Add extracted source directory and README navigation

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/auth/httpAuthSchemeProvider.js

@@ -0,0 +1,68 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.resolveHttpAuthSchemeConfig = exports.defaultSSOHttpAuthSchemeProvider = exports.defaultSSOHttpAuthSchemeParametersProvider = void 0;
+const core_1 = require("@aws-sdk/core");
+const util_middleware_1 = require("@smithy/util-middleware");
+const defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => {
+    return {
+        operation: (0, util_middleware_1.getSmithyContext)(context).operation,
+        region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) ||
+            (() => {
+                throw new Error("expected `region` to be configured for `aws.auth#sigv4`");
+            })(),
+    };
+};
+exports.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider;
+function createAwsAuthSigv4HttpAuthOption(authParameters) {
+    return {
+        schemeId: "aws.auth#sigv4",
+        signingProperties: {
+            name: "awsssoportal",
+            region: authParameters.region,
+        },
+        propertiesExtractor: (config, context) => ({
+            signingProperties: {
+                config,
+                context,
+            },
+        }),
+    };
+}
+function createSmithyApiNoAuthHttpAuthOption(authParameters) {
+    return {
+        schemeId: "smithy.api#noAuth",
+    };
+}
+const defaultSSOHttpAuthSchemeProvider = (authParameters) => {
+    const options = [];
+    switch (authParameters.operation) {
+        case "GetRoleCredentials": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        case "ListAccountRoles": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        case "ListAccounts": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        case "Logout": {
+            options.push(createSmithyApiNoAuthHttpAuthOption(authParameters));
+            break;
+        }
+        default: {
+            options.push(createAwsAuthSigv4HttpAuthOption(authParameters));
+        }
+    }
+    return options;
+};
+exports.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider;
+const resolveHttpAuthSchemeConfig = (config) => {
+    const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config);
+    return Object.assign(config_0, {
+        authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []),
+    });
+};
+exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig;

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/endpointResolver.js

@@ -0,0 +1,18 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.defaultEndpointResolver = void 0;
+const util_endpoints_1 = require("@aws-sdk/util-endpoints");
+const util_endpoints_2 = require("@smithy/util-endpoints");
+const ruleset_1 = require("./ruleset");
+const cache = new util_endpoints_2.EndpointCache({
+    size: 50,
+    params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"],
+});
+const defaultEndpointResolver = (endpointParams, context = {}) => {
+    return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, {
+        endpointParams: endpointParams,
+        logger: context.logger,
+    }));
+};
+exports.defaultEndpointResolver = defaultEndpointResolver;
+util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions;

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/endpoint/ruleset.js

@@ -0,0 +1,7 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.ruleSet = void 0;
+const u = "required", v = "fn", w = "argv", x = "ref";
+const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "string" }, j = { [u]: true, "default": false, "type": "boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }];
+const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] };
+exports.ruleSet = _data;

