Add extracted source directory and README navigation

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/STSClient.js

@@ -0,0 +1,54 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.STSClient = exports.__Client = void 0;
+const middleware_host_header_1 = require("@aws-sdk/middleware-host-header");
+const middleware_logger_1 = require("@aws-sdk/middleware-logger");
+const middleware_recursion_detection_1 = require("@aws-sdk/middleware-recursion-detection");
+const middleware_user_agent_1 = require("@aws-sdk/middleware-user-agent");
+const config_resolver_1 = require("@smithy/config-resolver");
+const core_1 = require("@smithy/core");
+const schema_1 = require("@smithy/core/schema");
+const middleware_content_length_1 = require("@smithy/middleware-content-length");
+const middleware_endpoint_1 = require("@smithy/middleware-endpoint");
+const middleware_retry_1 = require("@smithy/middleware-retry");
+const smithy_client_1 = require("@smithy/smithy-client");
+Object.defineProperty(exports, "__Client", { enumerable: true, get: function () { return smithy_client_1.Client; } });
+const httpAuthSchemeProvider_1 = require("./auth/httpAuthSchemeProvider");
+const EndpointParameters_1 = require("./endpoint/EndpointParameters");
+const runtimeConfig_1 = require("./runtimeConfig");
+const runtimeExtensions_1 = require("./runtimeExtensions");
+class STSClient extends smithy_client_1.Client {
+    config;
+    constructor(...[configuration]) {
+        const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {});
+        super(_config_0);
+        this.initConfig = _config_0;
+        const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0);
+        const _config_2 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_1);
+        const _config_3 = (0, middleware_retry_1.resolveRetryConfig)(_config_2);
+        const _config_4 = (0, config_resolver_1.resolveRegionConfig)(_config_3);
+        const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4);
+        const _config_6 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_5);
+        const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6);
+        const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []);
+        this.config = _config_8;
+        this.middlewareStack.use((0, schema_1.getSchemaSerdePlugin)(this.config));
+        this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config));
+        this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config));
+        this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config));
+        this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config));
+        this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config));
+        this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config));
+        this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, {
+            httpAuthSchemeParametersProvider: httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider,
+            identityProviderConfigProvider: async (config) => new core_1.DefaultIdentityProviderConfig({
+                "aws.auth#sigv4": config.credentials,
+            }),
+        }));
+        this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config));
+    }
+    destroy() {
+        super.destroy();
+    }
+}
+exports.STSClient = STSClient;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthExtensionConfiguration.js

@@ -0,0 +1,43 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolveHttpAuthRuntimeConfig = exports.getHttpAuthExtensionConfiguration = void 0;
+const getHttpAuthExtensionConfiguration = (runtimeConfig) => {
+    const _httpAuthSchemes = runtimeConfig.httpAuthSchemes;
+    let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider;
+    let _credentials = runtimeConfig.credentials;
+    return {
+        setHttpAuthScheme(httpAuthScheme) {
+            const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId);
+            if (index === -1) {
+                _httpAuthSchemes.push(httpAuthScheme);
+            }
+            else {
+                _httpAuthSchemes.splice(index, 1, httpAuthScheme);
+            }
+        },
+        httpAuthSchemes() {
+            return _httpAuthSchemes;
+        },
+        setHttpAuthSchemeProvider(httpAuthSchemeProvider) {
+            _httpAuthSchemeProvider = httpAuthSchemeProvider;
+        },
+        httpAuthSchemeProvider() {
+            return _httpAuthSchemeProvider;
+        },
+        setCredentials(credentials) {
+            _credentials = credentials;
+        },
+        credentials() {
+            return _credentials;
+        },
+    };
+};
+exports.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration;
+const resolveHttpAuthRuntimeConfig = (config) => {
+    return {
+        httpAuthSchemes: config.httpAuthSchemes(),
+        httpAuthSchemeProvider: config.httpAuthSchemeProvider(),
+        credentials: config.credentials(),
+    };
+};
+exports.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/auth/httpAuthSchemeProvider.js

@@ -0,0 +1,66 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolveHttpAuthSchemeConfig = exports.resolveStsAuthConfig = exports.defaultSTSHttpAuthSchemeProvider = exports.defaultSTSHttpAuthSchemeParametersProvider = void 0;
+const core_1 = require("@aws-sdk/core");
+const util_middleware_1 = require("@smithy/util-middleware");
+const STSClient_1 = require("../STSClient");
+const defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => {
+    return {
+        operation: (0, util_middleware_1.getSmithyContext)(context).operation,
+        region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) ||
+            (() => {
+                throw new Error("expected `region` to be configured for `aws.auth#sigv4`");
+            })(),
+    };
+};
+exports.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider;
+function createAwsAuthSigv4HttpAuthOption(authParameters) {
+    return {
+        schemeId: "aws.auth#sigv4",
+        signingProperties: {
+            name: "sts",
+            region: authParameters.region,
+        },
+        propertiesExtractor: (config, context) => ({
+            signingProperties: {
+                config,
+                context,
+            },
+        }),
+    };
+}
+function createSmithyApiNoAuthHttpAuthOption(authParameters) {
+    return {
+        schemeId: "smithy.api#noAuth",
+    };
+}
+const defaultSTSHttpAuthSchemeProvider = (authParameters) => {
+    const options = [];
+    switch (authParameters.operation) {
+        case "AssumeRoleWithSAML": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        case "AssumeRoleWithWebIdentity": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        default: {
+            options.push(createAwsAuthSigv4HttpAuthOption(authParameters));
+        }
+    }
+    return options;
+};
+exports.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider;
+const resolveStsAuthConfig = (input) => Object.assign(input, {
+    stsClientCtor: STSClient_1.STSClient,
+});
+exports.resolveStsAuthConfig = resolveStsAuthConfig;
+const resolveHttpAuthSchemeConfig = (config) => {
+    const config_0 = (0, exports.resolveStsAuthConfig)(config);
+    const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0);
+    return Object.assign(config_1, {
+        authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []),
+    });
+};
+exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/EndpointParameters.js

@@ -0,0 +1,19 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.commonParams = exports.resolveClientEndpointParameters = void 0;
+const resolveClientEndpointParameters = (options) => {
+    return Object.assign(options, {
+        useDualstackEndpoint: options.useDualstackEndpoint ?? false,
+        useFipsEndpoint: options.useFipsEndpoint ?? false,
+        useGlobalEndpoint: options.useGlobalEndpoint ?? false,
+        defaultSigningName: "sts",
+    });
+};
+exports.resolveClientEndpointParameters = resolveClientEndpointParameters;
+exports.commonParams = {
+    UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
+    UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
+    Endpoint: { type: "builtInParams", name: "endpoint" },
+    Region: { type: "builtInParams", name: "region" },
+    UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
+};

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/endpointResolver.js

@@ -0,0 +1,18 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.defaultEndpointResolver = void 0;
+const util_endpoints_1 = require("@aws-sdk/util-endpoints");
+const util_endpoints_2 = require("@smithy/util-endpoints");
+const ruleset_1 = require("./ruleset");
+const cache = new util_endpoints_2.EndpointCache({
+    size: 50,
+    params: ["Endpoint", "Region", "UseDualStack", "UseFIPS", "UseGlobalEndpoint"],
+});
+const defaultEndpointResolver = (endpointParams, context = {}) => {
+    return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, {
+        endpointParams: endpointParams,
+        logger: context.logger,
+    }));
+};
+exports.defaultEndpointResolver = defaultEndpointResolver;
+util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/endpoint/ruleset.js

@@ -0,0 +1,7 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.ruleSet = void 0;
+const F = "required", G = "type", H = "fn", I = "argv", J = "ref";
+const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "string" }, n = { [F]: true, "default": false, [G]: "boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y];
+const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] };
+exports.ruleSet = _data;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/index.js

