithContext(clientStack, configuration, options, { middlewareFn, clientName, commandName, inputFilterSensitiveLog, outputFilterSensitiveLog, smithyContext, additionalContext, CommandCtor, }) {
+        for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) {
+            this.middlewareStack.use(mw);
+        }
+        const stack = clientStack.concat(this.middlewareStack);
+        const { logger } = configuration;
+        const handlerExecutionContext = {
+            logger,
+            clientName,
+            commandName,
+            inputFilterSensitiveLog,
+            outputFilterSensitiveLog,
+            [types.SMITHY_CONTEXT_KEY]: {
+                commandInstance: this,
+                ...smithyContext,
+            },
+            ...additionalContext,
+        };
+        const { requestHandler } = configuration;
+        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
+    }
+}
+class ClassBuilder {
+    _init = () => { };
+    _ep = {};
+    _middlewareFn = () => [];
+    _commandName = "";
+    _clientName = "";
+    _additionalContext = {};
+    _smithyContext = {};
+    _inputFilterSensitiveLog = undefined;
+    _outputFilterSensitiveLog = undefined;
+    _serializer = null;
+    _deserializer = null;
+    _operationSchema;
+    init(cb) {
+        this._init = cb;
+    }
+    ep(endpointParameterInstructions) {
+        this._ep = endpointParameterInstructions;
+        return this;
+    }
+    m(middlewareSupplier) {
+        this._middlewareFn = middlewareSupplier;
+        return this;
+    }
+    s(service, operation, smithyContext = {}) {
+        this._smithyContext = {
+            service,
+            operation,
+            ...smithyContext,
+        };
+        return this;
+    }
+    c(additionalContext = {}) {
+        this._additionalContext = additionalContext;
+        return this;
+    }
+    n(clientName, commandName) {
+        this._clientName = clientName;
+        this._commandName = commandName;
+        return this;
+    }
+    f(inputFilter = (_) => _, outputFilter = (_) => _) {
+        this._inputFilterSensitiveLog = inputFilter;
+        this._outputFilterSensitiveLog = outputFilter;
+        return this;
+    }
+    ser(serializer) {
+        this._serializer = serializer;
+        return this;
+    }
+    de(deserializer) {
+        this._deserializer = deserializer;
+        return this;
+    }
+    sc(operation) {
+        this._operationSchema = operation;
+        this._smithyContext.operationSchema = operation;
+        return this;
+    }
+    build() {
+        const closure = this;
+        let CommandRef;
+        return (CommandRef = class extends Command {
+            input;
+            static getEndpointParameterInstructions() {
+                return closure._ep;
+            }
+            constructor(...[input]) {
+                super();
+                this.input = input ?? {};
+                closure._init(this);
+                this.schema = closure._operationSchema;
+            }
+            resolveMiddleware(stack, configuration, options) {
+                const op = closure._operationSchema;
+                const input = op?.[4] ?? op?.input;
+                const output = op?.[5] ?? op?.output;
+                return this.resolveMiddlewareWithContext(stack, configuration, options, {
+                    CommandCtor: CommandRef,
+                    middlewareFn: closure._middlewareFn,
+                    clientName: closure._clientName,
+                    commandName: closure._commandName,
+                    inputFilterSensitiveLog: closure._inputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, input) : (_) => _),
+                    outputFilterSensitiveLog: closure._outputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, output) : (_) => _),
+                    smithyContext: closure._smithyContext,
+                    additionalContext: closure._additionalContext,
+                });
+            }
+            serialize = closure._serializer;
+            deserialize = closure._deserializer;
+        });
+    }
+}
+
+const SENSITIVE_STRING = "***SensitiveInformation***";
+
+const createAggregatedClient = (commands, Client) => {
+    for (const command of Object.keys(commands)) {
+        const CommandCtor = commands[command];
+        const methodImpl = async function (args, optionsOrCb, cb) {
+            const command = new CommandCtor(args);
+            if (typeof optionsOrCb === "function") {
+                this.send(command, optionsOrCb);
+            }
+            else if (typeof cb === "function") {
+                if (typeof optionsOrCb !== "object")
+                    throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
+                this.send(command, optionsOrCb || {}, cb);
+            }
+            else {
+                return this.send(command, optionsOrCb);
+            }
+        };
+        const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
+        Client.prototype[methodName] = methodImpl;
+    }
+};
+
+class ServiceException extends Error {
+    $fault;
+    $response;
+    $retryable;
+    $metadata;