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/index.js

@@ -0,0 +1,514 @@
+'use strict';
+
+var middlewareHostHeader = require('@aws-sdk/middleware-host-header');
+var middlewareLogger = require('@aws-sdk/middleware-logger');
+var middlewareRecursionDetection = require('@aws-sdk/middleware-recursion-detection');
+var middlewareUserAgent = require('@aws-sdk/middleware-user-agent');
+var configResolver = require('@smithy/config-resolver');
+var core = require('@smithy/core');
+var schema = require('@smithy/core/schema');
+var middlewareContentLength = require('@smithy/middleware-content-length');
+var middlewareEndpoint = require('@smithy/middleware-endpoint');
+var middlewareRetry = require('@smithy/middleware-retry');
+var smithyClient = require('@smithy/smithy-client');
+var httpAuthSchemeProvider = require('./auth/httpAuthSchemeProvider');
+var runtimeConfig = require('./runtimeConfig');
+var regionConfigResolver = require('@aws-sdk/region-config-resolver');
+var protocolHttp = require('@smithy/protocol-http');
+
+const resolveClientEndpointParameters = (options) => {
+    return Object.assign(options, {
+        useDualstackEndpoint: options.useDualstackEndpoint ?? false,
+        useFipsEndpoint: options.useFipsEndpoint ?? false,
+        defaultSigningName: "awsssoportal",
+    });
+};
+const commonParams = {
+    UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
+    Endpoint: { type: "builtInParams", name: "endpoint" },
+    Region: { type: "builtInParams", name: "region" },
+    UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
+};
+
+const getHttpAuthExtensionConfiguration = (runtimeConfig) => {
+    const _httpAuthSchemes = runtimeConfig.httpAuthSchemes;
+    let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider;
+    let _credentials = runtimeConfig.credentials;
+    return {
+        setHttpAuthScheme(httpAuthScheme) {
+            const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId);
+            if (index === -1) {
+                _httpAuthSchemes.push(httpAuthScheme);
+            }
+            else {
+                _httpAuthSchemes.splice(index, 1, httpAuthScheme);
+            }
+        },
+        httpAuthSchemes() {
+            return _httpAuthSchemes;
+        },
+        setHttpAuthSchemeProvider(httpAuthSchemeProvider) {
+            _httpAuthSchemeProvider = httpAuthSchemeProvider;
+        },
+        httpAuthSchemeProvider() {
+            return _httpAuthSchemeProvider;
+        },
+        setCredentials(credentials) {
+            _credentials = credentials;
+        },
+        credentials() {
+            return _credentials;
+        },
+    };
+};
+const resolveHttpAuthRuntimeConfig = (config) => {
+    return {
+        httpAuthSchemes: config.httpAuthSchemes(),
+        httpAuthSchemeProvider: config.httpAuthSchemeProvider(),
+        credentials: config.credentials(),
+    };
+};
+
+const resolveRuntimeExtensions = (runtimeConfig, extensions) => {
+    const extensionConfiguration = Object.assign(regionConfigResolver.getAwsRegionExtensionConfiguration(runtimeConfig), smithyClient.getDefaultExtensionConfiguration(runtimeConfig), protocolHttp.getHttpHandlerExtensionConfiguration(runtimeConfig), getHttpAuthExtensionConfiguration(runtimeConfig));
+    extensions.forEach((extension) => extension.configure(extensionConfiguration));
+    return Object.assign(runtimeConfig, regionConfigResolver.resolveAwsRegionExtensionConfiguration(extensionConfiguration), smithyClient.resolveDefaultRuntimeConfig(extensionConfiguration), protocolHttp.resolveHttpHandlerRuntimeConfig(extensionConfiguration), resolveHttpAuthRuntimeConfig(extensionConfiguration));
+};
+
+class SSOClient extends smithyClient.Client {
+    config;
+    constructor(...[configuration]) {
+        const _config_0 = runtimeConfig.getRuntimeConfig(configuration || {});
+        super(_config_0);
+        this.initConfig = _config_0;
+        const _config_1 = resolveClientEndpointParameters(_config_0);
+        const _config_2 = middlewareUserAgent.resolveUserAgentConfig(_config_1);
+        const _config_3 = middlewareRetry.resolveRetryConfig(_config_2);
+        const _config_4 = configResolver.resolveRegionConfig(_config_3);
+        const _config_5 = middlewareHostHeader.resolveHostHeaderConfig(_config_4);
+        const _config_6 = middlewareEndpoint.resolveEndpointConfig(_config_5);
+        const _config_7 = httpAuthSchemeProvider.resolveHttpAuthSchemeConfig(_config_6);
+        const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []);
+        this.config = _config_8;
+        this.middlewareStack.use(schema.getSchemaSerdePlugin(this.config));
+        this.middlewareStack.use(middlewareUserAgent.getUserAgentPlugin(this.config));
+        this.middlewareStack.use(middlewareRetry.getRetryPlugin(this.config));
+        this.middlewareStack.use(middlewareContentLength.getContentLengthPlugin(this.config));
+        this.middlewareStack.use(middlewareHostHeader.getHostHeaderPlugin(this.config));
+        this.middlewareStack.use(middlewareLogger.getLoggerPlugin(this.config));
+        this.middlewareStack.use(middlewareRecursionDetection.getRecursionDetectionPlugin(this.config));