@@ -0,0 +1,947 @@
+'use strict';
+
+var STSClient = require('./STSClient');
+var smithyClient = require('@smithy/smithy-client');
+var middlewareEndpoint = require('@smithy/middleware-endpoint');
+var EndpointParameters = require('./endpoint/EndpointParameters');
+var schema = require('@smithy/core/schema');
+var client = require('@aws-sdk/core/client');
+var regionConfigResolver = require('@aws-sdk/region-config-resolver');
+
+let STSServiceException$1 = class STSServiceException extends smithyClient.ServiceException {
+    constructor(options) {
+        super(options);
+        Object.setPrototypeOf(this, STSServiceException.prototype);
+    }
+};
+
+let ExpiredTokenException$1 = class ExpiredTokenException extends STSServiceException$1 {
+    name = "ExpiredTokenException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "ExpiredTokenException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, ExpiredTokenException.prototype);
+    }
+};
+let MalformedPolicyDocumentException$1 = class MalformedPolicyDocumentException extends STSServiceException$1 {
+    name = "MalformedPolicyDocumentException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "MalformedPolicyDocumentException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype);
+    }
+};
+let PackedPolicyTooLargeException$1 = class PackedPolicyTooLargeException extends STSServiceException$1 {
+    name = "PackedPolicyTooLargeException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "PackedPolicyTooLargeException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype);
+    }
+};
+let RegionDisabledException$1 = class RegionDisabledException extends STSServiceException$1 {
+    name = "RegionDisabledException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "RegionDisabledException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, RegionDisabledException.prototype);
+    }
+};
+let IDPRejectedClaimException$1 = class IDPRejectedClaimException extends STSServiceException$1 {
+    name = "IDPRejectedClaimException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "IDPRejectedClaimException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, IDPRejectedClaimException.prototype);
+    }
+};
+let InvalidIdentityTokenException$1 = class InvalidIdentityTokenException extends STSServiceException$1 {
+    name = "InvalidIdentityTokenException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "InvalidIdentityTokenException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype);
+    }
+};
+let IDPCommunicationErrorException$1 = class IDPCommunicationErrorException extends STSServiceException$1 {
+    name = "IDPCommunicationErrorException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "IDPCommunicationErrorException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype);
+    }
+};
+let InvalidAuthorizationMessageException$1 = class InvalidAuthorizationMessageException extends STSServiceException$1 {
+    name = "InvalidAuthorizationMessageException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "InvalidAuthorizationMessageException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, InvalidAuthorizationMessageException.prototype);
+    }
+};
+let ExpiredTradeInTokenException$1 = class ExpiredTradeInTokenException extends STSServiceException$1 {
+    name = "ExpiredTradeInTokenException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "ExpiredTradeInTokenException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, ExpiredTradeInTokenException.prototype);
+    }
+};
+let JWTPayloadSizeExceededException$1 = class JWTPayloadSizeExceededException extends STSServiceException$1 {
+    name = "JWTPayloadSizeExceededException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "JWTPayloadSizeExceededException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, JWTPayloadSizeExceededException.prototype);
+    }
+};
+let OutboundWebIdentityFederationDisabledException$1 = class OutboundWebIdentityFederationDisabledException extends STSServiceException$1 {
+    name = "OutboundWebIdentityFederationDisabledException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "OutboundWebIdentityFederationDisabledException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, OutboundWebIdentityFederationDisabledException.prototype);
+    }
+};
+let SessionDurationEscalationException$1 = class SessionDurationEscalationException extends STSServiceException$1 {
+    name = "SessionDurationEscalationException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "SessionDurationEscalationException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, SessionDurationEscalationException.prototype);
+    }
+};
+
+const _A = "Arn";
+const _AKI = "AccessKeyId";
+const _AP = "AssumedPrincipal";
+const _AR = "AssumeRole";
+const _ARI = "AssumedRoleId";
+const _ARR = "AssumeRoleRequest";
+const _ARRs = "AssumeRoleResponse";
+const _ARRss = "AssumeRootRequest";
+const _ARRssu = "AssumeRootResponse";
+const _ARU = "AssumedRoleUser";
+const _ARWSAML = "AssumeRoleWithSAML";
+const _ARWSAMLR = "AssumeRoleWithSAMLRequest";
+const _ARWSAMLRs = "AssumeRoleWithSAMLResponse";
+const _ARWWI = "AssumeRoleWithWebIdentity";
+const _ARWWIR = "AssumeRoleWithWebIdentityRequest";
+const _ARWWIRs = "AssumeRoleWithWebIdentityResponse";
+const _ARs = "AssumeRoot";
+const _Ac = "Account";
+const _Au = "Audience";
+const _C = "Credentials";
+const _CA = "ContextAssertion";
+const _DAM = "DecodeAuthorizationMessage";
+const _DAMR = "DecodeAuthorizationMessageRequest";
+const _DAMRe = "DecodeAuthorizationMessageResponse";
+const _DM = "DecodedMessage";
+const _DS = "DurationSeconds";
+const _E = "Expiration";
+const _EI = "ExternalId";
+const _EM = "EncodedMessage";
+const _ETE = "ExpiredTokenException";
+const _ETITE = "ExpiredTradeInTokenException";
+const _FU = "FederatedUser";
+const _FUI = "FederatedUserId";
+const _GAKI = "GetAccessKeyInfo";
+const _GAKIR = "GetAccessKeyInfoRequest";
+const _GAKIRe = "GetAccessKeyInfoResponse";
+const _GCI = "GetCallerIdentity";
+const _GCIR = "GetCallerIdentityRequest";
+const _GCIRe = "GetCallerIdentityResponse";
+const _GDAT = "GetDelegatedAccessToken";
+const _GDATR = "GetDelegatedAccessTokenRequest";
+const _GDATRe = "GetDelegatedAccessTokenResponse";
+const _GFT = "GetFederationToken";
+const _GFTR = "GetFederationTokenRequest";
+const _GFTRe = "GetFederationTokenResponse";
+const _GST = "GetSessionToken";
+const _GSTR = "GetSessionTokenRequest";
+const _GSTRe = "GetSessionTokenResponse";
+const _GWIT = "GetWebIdentityToken";
+const _GWITR = "GetWebIdentityTokenRequest";
+const _GWITRe = "GetWebIdentityTokenResponse";
+const _I = "Issuer";
+const _IAME = "InvalidAuthorizationMessageException";
+const _IDPCEE = "IDPCommunicationErrorException";
+const _IDPRCE = "IDPRejectedClaimException";
+const _IITE = "InvalidIdentityTokenException";
+const _JWTPSEE = "JWTPayloadSizeExceededException";
+const _K = "Key";
+const _MPDE = "MalformedPolicyDocumentException";
+const _N = "Name";
+const _NQ = "NameQualifier";
+const _OWIFDE = "OutboundWebIdentityFederationDisabledException";
+const _P = "Policy";
+const _PA = "PolicyArns";
+const _PAr = "PrincipalArn";
+const _PAro = "ProviderArn";
+const _PC = "ProvidedContexts";
+const _PCLT = "ProvidedContextsListType";
+const _PCr = "ProvidedContext";
+const _PDT = "PolicyDescriptorType";
+const _PI = "ProviderId";
+const _PPS = "PackedPolicySize";
+const _PPTLE = "PackedPolicyTooLargeException";
+const _Pr = "Provider";
+const _RA = "RoleArn";
+const _RDE = "RegionDisabledException";
+const _RSN = "RoleSessionName";
+const _S = "Subject";
+const _SA = "SigningAlgorithm";
+const _SAK = "SecretAccessKey";
+const _SAMLA = "SAMLAssertion";
+const _SAMLAT = "SAMLAssertionType";
+const _SDEE = "SessionDurationEscalationException";
+const _SFWIT = "SubjectFromWebIdentityToken";
+const _SI = "SourceIdentity";
+const _SN = "SerialNumber";
+const _ST = "SubjectType";
+const _STe = "SessionToken";
+const _T = "Tags";
+const _TC = "TokenCode";
+const _TIT = "TradeInToken";
+const _TP = "TargetPrincipal";
+const _TPA = "TaskPolicyArn";
+const _TTK = "TransitiveTagKeys";
+const _Ta = "Tag";
+const _UI = "UserId";
+const _V = "Value";
+const _WIT = "WebIdentityToken";
+const _a = "arn";
+const _aKST = "accessKeySecretType";
+const _aQE = "awsQueryError";
+const _c = "client";
+const _cTT = "clientTokenType";
+const _e = "error";
+const _hE = "httpError";
+const _m = "message";
+const _pDLT = "policyDescriptorListType";
+const _s = "smithy.ts.sdk.synthetic.com.amazonaws.sts";
+const _tITT = "tradeInTokenType";
+const _tLT = "tagListType";
+const _wITT = "webIdentityTokenType";
+const n0 = "com.amazonaws.sts";
+var accessKeySecretType = [0, n0, _aKST, 8, 0];
+var clientTokenType = [0, n0, _cTT, 8, 0];
+var SAMLAssertionType = [0, n0, _SAMLAT, 8, 0];
+var tradeInTokenType = [0, n0, _tITT, 8, 0];
+var webIdentityTokenType = [0, n0, _wITT, 8, 0];
+var AssumedRoleUser = [3, n0, _ARU, 0, [_ARI, _A], [0, 0]];
+var AssumeRoleRequest = [
+    3,
+    n0,
+    _ARR,
+    0,
+    [_RA, _RSN, _PA, _P, _DS, _T, _TTK, _EI, _SN, _TC, _SI, _PC],
+    [0, 0, () => policyDescriptorListType, 0, 1, () => tagListType, 64 | 0, 0, 0, 0, 0, () => ProvidedContextsListType],
+];
+var AssumeRoleResponse = [
+    3,
+    n0,
+    _ARRs,
+    0,
+    [_C, _ARU, _PPS, _SI],
+    [[() => Credentials, 0], () => AssumedRoleUser, 1, 0],