+    constructor(options) {
+        super(options.message);
+        Object.setPrototypeOf(this, Object.getPrototypeOf(this).constructor.prototype);
+        this.name = options.name;
+        this.$fault = options.$fault;
+        this.$metadata = options.$metadata;
+    }
+    static isInstance(value) {
+        if (!value)
+            return false;
+        const candidate = value;
+        return (ServiceException.prototype.isPrototypeOf(candidate) ||
+            (Boolean(candidate.$fault) &&
+                Boolean(candidate.$metadata) &&
+                (candidate.$fault === "client" || candidate.$fault === "server")));
+    }
+    static [Symbol.hasInstance](instance) {
+        if (!instance)
+            return false;
+        const candidate = instance;
+        if (this === ServiceException) {
+            return ServiceException.isInstance(instance);
+        }
+        if (ServiceException.isInstance(instance)) {
+            if (candidate.name && this.name) {
+                return this.prototype.isPrototypeOf(instance) || candidate.name === this.name;
+            }
+            return this.prototype.isPrototypeOf(instance);
+        }
+        return false;
+    }
+}
+const decorateServiceException = (exception, additions = {}) => {
+    Object.entries(additions)
+        .filter(([, v]) => v !== undefined)
+        .forEach(([k, v]) => {
+        if (exception[k] == undefined || exception[k] === "") {
+            exception[k] = v;
+        }
+    });
+    const message = exception.message || exception.Message || "UnknownError";
+    exception.message = message;
+    delete exception.Message;
+    return exception;
+};
+
+const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
+    const $metadata = deserializeMetadata(output);
+    const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
+    const response = new exceptionCtor({
+        name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || "UnknownError",
+        $fault: "client",
+        $metadata,
+    });
+    throw decorateServiceException(response, parsedBody);
+};
+const withBaseException = (ExceptionCtor) => {
+    return ({ output, parsedBody, errorCode }) => {
+        throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
+    };
+};
+const deserializeMetadata = (output) => ({
+    httpStatusCode: output.statusCode,
+    requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
+    extendedRequestId: output.headers["x-amz-id-2"],
+    cfId: output.headers["x-amz-cf-id"],
+});
+
+const loadConfigsForDefaultMode = (mode) => {
+    switch (mode) {
+        case "standard":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "in-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 1100,
+            };
+        case "cross-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "mobile":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 30000,
+            };
+        default:
+            return {};
+    }
+};
+
+let warningEmitted = false;
+const emitWarningIfUnsupportedVersion = (version) => {
+    if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
+        warningEmitted = true;
+    }
+};
+
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    for (const id in types.AlgorithmId) {
+        const algorithmId = types.AlgorithmId[id];
+        if (runtimeConfig[algorithmId] === undefined) {
+            continue;
+        }
+        checksumAlgorithms.push({
+            algorithmId: () => algorithmId,
+            checksumConstructor: () => runtimeConfig[algorithmId],
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getRetryConfiguration = (runtimeConfig) => {
+    return {
+        setRetryStrategy(retryStrategy) {
+            runtimeConfig.retryStrategy = retryStrategy;
+        },
+        retryStrategy() {
+            return runtimeConfig.retryStrategy;
+        },
+    };
+};
+const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
+    const runtimeConfig = {};
+    runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
+    return runtimeConfig;
+};
+
+const getDefaultExtensionConfiguration = (runtimeConfig) => {
+    return Object.assign(getChecksumConfiguration(runtimeConfig), getRetryConfiguration(runtimeConfig));
+};
+const getDefaultClientConfiguration = getDefaultExtensionConfiguration;
+const resolveDefaultRuntimeConfig = (config) => {
+    return Object.assign(resolveChecksumRuntimeConfig(config), resolveRetryRuntimeConfig(config));
+};
+
+const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
+
+const getValueFromTextNode = (obj) => {
+    const textNodeName = "#text";
+    for (const key in obj) {
+        if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
+            obj[key] = obj[key][textNodeName];
+        }
+        else if (typeof obj[key] === "object" && obj[key] !== null) {
+            obj[key] = getValueFromTextNode(obj[key]);
+        }
+    }
+    return obj;
+};
+
+const isSerializableHeaderValue = (value) => {
+    return value != null;
+};
+
+class NoOpLogger {
+    trace() { }
+    debug() { }
+    info() { }
+    warn() { }
+    error() { }
+}
+
+function map(arg0, arg1, arg2) {
+    let target;
+    let filter;