+        this.middlewareStack.use(core.getHttpAuthSchemeEndpointRuleSetPlugin(this.config, {
+            httpAuthSchemeParametersProvider: httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider,
+            identityProviderConfigProvider: async (config) => new core.DefaultIdentityProviderConfig({
+                "aws.auth#sigv4": config.credentials,
+            }),
+        }));
+        this.middlewareStack.use(core.getHttpSigningPlugin(this.config));
+    }
+    destroy() {
+        super.destroy();
+    }
+}
+
+let SSOServiceException$1 = class SSOServiceException extends smithyClient.ServiceException {
+    constructor(options) {
+        super(options);
+        Object.setPrototypeOf(this, SSOServiceException.prototype);
+    }
+};
+
+let InvalidRequestException$1 = class InvalidRequestException extends SSOServiceException$1 {
+    name = "InvalidRequestException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "InvalidRequestException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, InvalidRequestException.prototype);
+    }
+};
+let ResourceNotFoundException$1 = class ResourceNotFoundException extends SSOServiceException$1 {
+    name = "ResourceNotFoundException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "ResourceNotFoundException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, ResourceNotFoundException.prototype);
+    }
+};
+let TooManyRequestsException$1 = class TooManyRequestsException extends SSOServiceException$1 {
+    name = "TooManyRequestsException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "TooManyRequestsException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, TooManyRequestsException.prototype);
+    }
+};
+let UnauthorizedException$1 = class UnauthorizedException extends SSOServiceException$1 {
+    name = "UnauthorizedException";
+    $fault = "client";
+    constructor(opts) {
+        super({
+            name: "UnauthorizedException",
+            $fault: "client",
+            ...opts,
+        });
+        Object.setPrototypeOf(this, UnauthorizedException.prototype);
+    }
+};
+
+const _AI = "AccountInfo";
+const _ALT = "AccountListType";
+const _ATT = "AccessTokenType";
+const _GRC = "GetRoleCredentials";
+const _GRCR = "GetRoleCredentialsRequest";
+const _GRCRe = "GetRoleCredentialsResponse";
+const _IRE = "InvalidRequestException";
+const _L = "Logout";
+const _LA = "ListAccounts";
+const _LAR = "ListAccountsRequest";
+const _LARR = "ListAccountRolesRequest";
+const _LARRi = "ListAccountRolesResponse";
+const _LARi = "ListAccountsResponse";
+const _LARis = "ListAccountRoles";
+const _LR = "LogoutRequest";
+const _RC = "RoleCredentials";
+const _RI = "RoleInfo";
+const _RLT = "RoleListType";
+const _RNFE = "ResourceNotFoundException";
+const _SAKT = "SecretAccessKeyType";
+const _STT = "SessionTokenType";
+const _TMRE = "TooManyRequestsException";
+const _UE = "UnauthorizedException";
+const _aI = "accountId";
+const _aKI = "accessKeyId";
+const _aL = "accountList";
+const _aN = "accountName";
+const _aT = "accessToken";
+const _ai = "account_id";
+const _c = "client";
+const _e = "error";
+const _eA = "emailAddress";
+const _ex = "expiration";
+const _h = "http";
+const _hE = "httpError";
+const _hH = "httpHeader";
+const _hQ = "httpQuery";
+const _m = "message";
+const _mR = "maxResults";
+const _mr = "max_result";
+const _nT = "nextToken";
+const _nt = "next_token";
+const _rC = "roleCredentials";
+const _rL = "roleList";
+const _rN = "roleName";
+const _rn = "role_name";
+const _s = "smithy.ts.sdk.synthetic.com.amazonaws.sso";
+const _sAK = "secretAccessKey";
+const _sT = "sessionToken";
+const _xasbt = "x-amz-sso_bearer_token";
+const n0 = "com.amazonaws.sso";
+var AccessTokenType = [0, n0, _ATT, 8, 0];
+var SecretAccessKeyType = [0, n0, _SAKT, 8, 0];
+var SessionTokenType = [0, n0, _STT, 8, 0];
+var AccountInfo = [3, n0, _AI, 0, [_aI, _aN, _eA], [0, 0, 0]];
+var GetRoleCredentialsRequest = [
+    3,
+    n0,
+    _GRCR,
+    0,
+    [_rN, _aI, _aT],
+    [
+        [
+            0,
+            {
+                [_hQ]: _rn,
+            },
+        ],
+        [
+            0,
+            {
+                [_hQ]: _ai,
+            },
+        ],
+        [
+            () => AccessTokenType,
+            {
+                [_hH]: _xasbt,
+            },
+        ],
+    ],
+];
+var GetRoleCredentialsResponse = [3, n0, _GRCRe, 0, [_rC], [[() => RoleCredentials, 0]]];
+var InvalidRequestException = [
+    -3,
+    n0,
+    _IRE,
+    {
+        [_e]: _c,
+        [_hE]: 400,
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(InvalidRequestException, InvalidRequestException$1);
+var ListAccountRolesRequest = [
+    3,
+    n0,
+    _LARR,
+    0,
+    [_nT, _mR, _aT, _aI],
+    [
+        [
+            0,
+            {
+                [_hQ]: _nt,
+            },
+        ],
+        [
+            1,
+            {
+                [_hQ]: _mr,
+            },
+        ],
+        [
+            () => AccessTokenType,
+            {
+                [_hH]: _xasbt,
+            },
+        ],
+        [
+            0,
+            {
+                [_hQ]: _ai,