+];
+var AssumeRoleWithSAMLRequest = [
+    3,
+    n0,
+    _ARWSAMLR,
+    0,
+    [_RA, _PAr, _SAMLA, _PA, _P, _DS],
+    [0, 0, [() => SAMLAssertionType, 0], () => policyDescriptorListType, 0, 1],
+];
+var AssumeRoleWithSAMLResponse = [
+    3,
+    n0,
+    _ARWSAMLRs,
+    0,
+    [_C, _ARU, _PPS, _S, _ST, _I, _Au, _NQ, _SI],
+    [[() => Credentials, 0], () => AssumedRoleUser, 1, 0, 0, 0, 0, 0, 0],
+];
+var AssumeRoleWithWebIdentityRequest = [
+    3,
+    n0,
+    _ARWWIR,
+    0,
+    [_RA, _RSN, _WIT, _PI, _PA, _P, _DS],
+    [0, 0, [() => clientTokenType, 0], 0, () => policyDescriptorListType, 0, 1],
+];
+var AssumeRoleWithWebIdentityResponse = [
+    3,
+    n0,
+    _ARWWIRs,
+    0,
+    [_C, _SFWIT, _ARU, _PPS, _Pr, _Au, _SI],
+    [[() => Credentials, 0], 0, () => AssumedRoleUser, 1, 0, 0, 0],
+];
+var AssumeRootRequest = [
+    3,
+    n0,
+    _ARRss,
+    0,
+    [_TP, _TPA, _DS],
+    [0, () => PolicyDescriptorType, 1],
+];
+var AssumeRootResponse = [3, n0, _ARRssu, 0, [_C, _SI], [[() => Credentials, 0], 0]];
+var Credentials = [
+    3,
+    n0,
+    _C,
+    0,
+    [_AKI, _SAK, _STe, _E],
+    [0, [() => accessKeySecretType, 0], 0, 4],
+];
+var DecodeAuthorizationMessageRequest = [3, n0, _DAMR, 0, [_EM], [0]];
+var DecodeAuthorizationMessageResponse = [3, n0, _DAMRe, 0, [_DM], [0]];
+var ExpiredTokenException = [
+    -3,
+    n0,
+    _ETE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`ExpiredTokenException`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(ExpiredTokenException, ExpiredTokenException$1);
+var ExpiredTradeInTokenException = [
+    -3,
+    n0,
+    _ETITE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`ExpiredTradeInTokenException`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(ExpiredTradeInTokenException, ExpiredTradeInTokenException$1);
+var FederatedUser = [3, n0, _FU, 0, [_FUI, _A], [0, 0]];
+var GetAccessKeyInfoRequest = [3, n0, _GAKIR, 0, [_AKI], [0]];
+var GetAccessKeyInfoResponse = [3, n0, _GAKIRe, 0, [_Ac], [0]];
+var GetCallerIdentityRequest = [3, n0, _GCIR, 0, [], []];
+var GetCallerIdentityResponse = [3, n0, _GCIRe, 0, [_UI, _Ac, _A], [0, 0, 0]];
+var GetDelegatedAccessTokenRequest = [
+    3,
+    n0,
+    _GDATR,
+    0,
+    [_TIT],
+    [[() => tradeInTokenType, 0]],
+];
+var GetDelegatedAccessTokenResponse = [
+    3,
+    n0,
+    _GDATRe,
+    0,
+    [_C, _PPS, _AP],
+    [[() => Credentials, 0], 1, 0],
+];
+var GetFederationTokenRequest = [
+    3,
+    n0,
+    _GFTR,
+    0,
+    [_N, _P, _PA, _DS, _T],
+    [0, 0, () => policyDescriptorListType, 1, () => tagListType],
+];
+var GetFederationTokenResponse = [
+    3,
+    n0,
+    _GFTRe,
+    0,
+    [_C, _FU, _PPS],
+    [[() => Credentials, 0], () => FederatedUser, 1],
+];
+var GetSessionTokenRequest = [3, n0, _GSTR, 0, [_DS, _SN, _TC], [1, 0, 0]];
+var GetSessionTokenResponse = [3, n0, _GSTRe, 0, [_C], [[() => Credentials, 0]]];
+var GetWebIdentityTokenRequest = [
+    3,
+    n0,
+    _GWITR,
+    0,
+    [_Au, _DS, _SA, _T],
+    [64 | 0, 1, 0, () => tagListType],
+];
+var GetWebIdentityTokenResponse = [
+    3,
+    n0,
+    _GWITRe,
+    0,
+    [_WIT, _E],
+    [[() => webIdentityTokenType, 0], 4],
+];
+var IDPCommunicationErrorException = [
+    -3,
+    n0,
+    _IDPCEE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`IDPCommunicationError`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(IDPCommunicationErrorException, IDPCommunicationErrorException$1);
+var IDPRejectedClaimException = [
+    -3,
+    n0,
+    _IDPRCE,
+    {
+        [_e]: _c,
+        [_hE]: 403,
+        [_aQE]: [`IDPRejectedClaim`, 403],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(IDPRejectedClaimException, IDPRejectedClaimException$1);
+var InvalidAuthorizationMessageException = [
+    -3,
+    n0,
+    _IAME,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`InvalidAuthorizationMessageException`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(InvalidAuthorizationMessageException, InvalidAuthorizationMessageException$1);
+var InvalidIdentityTokenException = [
+    -3,
+    n0,
+    _IITE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`InvalidIdentityToken`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(InvalidIdentityTokenException, InvalidIdentityTokenException$1);
+var JWTPayloadSizeExceededException = [
+    -3,
+    n0,
+    _JWTPSEE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`JWTPayloadSizeExceededException`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(JWTPayloadSizeExceededException, JWTPayloadSizeExceededException$1);
+var MalformedPolicyDocumentException = [
+    -3,
+    n0,
+    _MPDE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`MalformedPolicyDocument`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(MalformedPolicyDocumentException, MalformedPolicyDocumentException$1);
+var OutboundWebIdentityFederationDisabledException = [
+    -3,
+    n0,
+    _OWIFDE,
+    {
+        [_e]: _c,
+        [_hE]: 403,
+        [_aQE]: [`OutboundWebIdentityFederationDisabledException`, 403],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(OutboundWebIdentityFederationDisabledException, OutboundWebIdentityFederationDisabledException$1);
+var PackedPolicyTooLargeException = [
+    -3,
+    n0,
+    _PPTLE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+        [_aQE]: [`PackedPolicyTooLarge`, 400],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(PackedPolicyTooLargeException, PackedPolicyTooLargeException$1);
+var PolicyDescriptorType = [3, n0, _PDT, 0, [_a], [0]];
+var ProvidedContext = [3, n0, _PCr, 0, [_PAro, _CA], [0, 0]];
+var RegionDisabledException = [
+    -3,
+    n0,
+    _RDE,
+    {
+        [_e]: _c,
+        [_hE]: 403,
+        [_aQE]: [`RegionDisabledException`, 403],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(RegionDisabledException, RegionDisabledException$1);
+var SessionDurationEscalationException = [
+    -3,
+    n0,
+    _SDEE,
+    {
+        [_e]: _c,
+        [_hE]: 403,
+        [_aQE]: [`SessionDurationEscalationException`, 403],
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(SessionDurationEscalationException, SessionDurationEscalationException$1);
+var Tag = [3, n0, _Ta, 0, [_K, _V], [0, 0]];
+var STSServiceException = [-3, _s, "STSServiceException", 0, [], []];
+schema.TypeRegistry.for(_s).registerError(STSServiceException, STSServiceException$1);
+var policyDescriptorListType = [1, n0, _pDLT, 0, () => PolicyDescriptorType];
+var ProvidedContextsListType = [1, n0, _PCLT, 0, () => ProvidedContext];
+var tagListType = [1, n0, _tLT, 0, () => Tag];
+var AssumeRole = [9, n0, _AR, 0, () => AssumeRoleRequest, () => AssumeRoleResponse];
+var AssumeRoleWithSAML = [
+    9,
+    n0,
+    _ARWSAML,
+    0,
+    () => AssumeRoleWithSAMLRequest,
+    () => AssumeRoleWithSAMLResponse,
+];
+var AssumeRoleWithWebIdentity = [
+    9,
+    n0,
+    _ARWWI,
+    0,
+    () => AssumeRoleWithWebIdentityRequest,
+    () => AssumeRoleWithWebIdentityResponse,
+];
+var AssumeRoot = [9, n0, _ARs, 0, () => AssumeRootRequest, () => AssumeRootResponse];
+var DecodeAuthorizationMessage = [
+    9,
+    n0,
+    _DAM,
+    0,
+    () => DecodeAuthorizationMessageRequest,
+    () => DecodeAuthorizationMessageResponse,
+];
+var GetAccessKeyInfo = [
+    9,
+    n0,
+    _GAKI,
+    0,
+    () => GetAccessKeyInfoRequest,
+    () => GetAccessKeyInfoResponse,
+];
+var GetCallerIdentity = [
+    9,
+    n0,
+    _GCI,
+    0,
+    () => GetCallerIdentityRequest,
+    () => GetCallerIdentityResponse,
+];
+var GetDelegatedAccessToken = [
+    9,
+    n0,
+    _GDAT,
+    0,
+    () => GetDelegatedAccessTokenRequest,
+    () => GetDelegatedAccessTokenResponse,
+];
+var GetFederationToken = [
+    9,
+    n0,
+    _GFT,
+    0,
+    () => GetFederationTokenRequest,
+    () => GetFederationTokenResponse,
+];
+var GetSessionToken = [
+    9,
+    n0,
+    _GST,
+    0,
+    () => GetSessionTokenRequest,
+    () => GetSessionTokenResponse,
+];
+var GetWebIdentityToken = [
+    9,
+    n0,
+    _GWIT,
+    0,
+    () => GetWebIdentityTokenRequest,
+    () => GetWebIdentityTokenResponse,
+];
+
+class AssumeRoleCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "AssumeRole", {})
+    .n("STSClient", "AssumeRoleCommand")
+    .sc(AssumeRole)
+    .build() {
+}
+
+class AssumeRoleWithSAMLCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithSAML", {})
+    .n("STSClient", "AssumeRoleWithSAMLCommand")
+    .sc(AssumeRoleWithSAML)
+    .build() {
+}
+
+class AssumeRoleWithWebIdentityCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {})
+    .n("STSClient", "AssumeRoleWithWebIdentityCommand")
+    .sc(AssumeRoleWithWebIdentity)
+    .build() {
+}
+
+class AssumeRootCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "AssumeRoot", {})
+    .n("STSClient", "AssumeRootCommand")
+    .sc(AssumeRoot)
+    .build() {
+}
+
+class DecodeAuthorizationMessageCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "DecodeAuthorizationMessage", {})
+    .n("STSClient", "DecodeAuthorizationMessageCommand")
+    .sc(DecodeAuthorizationMessage)
+    .build() {
+}
+
+class GetAccessKeyInfoCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetAccessKeyInfo", {})
+    .n("STSClient", "GetAccessKeyInfoCommand")
+    .sc(GetAccessKeyInfo)
+    .build() {
+}
+
+class GetCallerIdentityCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetCallerIdentity", {})