+    let instructions;
+    if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
+        target = {};
+        instructions = arg0;
+    }
+    else {
+        target = arg0;
+        if (typeof arg1 === "function") {
+            filter = arg1;
+            instructions = arg2;
+            return mapWithFilter(target, filter, instructions);
+        }
+        else {
+            instructions = arg1;
+        }
+    }
+    for (const key of Object.keys(instructions)) {
+        if (!Array.isArray(instructions[key])) {
+            target[key] = instructions[key];
+            continue;
+        }
+        applyInstruction(target, null, instructions, key);
+    }
+    return target;
+}
+const convertMap = (target) => {
+    const output = {};
+    for (const [k, v] of Object.entries(target || {})) {
+        output[k] = [, v];
+    }
+    return output;
+};
+const take = (source, instructions) => {
+    const out = {};
+    for (const key in instructions) {
+        applyInstruction(out, source, instructions, key);
+    }
+    return out;
+};
+const mapWithFilter = (target, filter, instructions) => {
+    return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
+        if (Array.isArray(value)) {
+            _instructions[key] = value;
+        }
+        else {
+            if (typeof value === "function") {
+                _instructions[key] = [filter, value()];
+            }
+            else {
+                _instructions[key] = [filter, value];
+            }
+        }
+        return _instructions;
+    }, {}));
+};
+const applyInstruction = (target, source, instructions, targetKey) => {
+    if (source !== null) {
+        let instruction = instructions[targetKey];
+        if (typeof instruction === "function") {
+            instruction = [, instruction];
+        }
+        const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
+        if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
+            target[targetKey] = valueFn(source[sourceKey]);
+        }
+        return;
+    }
+    let [filter, value] = instructions[targetKey];
+    if (typeof value === "function") {
+        let _value;
+        const defaultFilterPassed = filter === undefined && (_value = value()) != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed) {
+            target[targetKey] = _value;
+        }
+        else if (customFilterPassed) {
+            target[targetKey] = value();
+        }
+    }
+    else {
+        const defaultFilterPassed = filter === undefined && value != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed || customFilterPassed) {
+            target[targetKey] = value;
+        }
+    }
+};
+const nonNullish = (_) => _ != null;
+const pass = (_) => _;
+
+const serializeFloat = (value) => {
+    if (value !== value) {
+        return "NaN";
+    }
+    switch (value) {
+        case Infinity:
+            return "Infinity";
+        case -Infinity:
+            return "-Infinity";
+        default:
+            return value;
+    }
+};
+const serializeDateTime = (date) => date.toISOString().replace(".000Z", "Z");
+
+const _json = (obj) => {
+    if (obj == null) {
+        return {};
+    }
+    if (Array.isArray(obj)) {
+        return obj.filter((_) => _ != null).map(_json);
+    }
+    if (typeof obj === "object") {
+        const target = {};
+        for (const key of Object.keys(obj)) {
+            if (obj[key] == null) {
+                continue;
+            }
+            target[key] = _json(obj[key]);
+        }
+        return target;
+    }
+    return obj;
+};
+
+Object.defineProperty(exports, "collectBody", {
+    enumerable: true,
+    get: function () { return protocols.collectBody; }
+});
+Object.defineProperty(exports, "extendedEncodeURIComponent", {
+    enumerable: true,
+    get: function () { return protocols.extendedEncodeURIComponent; }
+});
+Object.defineProperty(exports, "resolvedPath", {
+    enumerable: true,
+    get: function () { return protocols.resolvedPath; }
+});
+exports.Client = Client;
+exports.Command = Command;
+exports.NoOpLogger = NoOpLogger;
+exports.SENSITIVE_STRING = SENSITIVE_STRING;
+exports.ServiceException = ServiceException;
+exports._json = _json;
+exports.convertMap = convertMap;
+exports.createAggregatedClient = createAggregatedClient;
+exports.decorateServiceException = decorateServiceException;
+exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
+exports.getArrayIfSingleItem = getArrayIfSingleItem;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
+exports.getValueFromTextNode = getValueFromTextNode;
+exports.isSerializableHeaderValue = isSerializableHeaderValue;
+exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
+exports.map = map;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
+exports.serializeDateTime = serializeDateTime;
+exports.serializeFloat = serializeFloat;
+exports.take = take;
+exports.throwDefaultError = throwDefaultError;
+exports.withBaseException = withBaseException;
+Object.keys(serde).forEach(function (k) {
+    if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+        enumerable: true,
+        get: function () { return serde[k]; }
+    });
+});