+            },
+        ],
+    ],
+];
+var ListAccountRolesResponse = [3, n0, _LARRi, 0, [_nT, _rL], [0, () => RoleListType]];
+var ListAccountsRequest = [
+    3,
+    n0,
+    _LAR,
+    0,
+    [_nT, _mR, _aT],
+    [
+        [
+            0,
+            {
+                [_hQ]: _nt,
+            },
+        ],
+        [
+            1,
+            {
+                [_hQ]: _mr,
+            },
+        ],
+        [
+            () => AccessTokenType,
+            {
+                [_hH]: _xasbt,
+            },
+        ],
+    ],
+];
+var ListAccountsResponse = [3, n0, _LARi, 0, [_nT, _aL], [0, () => AccountListType]];
+var LogoutRequest = [
+    3,
+    n0,
+    _LR,
+    0,
+    [_aT],
+    [
+        [
+            () => AccessTokenType,
+            {
+                [_hH]: _xasbt,
+            },
+        ],
+    ],
+];
+var ResourceNotFoundException = [
+    -3,
+    n0,
+    _RNFE,
+    {
+        [_e]: _c,
+        [_hE]: 404,
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(ResourceNotFoundException, ResourceNotFoundException$1);
+var RoleCredentials = [
+    3,
+    n0,
+    _RC,
+    0,
+    [_aKI, _sAK, _sT, _ex],
+    [0, [() => SecretAccessKeyType, 0], [() => SessionTokenType, 0], 1],
+];
+var RoleInfo = [3, n0, _RI, 0, [_rN, _aI], [0, 0]];
+var TooManyRequestsException = [
+    -3,
+    n0,
+    _TMRE,
+    {
+        [_e]: _c,
+        [_hE]: 429,
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(TooManyRequestsException, TooManyRequestsException$1);
+var UnauthorizedException = [
+    -3,
+    n0,
+    _UE,
+    {
+        [_e]: _c,
+        [_hE]: 401,
+    },
+    [_m],
+    [0],
+];
+schema.TypeRegistry.for(n0).registerError(UnauthorizedException, UnauthorizedException$1);
+var __Unit = "unit";
+var SSOServiceException = [-3, _s, "SSOServiceException", 0, [], []];
+schema.TypeRegistry.for(_s).registerError(SSOServiceException, SSOServiceException$1);
+var AccountListType = [1, n0, _ALT, 0, () => AccountInfo];
+var RoleListType = [1, n0, _RLT, 0, () => RoleInfo];
+var GetRoleCredentials = [
+    9,
+    n0,
+    _GRC,
+    {
+        [_h]: ["GET", "/federation/credentials", 200],
+    },
+    () => GetRoleCredentialsRequest,
+    () => GetRoleCredentialsResponse,
+];
+var ListAccountRoles = [
+    9,
+    n0,
+    _LARis,
+    {
+        [_h]: ["GET", "/assignment/roles", 200],
+    },
+    () => ListAccountRolesRequest,
+    () => ListAccountRolesResponse,
+];
+var ListAccounts = [
+    9,
+    n0,
+    _LA,
+    {
+        [_h]: ["GET", "/assignment/accounts", 200],
+    },
+    () => ListAccountsRequest,
+    () => ListAccountsResponse,
+];
+var Logout = [
+    9,
+    n0,
+    _L,
+    {
+        [_h]: ["POST", "/logout", 200],
+    },
+    () => LogoutRequest,
+    () => __Unit,
+];
+
+class GetRoleCredentialsCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("SWBPortalService", "GetRoleCredentials", {})
+    .n("SSOClient", "GetRoleCredentialsCommand")
+    .sc(GetRoleCredentials)
+    .build() {
+}
+
+class ListAccountRolesCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("SWBPortalService", "ListAccountRoles", {})
+    .n("SSOClient", "ListAccountRolesCommand")
+    .sc(ListAccountRoles)
+    .build() {
+}
+
+class ListAccountsCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("SWBPortalService", "ListAccounts", {})
+    .n("SSOClient", "ListAccountsCommand")
+    .sc(ListAccounts)
+    .build() {
+}
+
+class LogoutCommand extends smithyClient.Command
+    .classBuilder()
+    .ep(commonParams)
+    .m(function (Command, cs, config, o) {
+    return [middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions())];
+})
+    .s("SWBPortalService", "Logout", {})
+    .n("SSOClient", "LogoutCommand")
+    .sc(Logout)
+    .build() {
+}
+
+const commands = {
+    GetRoleCredentialsCommand,
+    ListAccountRolesCommand,
+    ListAccountsCommand,
+    LogoutCommand,
+};
+class SSO extends SSOClient {
+}
+smithyClient.createAggregatedClient(commands, SSO);
+
+const paginateListAccountRoles = core.createPaginator(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults");
+
+const paginateListAccounts = core.createPaginator(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults");
+
+Object.defineProperty(exports, "$Command", {
+    enumerable: true,
+    get: function () { return smithyClient.Command; }
+});
+Object.defineProperty(exports, "__Client", {
+    enumerable: true,
+    get: function () { return smithyClient.Client; }
+});
+exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand;
+exports.InvalidRequestException = InvalidRequestException$1;
+exports.ListAccountRolesCommand = ListAccountRolesCommand;
+exports.ListAccountsCommand = ListAccountsCommand;
+exports.LogoutCommand = LogoutCommand;
+exports.ResourceNotFoundException = ResourceNotFoundException$1;
+exports.SSO = SSO;
+exports.SSOClient = SSOClient;
+exports.SSOServiceException = SSOServiceException$1;
+exports.TooManyRequestsException = TooManyRequestsException$1;
+exports.UnauthorizedException = UnauthorizedException$1;
+exports.paginateListAccountRoles = paginateListAccountRoles;
+exports.paginateListAccounts = paginateListAccounts;