+    .n("STSClient", "GetCallerIdentityCommand")
+    .sc(GetCallerIdentity)
+    .build() {
+}
+
+class GetDelegatedAccessTokenCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetDelegatedAccessToken", {})
+    .n("STSClient", "GetDelegatedAccessTokenCommand")
+    .sc(GetDelegatedAccessToken)
+    .build() {
+}
+
+class GetFederationTokenCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetFederationToken", {})
+    .n("STSClient", "GetFederationTokenCommand")
+    .sc(GetFederationToken)
+    .build() {
+}
+
+class GetSessionTokenCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetSessionToken", {})
+    .n("STSClient", "GetSessionTokenCommand")
+    .sc(GetSessionToken)
+    .build() {
+}
+
+class GetWebIdentityTokenCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(EndpointParameters.commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("AWSSecurityTokenServiceV20110615", "GetWebIdentityToken", {})
+    .n("STSClient", "GetWebIdentityTokenCommand")
+    .sc(GetWebIdentityToken)
+    .build() {
+}
+
+const commands = {
+    AssumeRoleCommand,
+    AssumeRoleWithSAMLCommand,
+    AssumeRoleWithWebIdentityCommand,
+    AssumeRootCommand,
+    DecodeAuthorizationMessageCommand,
+    GetAccessKeyInfoCommand,
+    GetCallerIdentityCommand,
+    GetDelegatedAccessTokenCommand,
+    GetFederationTokenCommand,
+    GetSessionTokenCommand,
+    GetWebIdentityTokenCommand,
+};
+class STS extends STSClient.STSClient {
+}
+smithyClient.createAggregatedClient(commands, STS);
+
+const getAccountIdFromAssumedRoleUser = (assumedRoleUser) => {
+    if (typeof assumedRoleUser?.Arn === "string") {
+        const arnComponents = assumedRoleUser.Arn.split(":");
+        if (arnComponents.length > 4 && arnComponents[4] !== "") {
+            return arnComponents[4];
+        }
+    }
+    return undefined;
+};
+const resolveRegion = async (_region, _parentRegion, credentialProviderLogger, loaderConfig = {}) => {
+    const region = typeof _region === "function" ? await _region() : _region;
+    const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion;
+    const stsDefaultRegion = await regionConfigResolver.stsRegionDefaultResolver(loaderConfig)();
+    credentialProviderLogger?.debug?.("@aws-sdk/client-sts::resolveRegion", "accepting first of:", `${region} (credential provider clientConfig)`, `${parentRegion} (contextual client)`, `${stsDefaultRegion} (STS default: AWS_REGION, profile region, or us-east-1)`);
+    return region ?? parentRegion ?? stsDefaultRegion;
+};
+const getDefaultRoleAssumer$1 = (stsOptions, STSClient) => {
+    let stsClient;
+    let closureSourceCreds;
+    return async (sourceCreds, params) => {
+        closureSourceCreds = sourceCreds;
+        if (!stsClient) {
+            const { logger = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId, } = stsOptions;
+            const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, {
+                logger,
+                profile,
+            });
+            const isCompatibleRequestHandler = !isH2(requestHandler);
+            stsClient = new STSClient({
+                ...stsOptions,
+                userAgentAppId,
+                profile,
+                credentialDefaultProvider: () => async () => closureSourceCreds,
+                region: resolvedRegion,
+                requestHandler: isCompatibleRequestHandler ? requestHandler : undefined,
+                logger: logger,
+            });
+        }
+        const { Credentials, AssumedRoleUser } = await stsClient.send(new AssumeRoleCommand(params));
+        if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) {
+            throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`);
+        }
+        const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser);
+        const credentials = {
+            accessKeyId: Credentials.AccessKeyId,
+            secretAccessKey: Credentials.SecretAccessKey,
+            sessionToken: Credentials.SessionToken,
+            expiration: Credentials.Expiration,
+            ...(Credentials.CredentialScope && { credentialScope: Credentials.CredentialScope }),
+            ...(accountId && { accountId }),
+        };
+        client.setCredentialFeature(credentials, "CREDENTIALS_STS_ASSUME_ROLE", "i");
+        return credentials;
+    };
+};
+const getDefaultRoleAssumerWithWebIdentity$1 = (stsOptions, STSClient) => {
+    let stsClient;
+    return async (params) => {
+        if (!stsClient) {
+            const { logger = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId, } = stsOptions;
+            const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, {
+                logger,
+                profile,
+            });
+            const isCompatibleRequestHandler = !isH2(requestHandler);
+            stsClient = new STSClient({
+                ...stsOptions,
+                userAgentAppId,
+                profile,
+                region: resolvedRegion,
+                requestHandler: isCompatibleRequestHandler ? requestHandler : undefined,
+                logger: logger,
+            });
+        }
+        const { Credentials, AssumedRoleUser } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params));
+        if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) {
+            throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`);
+        }
+        const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser);
+        const credentials = {
+            accessKeyId: Credentials.AccessKeyId,
+            secretAccessKey: Credentials.SecretAccessKey,
+            sessionToken: Credentials.SessionToken,
+            expiration: Credentials.Expiration,
+            ...(Credentials.CredentialScope && { credentialScope: Credentials.CredentialScope }),
+            ...(accountId && { accountId }),
+        };
+        if (accountId) {
+            client.setCredentialFeature(credentials, "RESOLVED_ACCOUNT_ID", "T");
+        }
+        client.setCredentialFeature(credentials, "CREDENTIALS_STS_ASSUME_ROLE_WEB_ID", "k");
+        return credentials;
+    };
+};
+const isH2 = (requestHandler) => {
+    return requestHandler?.metadata?.handlerProtocol === "h2";
+};
+
+const getCustomizableStsClientCtor = (baseCtor, customizations) => {
+    if (!customizations)
+        return baseCtor;
+    else
+        return class CustomizableSTSClient extends baseCtor {
+            constructor(config) {
+                super(config);
+                for (const customization of customizations) {
+                    this.middlewareStack.use(customization);
+                }
+            }
+        };
+};
+const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => getDefaultRoleAssumer$1(stsOptions, getCustomizableStsClientCtor(STSClient.STSClient, stsPlugins));
+const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity$1(stsOptions, getCustomizableStsClientCtor(STSClient.STSClient, stsPlugins));
+const decorateDefaultCredentialProvider = (provider) => (input) => provider({
+    roleAssumer: getDefaultRoleAssumer(input),
+    roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity(input),
+    ...input,
+});
+
+Object.defineProperty(exports, "$Command", {
+    enumerable: true,
+    get: function () { return smithyClient.Command; }
+});
+exports.AssumeRoleCommand = AssumeRoleCommand;
+exports.AssumeRoleWithSAMLCommand = AssumeRoleWithSAMLCommand;
+exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand;
+exports.AssumeRootCommand = AssumeRootCommand;
+exports.DecodeAuthorizationMessageCommand = DecodeAuthorizationMessageCommand;
+exports.ExpiredTokenException = ExpiredTokenException$1;
+exports.ExpiredTradeInTokenException = ExpiredTradeInTokenException$1;
+exports.GetAccessKeyInfoCommand = GetAccessKeyInfoCommand;
+exports.GetCallerIdentityCommand = GetCallerIdentityCommand;
+exports.GetDelegatedAccessTokenCommand = GetDelegatedAccessTokenCommand;
+exports.GetFederationTokenCommand = GetFederationTokenCommand;
+exports.GetSessionTokenCommand = GetSessionTokenCommand;
+exports.GetWebIdentityTokenCommand = GetWebIdentityTokenCommand;
+exports.IDPCommunicationErrorException = IDPCommunicationErrorException$1;
+exports.IDPRejectedClaimException = IDPRejectedClaimException$1;
+exports.InvalidAuthorizationMessageException = InvalidAuthorizationMessageException$1;
+exports.InvalidIdentityTokenException = InvalidIdentityTokenException$1;
+exports.JWTPayloadSizeExceededException = JWTPayloadSizeExceededException$1;
+exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException$1;
+exports.OutboundWebIdentityFederationDisabledException = OutboundWebIdentityFederationDisabledException$1;
+exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException$1;
+exports.RegionDisabledException = RegionDisabledException$1;
+exports.STS = STS;
+exports.STSServiceException = STSServiceException$1;
+exports.SessionDurationEscalationException = SessionDurationEscalationException$1;
+exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider;
+exports.getDefaultRoleAssumer = getDefaultRoleAssumer;
+exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity;
+Object.keys(STSClient).forEach(function (k) {
+    if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+        enumerable: true,
+        get: function () { return STSClient[k]; }
+    });
+});