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/types/dist-cjs/index.js

@@ -0,0 +1,91 @@
+'use strict';
+
+exports.HttpAuthLocation = void 0;
+(function (HttpAuthLocation) {
+    HttpAuthLocation["HEADER"] = "header";
+    HttpAuthLocation["QUERY"] = "query";
+})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
+
+exports.HttpApiKeyAuthLocation = void 0;
+(function (HttpApiKeyAuthLocation) {
+    HttpApiKeyAuthLocation["HEADER"] = "header";
+    HttpApiKeyAuthLocation["QUERY"] = "query";
+})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
+
+exports.EndpointURLScheme = void 0;
+(function (EndpointURLScheme) {
+    EndpointURLScheme["HTTP"] = "http";
+    EndpointURLScheme["HTTPS"] = "https";
+})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
+
+exports.AlgorithmId = void 0;
+(function (AlgorithmId) {
+    AlgorithmId["MD5"] = "md5";
+    AlgorithmId["CRC32"] = "crc32";
+    AlgorithmId["CRC32C"] = "crc32c";
+    AlgorithmId["SHA1"] = "sha1";
+    AlgorithmId["SHA256"] = "sha256";
+})(exports.AlgorithmId || (exports.AlgorithmId = {}));
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    if (runtimeConfig.sha256 !== undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.SHA256,
+            checksumConstructor: () => runtimeConfig.sha256,
+        });
+    }
+    if (runtimeConfig.md5 != undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.MD5,
+            checksumConstructor: () => runtimeConfig.md5,
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getDefaultClientConfiguration = (runtimeConfig) => {
+    return getChecksumConfiguration(runtimeConfig);
+};
+const resolveDefaultRuntimeConfig = (config) => {
+    return resolveChecksumRuntimeConfig(config);
+};
+
+exports.FieldPosition = void 0;
+(function (FieldPosition) {
+    FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
+    FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
+})(exports.FieldPosition || (exports.FieldPosition = {}));
+
+const SMITHY_CONTEXT_KEY = "__smithy_context";
+
+exports.IniSectionType = void 0;
+(function (IniSectionType) {
+    IniSectionType["PROFILE"] = "profile";
+    IniSectionType["SSO_SESSION"] = "sso-session";
+    IniSectionType["SERVICES"] = "services";
+})(exports.IniSectionType || (exports.IniSectionType = {}));
+
+exports.RequestHandlerProtocol = void 0;
+(function (RequestHandlerProtocol) {
+    RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
+    RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
+    RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
+})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
+
+exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/util-base64/dist-cjs/fromBase64.js

@@ -0,0 +1,16 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.fromBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
+const fromBase64 = (input) => {
+    if ((input.length * 3) % 4 !== 0) {
+        throw new TypeError(`Incorrect padding on base64 string.`);
+    }
+    if (!BASE64_REGEX.exec(input)) {
+        throw new TypeError(`Invalid base64 string.`);
+    }
+    const buffer = (0, util_buffer_from_1.fromString)(input, "base64");
+    return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength);
+};
+exports.fromBase64 = fromBase64;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/util-base64/dist-cjs/index.js

@@ -0,0 +1,19 @@
+'use strict';
+
+var fromBase64 = require('./fromBase64');
+var toBase64 = require('./toBase64');
+
+
+
+Object.keys(fromBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return fromBase64[k]; }
+	});
+});
+Object.keys(toBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return toBase64[k]; }
+	});
+});

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/util-base64/dist-cjs/toBase64.js

@@ -0,0 +1,19 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.toBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const util_utf8_1 = require("@smithy/util-utf8");
+const toBase64 = (_input) => {
+    let input;
+    if (typeof _input === "string") {
+        input = (0, util_utf8_1.fromUtf8)(_input);
+    }
+    else {
+        input = _input;
+    }
+    if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") {
+        throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array.");
+    }
+    return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64");
+};
+exports.toBase64 = toBase64;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/dist-cjs/index.js

@@ -0,0 +1,20 @@
+'use strict';
+
+var isArrayBuffer = require('@smithy/is-array-buffer');
+var buffer = require('buffer');
+
+const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => {
+    if (!isArrayBuffer.isArrayBuffer(input)) {
+        throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`);
+    }
+    return buffer.Buffer.from(input, offset, length);
+};
+const fromString = (input, encoding) => {
+    if (typeof input !== "string") {
+        throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`);
+    }
+    return encoding ? buffer.Buffer.from(input, encoding) : buffer.Buffer.from(input);
+};
+
+exports.fromArrayBuffer = fromArrayBuffer;
+exports.fromString = fromString;

extracted-source/node_modules/@aws-sdk/core/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/node_modules/@smithy/is-array-buffer/dist-cjs/index.js

@@ -0,0 +1,6 @@
+'use strict';
+
+const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
+    Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
+
+exports.isArrayBuffer = isArrayBuffer;