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.js

@@ -0,0 +1,70 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getRuntimeConfig = void 0;
+const tslib_1 = require("tslib");
+const package_json_1 = tslib_1.__importDefault(require("../package.json"));
+const core_1 = require("@aws-sdk/core");
+const credential_provider_node_1 = require("@aws-sdk/credential-provider-node");
+const util_user_agent_node_1 = require("@aws-sdk/util-user-agent-node");
+const config_resolver_1 = require("@smithy/config-resolver");
+const core_2 = require("@smithy/core");
+const hash_node_1 = require("@smithy/hash-node");
+const middleware_retry_1 = require("@smithy/middleware-retry");
+const node_config_provider_1 = require("@smithy/node-config-provider");
+const node_http_handler_1 = require("@smithy/node-http-handler");
+const util_body_length_node_1 = require("@smithy/util-body-length-node");
+const util_retry_1 = require("@smithy/util-retry");
+const runtimeConfig_shared_1 = require("./runtimeConfig.shared");
+const smithy_client_1 = require("@smithy/smithy-client");
+const util_defaults_mode_node_1 = require("@smithy/util-defaults-mode-node");
+const smithy_client_2 = require("@smithy/smithy-client");
+const getRuntimeConfig = (config) => {
+    (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version);
+    const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
+    const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode);
+    const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config);
+    (0, core_1.emitWarningIfUnsupportedVersion)(process.version);
+    const loaderConfig = {
+        profile: config?.profile,
+        logger: clientSharedValues.logger,
+    };
+    return {
+        ...clientSharedValues,
+        ...config,
+        runtime: "node",
+        defaultsMode,
+        authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig),
+        bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength,
+        credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider,
+        defaultUserAgentProvider: config?.defaultUserAgentProvider ??
+            (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }),
+        httpAuthSchemes: config?.httpAuthSchemes ?? [
+            {
+                schemeId: "aws.auth#sigv4",
+                identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") ||
+                    (async (idProps) => await (0, credential_provider_node_1.defaultProvider)(idProps?.__config || {})()),
+                signer: new core_1.AwsSdkSigV4Signer(),
+            },
+            {
+                schemeId: "smithy.api#noAuth",
+                identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})),
+                signer: new core_2.NoAuthSigner(),
+            },
+        ],
+        maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config),
+        region: config?.region ??
+            (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }),
+        requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider),
+        retryMode: config?.retryMode ??
+            (0, node_config_provider_1.loadConfig)({
+                ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS,
+                default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
+            }, config),
+        sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"),
+        streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector,
+        useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
+        useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
+        userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig),
+    };
+};
+exports.getRuntimeConfig = getRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/runtimeConfig.shared.js

@@ -0,0 +1,47 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getRuntimeConfig = void 0;
+const core_1 = require("@aws-sdk/core");
+const protocols_1 = require("@aws-sdk/core/protocols");
+const core_2 = require("@smithy/core");
+const smithy_client_1 = require("@smithy/smithy-client");
+const url_parser_1 = require("@smithy/url-parser");
+const util_base64_1 = require("@smithy/util-base64");
+const util_utf8_1 = require("@smithy/util-utf8");
+const httpAuthSchemeProvider_1 = require("./auth/httpAuthSchemeProvider");
+const endpointResolver_1 = require("./endpoint/endpointResolver");
+const getRuntimeConfig = (config) => {
+    return {
+        apiVersion: "2011-06-15",
+        base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64,
+        base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64,
+        disableHostPrefix: config?.disableHostPrefix ?? false,
+        endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver,
+        extensions: config?.extensions ?? [],
+        httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider,
+        httpAuthSchemes: config?.httpAuthSchemes ?? [
+            {
+                schemeId: "aws.auth#sigv4",
+                identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"),
+                signer: new core_1.AwsSdkSigV4Signer(),
+            },
+            {
+                schemeId: "smithy.api#noAuth",
+                identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})),
+                signer: new core_2.NoAuthSigner(),
+            },
+        ],
+        logger: config?.logger ?? new smithy_client_1.NoOpLogger(),
+        protocol: config?.protocol ??
+            new protocols_1.AwsQueryProtocol({
+                defaultNamespace: "com.amazonaws.sts",
+                xmlNamespace: "https://sts.amazonaws.com/doc/2011-06-15/",
+                version: "2011-06-15",
+            }),
+        serviceId: config?.serviceId ?? "STS",
+        urlParser: config?.urlParser ?? url_parser_1.parseUrl,
+        utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8,
+        utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8,
+    };
+};
+exports.getRuntimeConfig = getRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/dist-cjs/runtimeExtensions.js

@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolveRuntimeExtensions = void 0;
+const region_config_resolver_1 = require("@aws-sdk/region-config-resolver");
+const protocol_http_1 = require("@smithy/protocol-http");
+const smithy_client_1 = require("@smithy/smithy-client");
+const httpAuthExtensionConfiguration_1 = require("./auth/httpAuthExtensionConfiguration");
+const resolveRuntimeExtensions = (runtimeConfig, extensions) => {
+    const extensionConfiguration = Object.assign((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig), (0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig), (0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig));
+    extensions.forEach((extension) => extension.configure(extensionConfiguration));
+    return Object.assign(runtimeConfig, (0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), (0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), (0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), (0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration));
+};
+exports.resolveRuntimeExtensions = resolveRuntimeExtensions;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/protocol-http/dist-cjs/index.js

@@ -0,0 +1,169 @@
+'use strict';
+
+var types = require('@smithy/types');
+
+const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
+    return {
+        setHttpHandler(handler) {
+            runtimeConfig.httpHandler = handler;
+        },
+        httpHandler() {
+            return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+            runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+            return runtimeConfig.httpHandler.httpHandlerConfigs();
+        },
+    };
+};
+const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
+    return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
+    };
+};
+
+class Field {
+    name;
+    kind;
+    values;
+    constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+    }
+    add(value) {
+        this.values.push(value);
+    }
+    set(values) {
+        this.values = values;
+    }
+    remove(value) {
+        this.values = this.values.filter((v) => v !== value);
+    }
+    toString() {
+        return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
+    }
+    get() {
+        return this.values;
+    }
+}
+
+class Fields {
+    entries = {};
+    encoding;
+    constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+    }
+    setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+    }
+    getField(name) {
+        return this.entries[name.toLowerCase()];
+    }
+    removeField(name) {
+        delete this.entries[name.toLowerCase()];
+    }
+    getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+    }
+}
+
+class HttpRequest {
+    method;
+    protocol;
+    hostname;
+    port;
+    path;
+    query;
+    headers;
+    username;
+    password;
+    fragment;
+    body;
+    constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol
+            ? options.protocol.slice(-1) !== ":"
+                ? `${options.protocol}:`
+                : options.protocol
+            : "https:";
+        this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+    }
+    static clone(request) {
+        const cloned = new HttpRequest({
+            ...request,
+            headers: { ...request.headers },
+        });
+        if (cloned.query) {
+            cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+    }
+    static isInstance(request) {
+        if (!request) {
+            return false;
+        }
+        const req = request;
+        return ("method" in req &&
+            "protocol" in req &&
+            "hostname" in req &&
+            "path" in req &&
+            typeof req["query"] === "object" &&
+            typeof req["headers"] === "object");
+    }
+    clone() {
+        return HttpRequest.clone(this);
+    }
+}
+function cloneQuery(query) {
+    return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+            ...carry,
+            [paramName]: Array.isArray(param) ? [...param] : param,
+        };
+    }, {});
+}
+
+class HttpResponse {
+    statusCode;
+    reason;
+    headers;
+    body;
+    constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+    }
+    static isInstance(response) {
+        if (!response)
+            return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+    }
+}
+
+function isValidHostname(hostname) {
+    const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+    return hostPattern.test(hostname);
+}
+
+exports.Field = Field;
+exports.Fields = Fields;
+exports.HttpRequest = HttpRequest;
+exports.HttpResponse = HttpResponse;
+exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
+exports.isValidHostname = isValidHostname;
+exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/smithy-client/dist-cjs/index.js

@@ -0,0 +1,589 @@
+'use strict';
+
+var middlewareStack = require('@smithy/middleware-stack');
+var protocols = require('@smithy/core/protocols');
+var types = require('@smithy/types');
+var schema = require('@smithy/core/schema');
+var serde = require('@smithy/core/serde');
+
+class Client {
+    config;
+    middlewareStack = middlewareStack.constructStack();
+    initConfig;
+    handlers;
+    constructor(config) {
+        this.config = config;
+    }
+    send(command, optionsOrCb, cb) {
+        const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
+        const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
+        const useHandlerCache = options === undefined && this.config.cacheMiddleware === true;
+        let handler;
+        if (useHandlerCache) {
+            if (!this.handlers) {
+                this.handlers = new WeakMap();
+            }
+            const handlers = this.handlers;
+            if (handlers.has(command.constructor)) {
+                handler = handlers.get(command.constructor);
+            }
+            else {
+                handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+                handlers.set(command.constructor, handler);
+            }
+        }
+        else {
+            delete this.handlers;
+            handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+        }
+        if (callback) {
+            handler(command)
+                .then((result) => callback(null, result.output), (err) => callback(err))
+                .catch(() => { });
+        }
+        else {
+            return handler(command).then((result) => result.output);
+        }
+    }
+    destroy() {
+        this.config?.requestHandler?.destroy?.();
+        delete this.handlers;
+    }
+}
+
+const SENSITIVE_STRING$1 = "***SensitiveInformation***";
+function schemaLogFilter(schema$1, data) {
+    if (data == null) {
+        return data;
+    }
+    const ns = schema.NormalizedSchema.of(schema$1);
+    if (ns.getMergedTraits().sensitive) {
+        return SENSITIVE_STRING$1;
+    }
+    if (ns.isListSchema()) {
+        const isSensitive = !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isMapSchema()) {
+        const isSensitive = !!ns.getKeySchema().getMergedTraits().sensitive || !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isStructSchema() && typeof data === "object") {
+        const object = data;
+        const newObject = {};
+        for (const [member, memberNs] of ns.structIterator()) {
+            if (object[member] != null) {
+                newObject[member] = schemaLogFilter(memberNs, object[member]);
+            }
+        }
+        return newObject;
+    }
+    return data;
+}
+
+class Command {
+    middlewareStack = middlewareStack.constructStack();
+    schema;
+    static classBuilder() {
+        return new ClassBuilder();
+    }
+    resolveMiddlewareWithContext(clientStack, configuration, options, { middlewareFn, clientName, commandName, inputFilterSensitiveLog, outputFilterSensitiveLog, smithyContext, additionalContext, CommandCtor, }) {
+        for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) {
+            this.middlewareStack.use(mw);
+        }
+        const stack = clientStack.concat(this.middlewareStack);
+        const { logger } = configuration;
+        const handlerExecutionContext = {
+            logger,
+            clientName,
+            commandName,
+            inputFilterSensitiveLog,
+            outputFilterSensitiveLog,
+            [types.SMITHY_CONTEXT_KEY]: {
+                commandInstance: this,
+                ...smithyContext,
+            },
+            ...additionalContext,
+        };
+        const { requestHandler } = configuration;
+        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
+    }
+}
+class ClassBuilder {
+    _init = () => { };
+    _ep = {};
+    _middlewareFn = () => [];
+    _commandName = "";
+    _clientName = "";
+    _additionalContext = {};
+    _smithyContext = {};
+    _inputFilterSensitiveLog = undefined;
+    _outputFilterSensitiveLog = undefined;
+    _serializer = null;
+    _deserializer = null;
+    _operationSchema;
+    init(cb) {
+        this._init = cb;
+    }
+    ep(endpointParameterInstructions) {
+        this._ep = endpointParameterInstructions;
+        return this;
+    }
+    m(middlewareSupplier) {
+        this._middlewareFn = middlewareSupplier;
+        return this;
+    }
+    s(service, operation, smithyContext = {}) {
+        this._smithyContext = {
+            service,
+            operation,
+            ...smithyContext,
+        };
+        return this;
+    }
+    c(additionalContext = {}) {
+        this._additionalContext = additionalContext;
+        return this;
+    }
+    n(clientName, commandName) {
+        this._clientName = clientName;
+        this._commandName = commandName;
+        return this;
+    }
+    f(inputFilter = (_) => _, outputFilter = (_) => _) {
+        this._inputFilterSensitiveLog = inputFilter;
+        this._outputFilterSensitiveLog = outputFilter;
+        return this;
+    }
+    ser(serializer) {
+        this._serializer = serializer;
+        return this;
+    }
+    de(deserializer) {
+        this._deserializer = deserializer;
+        return this;
+    }
+    sc(operation) {
+        this._operationSchema = operation;
+        this._smithyContext.operationSchema = operation;
+        return this;
+    }
+    build() {
+        const closure = this;
+        let CommandRef;
+        return (CommandRef = class extends Command {
+            input;
+            static getEndpointParameterInstructions() {
+                return closure._ep;
+            }
+            constructor(...[input]) {
+                super();
+                this.input = input ?? {};
+                closure._init(this);
+                this.schema = closure._operationSchema;
+            }
+            resolveMiddleware(stack, configuration, options) {
+                const op = closure._operationSchema;
+                const input = op?.[4] ?? op?.input;
+                const output = op?.[5] ?? op?.output;
+                return this.resolveMiddlewareWithContext(stack, configuration, options, {
+                    CommandCtor: CommandRef,
+                    middlewareFn: closure._middlewareFn,
+                    clientName: closure._clientName,
+                    commandName: closure._commandName,
+                    inputFilterSensitiveLog: closure._inputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, input) : (_) => _),
+                    outputFilterSensitiveLog: closure._outputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, output) : (_) => _),
+                    smithyContext: closure._smithyContext,
+                    additionalContext: closure._additionalContext,
+                });
+            }
+            serialize = closure._serializer;
+            deserialize = closure._deserializer;
+        });
+    }
+}
+
+const SENSITIVE_STRING = "***SensitiveInformation***";
+
+const createAggregatedClient = (commands, Client) => {
+    for (const command of Object.keys(commands)) {
+        const CommandCtor = commands[command];
+        const methodImpl = async function (args, optionsOrCb, cb) {
+            const command = new CommandCtor(args);
+            if (typeof optionsOrCb === "function") {
+                this.send(command, optionsOrCb);
+            }
+            else if (typeof cb === "function") {
+                if (typeof optionsOrCb !== "object")
+                    throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
+                this.send(command, optionsOrCb || {}, cb);
+            }
+            else {
+                return this.send(command, optionsOrCb);
+            }
+        };
+        const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
+        Client.prototype[methodName] = methodImpl;
+    }
+};
+
+class ServiceException extends Error {
+    $fault;
+    $response;
+    $retryable;
+    $metadata;
+    constructor(options) {
+        super(options.message);
+        Object.setPrototypeOf(this, Object.getPrototypeOf(this).constructor.prototype);
+        this.name = options.name;
+        this.$fault = options.$fault;
+        this.$metadata = options.$metadata;
+    }
+    static isInstance(value) {
+        if (!value)
+            return false;
+        const candidate = value;
+        return (ServiceException.prototype.isPrototypeOf(candidate) ||
+            (Boolean(candidate.$fault) &&
+                Boolean(candidate.$metadata) &&
+                (candidate.$fault === "client" || candidate.$fault === "server")));
+    }
+    static [Symbol.hasInstance](instance) {
+        if (!instance)
+            return false;
+        const candidate = instance;
+        if (this === ServiceException) {
+            return ServiceException.isInstance(instance);
+        }
+        if (ServiceException.isInstance(instance)) {
+            if (candidate.name && this.name) {
+                return this.prototype.isPrototypeOf(instance) || candidate.name === this.name;
+            }
+            return this.prototype.isPrototypeOf(instance);
+        }
+        return false;
+    }
+}
+const decorateServiceException = (exception, additions = {}) => {
+    Object.entries(additions)
+        .filter(([, v]) => v !== undefined)
+        .forEach(([k, v]) => {
+        if (exception[k] == undefined || exception[k] === "") {
+            exception[k] = v;
+        }
+    });
+    const message = exception.message || exception.Message || "UnknownError";
+    exception.message = message;
+    delete exception.Message;
+    return exception;
+};
+
+const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
+    const $metadata = deserializeMetadata(output);
+    const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
+    const response = new exceptionCtor({
+        name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || "UnknownError",
+        $fault: "client",
+        $metadata,
+    });
+    throw decorateServiceException(response, parsedBody);
+};
+const withBaseException = (ExceptionCtor) => {
+    return ({ output, parsedBody, errorCode }) => {
+        throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
+    };
+};
+const deserializeMetadata = (output) => ({
+    httpStatusCode: output.statusCode,
+    requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
+    extendedRequestId: output.headers["x-amz-id-2"],
+    cfId: output.headers["x-amz-cf-id"],
+});
+
+const loadConfigsForDefaultMode = (mode) => {
+    switch (mode) {
+        case "standard":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "in-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 1100,
+            };
+        case "cross-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "mobile":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 30000,
+            };
+        default:
+            return {};
+    }
+};
+
+let warningEmitted = false;
+const emitWarningIfUnsupportedVersion = (version) => {
+    if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
+        warningEmitted = true;
+    }
+};
+
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    for (const id in types.AlgorithmId) {
+        const algorithmId = types.AlgorithmId[id];
+        if (runtimeConfig[algorithmId] === undefined) {
+            continue;
+        }
+        checksumAlgorithms.push({
+            algorithmId: () => algorithmId,
+            checksumConstructor: () => runtimeConfig[algorithmId],
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getRetryConfiguration = (runtimeConfig) => {
+    return {
+        setRetryStrategy(retryStrategy) {
+            runtimeConfig.retryStrategy = retryStrategy;
+        },
+        retryStrategy() {
+            return runtimeConfig.retryStrategy;
+        },
+    };
+};
+const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
+    const runtimeConfig = {};
+    runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
+    return runtimeConfig;
+};
+
+const getDefaultExtensionConfiguration = (runtimeConfig) => {
+    return Object.assign(getChecksumConfiguration(runtimeConfig), getRetryConfiguration(runtimeConfig));
+};
+const getDefaultClientConfiguration = getDefaultExtensionConfiguration;
+const resolveDefaultRuntimeConfig = (config) => {
+    return Object.assign(resolveChecksumRuntimeConfig(config), resolveRetryRuntimeConfig(config));
+};
+
+const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
+
+const getValueFromTextNode = (obj) => {
+    const textNodeName = "#text";
+    for (const key in obj) {
+        if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
+            obj[key] = obj[key][textNodeName];
+        }
+        else if (typeof obj[key] === "object" && obj[key] !== null) {
+            obj[key] = getValueFromTextNode(obj[key]);
+        }
+    }
+    return obj;
+};
+
+const isSerializableHeaderValue = (value) => {
+    return value != null;
+};
+
+class NoOpLogger {
+    trace() { }
+    debug() { }
+    info() { }
+    warn() { }
+    error() { }
+}
+
+function map(arg0, arg1, arg2) {
+    let target;
+    let filter;
+    let instructions;
+    if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
+        target = {};
+        instructions = arg0;
+    }
+    else {
+        target = arg0;
+        if (typeof arg1 === "function") {
+            filter = arg1;
+            instructions = arg2;
+            return mapWithFilter(target, filter, instructions);
+        }
+        else {
+            instructions = arg1;
+        }
+    }
+    for (const key of Object.keys(instructions)) {
+        if (!Array.isArray(instructions[key])) {
+            target[key] = instructions[key];
+            continue;
+        }
+        applyInstruction(target, null, instructions, key);
+    }
+    return target;
+}
+const convertMap = (target) => {
+    const output = {};
+    for (const [k, v] of Object.entries(target || {})) {
+        output[k] = [, v];
+    }
+    return output;
+};
+const take = (source, instructions) => {
+    const out = {};
+    for (const key in instructions) {
+        applyInstruction(out, source, instructions, key);
+    }
+    return out;
+};
+const mapWithFilter = (target, filter, instructions) => {
+    return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
+        if (Array.isArray(value)) {
+            _instructions[key] = value;
+        }
+        else {
+            if (typeof value === "function") {
+                _instructions[key] = [filter, value()];
+            }
+            else {
+                _instructions[key] = [filter, value];
+            }
+        }
+        return _instructions;
+    }, {}));
+};
+const applyInstruction = (target, source, instructions, targetKey) => {
+    if (source !== null) {
+        let instruction = instructions[targetKey];
+        if (typeof instruction === "function") {
+            instruction = [, instruction];
+        }
+        const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
+        if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
+            target[targetKey] = valueFn(source[sourceKey]);
+        }
+        return;
+    }
+    let [filter, value] = instructions[targetKey];
+    if (typeof value === "function") {
+        let _value;
+        const defaultFilterPassed = filter === undefined && (_value = value()) != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed) {
+            target[targetKey] = _value;
+        }
+        else if (customFilterPassed) {
+            target[targetKey] = value();
+        }
+    }
+    else {
+        const defaultFilterPassed = filter === undefined && value != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed || customFilterPassed) {
+            target[targetKey] = value;
+        }
+    }
+};
+const nonNullish = (_) => _ != null;
+const pass = (_) => _;
+
+const serializeFloat = (value) => {
+    if (value !== value) {
+        return "NaN";
+    }
+    switch (value) {
+        case Infinity:
+            return "Infinity";
+        case -Infinity:
+            return "-Infinity";
+        default:
+            return value;
+    }
+};
+const serializeDateTime = (date) => date.toISOString().replace(".000Z", "Z");
+
+const _json = (obj) => {
+    if (obj == null) {
+        return {};
+    }
+    if (Array.isArray(obj)) {
+        return obj.filter((_) => _ != null).map(_json);
+    }
+    if (typeof obj === "object") {
+        const target = {};
+        for (const key of Object.keys(obj)) {
+            if (obj[key] == null) {
+                continue;
+            }
+            target[key] = _json(obj[key]);
+        }
+        return target;
+    }
+    return obj;
+};
+
+Object.defineProperty(exports, "collectBody", {
+    enumerable: true,
+    get: function () { return protocols.collectBody; }
+});
+Object.defineProperty(exports, "extendedEncodeURIComponent", {
+    enumerable: true,
+    get: function () { return protocols.extendedEncodeURIComponent; }
+});
+Object.defineProperty(exports, "resolvedPath", {
+    enumerable: true,
+    get: function () { return protocols.resolvedPath; }
+});
+exports.Client = Client;
+exports.Command = Command;
+exports.NoOpLogger = NoOpLogger;
+exports.SENSITIVE_STRING = SENSITIVE_STRING;
+exports.ServiceException = ServiceException;
+exports._json = _json;
+exports.convertMap = convertMap;
+exports.createAggregatedClient = createAggregatedClient;
+exports.decorateServiceException = decorateServiceException;
+exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
+exports.getArrayIfSingleItem = getArrayIfSingleItem;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
+exports.getValueFromTextNode = getValueFromTextNode;
+exports.isSerializableHeaderValue = isSerializableHeaderValue;
+exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
+exports.map = map;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
+exports.serializeDateTime = serializeDateTime;
+exports.serializeFloat = serializeFloat;
+exports.take = take;
+exports.throwDefaultError = throwDefaultError;
+exports.withBaseException = withBaseException;
+Object.keys(serde).forEach(function (k) {
+    if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+        enumerable: true,
+        get: function () { return serde[k]; }
+    });
+});

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/types/dist-cjs/index.js

@@ -0,0 +1,91 @@
+'use strict';
+
+exports.HttpAuthLocation = void 0;
+(function (HttpAuthLocation) {
+    HttpAuthLocation["HEADER"] = "header";
+    HttpAuthLocation["QUERY"] = "query";
+})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
+
+exports.HttpApiKeyAuthLocation = void 0;
+(function (HttpApiKeyAuthLocation) {
+    HttpApiKeyAuthLocation["HEADER"] = "header";
+    HttpApiKeyAuthLocation["QUERY"] = "query";
+})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
+
+exports.EndpointURLScheme = void 0;
+(function (EndpointURLScheme) {
+    EndpointURLScheme["HTTP"] = "http";
+    EndpointURLScheme["HTTPS"] = "https";
+})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
+
+exports.AlgorithmId = void 0;
+(function (AlgorithmId) {
+    AlgorithmId["MD5"] = "md5";
+    AlgorithmId["CRC32"] = "crc32";
+    AlgorithmId["CRC32C"] = "crc32c";
+    AlgorithmId["SHA1"] = "sha1";
+    AlgorithmId["SHA256"] = "sha256";
+})(exports.AlgorithmId || (exports.AlgorithmId = {}));
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    if (runtimeConfig.sha256 !== undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.SHA256,
+            checksumConstructor: () => runtimeConfig.sha256,
+        });
+    }
+    if (runtimeConfig.md5 != undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.MD5,
+            checksumConstructor: () => runtimeConfig.md5,
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getDefaultClientConfiguration = (runtimeConfig) => {
+    return getChecksumConfiguration(runtimeConfig);
+};
+const resolveDefaultRuntimeConfig = (config) => {
+    return resolveChecksumRuntimeConfig(config);
+};
+
+exports.FieldPosition = void 0;
+(function (FieldPosition) {
+    FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
+    FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
+})(exports.FieldPosition || (exports.FieldPosition = {}));
+
+const SMITHY_CONTEXT_KEY = "__smithy_context";
+
+exports.IniSectionType = void 0;
+(function (IniSectionType) {
+    IniSectionType["PROFILE"] = "profile";
+    IniSectionType["SSO_SESSION"] = "sso-session";
+    IniSectionType["SERVICES"] = "services";
+})(exports.IniSectionType || (exports.IniSectionType = {}));
+
+exports.RequestHandlerProtocol = void 0;
+(function (RequestHandlerProtocol) {
+    RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
+    RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
+    RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
+})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
+
+exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/util-base64/dist-cjs/fromBase64.js

@@ -0,0 +1,16 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.fromBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
+const fromBase64 = (input) => {
+    if ((input.length * 3) % 4 !== 0) {
+        throw new TypeError(`Incorrect padding on base64 string.`);
+    }
+    if (!BASE64_REGEX.exec(input)) {
+        throw new TypeError(`Invalid base64 string.`);
+    }
+    const buffer = (0, util_buffer_from_1.fromString)(input, "base64");
+    return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength);
+};
+exports.fromBase64 = fromBase64;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/util-base64/dist-cjs/index.js

@@ -0,0 +1,19 @@
+'use strict';
+
+var fromBase64 = require('./fromBase64');
+var toBase64 = require('./toBase64');
+
+
+
+Object.keys(fromBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return fromBase64[k]; }
+	});
+});
+Object.keys(toBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return toBase64[k]; }
+	});
+});

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/util-base64/dist-cjs/toBase64.js

@@ -0,0 +1,19 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.toBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const util_utf8_1 = require("@smithy/util-utf8");
+const toBase64 = (_input) => {
+    let input;
+    if (typeof _input === "string") {
+        input = (0, util_utf8_1.fromUtf8)(_input);
+    }
+    else {
+        input = _input;
+    }
+    if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") {
+        throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array.");
+    }
+    return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64");
+};
+exports.toBase64 = toBase64;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/dist-cjs/index.js

@@ -0,0 +1,20 @@
+'use strict';
+
+var isArrayBuffer = require('@smithy/is-array-buffer');
+var buffer = require('buffer');
+
+const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => {
+    if (!isArrayBuffer.isArrayBuffer(input)) {
+        throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`);
+    }
+    return buffer.Buffer.from(input, offset, length);
+};
+const fromString = (input, encoding) => {
+    if (typeof input !== "string") {
+        throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`);
+    }
+    return encoding ? buffer.Buffer.from(input, encoding) : buffer.Buffer.from(input);
+};
+
+exports.fromArrayBuffer = fromArrayBuffer;
+exports.fromString = fromString;

extracted-source/node_modules/@aws-sdk/client-sts/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/node_modules/@smithy/is-array-buffer/dist-cjs/index.js

@@ -0,0 +1,6 @@
+'use strict';
+
+const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
+    Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
+
+exports.isArrayBuffer = isArrayBuffer;