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.js

@@ -0,0 +1,54 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getRuntimeConfig = void 0;
+const tslib_1 = require("tslib");
+const package_json_1 = tslib_1.__importDefault(require("../package.json"));
+const core_1 = require("@aws-sdk/core");
+const util_user_agent_node_1 = require("@aws-sdk/util-user-agent-node");
+const config_resolver_1 = require("@smithy/config-resolver");
+const hash_node_1 = require("@smithy/hash-node");
+const middleware_retry_1 = require("@smithy/middleware-retry");
+const node_config_provider_1 = require("@smithy/node-config-provider");
+const node_http_handler_1 = require("@smithy/node-http-handler");
+const util_body_length_node_1 = require("@smithy/util-body-length-node");
+const util_retry_1 = require("@smithy/util-retry");
+const runtimeConfig_shared_1 = require("./runtimeConfig.shared");
+const smithy_client_1 = require("@smithy/smithy-client");
+const util_defaults_mode_node_1 = require("@smithy/util-defaults-mode-node");
+const smithy_client_2 = require("@smithy/smithy-client");
+const getRuntimeConfig = (config) => {
+    (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version);
+    const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
+    const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode);
+    const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config);
+    (0, core_1.emitWarningIfUnsupportedVersion)(process.version);
+    const loaderConfig = {
+        profile: config?.profile,
+        logger: clientSharedValues.logger,
+    };
+    return {
+        ...clientSharedValues,
+        ...config,
+        runtime: "node",
+        defaultsMode,
+        authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig),
+        bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength,
+        defaultUserAgentProvider: config?.defaultUserAgentProvider ??
+            (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }),
+        maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config),
+        region: config?.region ??
+            (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }),
+        requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider),
+        retryMode: config?.retryMode ??
+            (0, node_config_provider_1.loadConfig)({
+                ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS,
+                default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
+            }, config),
+        sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"),
+        streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector,
+        useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
+        useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
+        userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig),
+    };
+};
+exports.getRuntimeConfig = getRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sso/dist-cjs/runtimeConfig.shared.js

@@ -0,0 +1,42 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.getRuntimeConfig = void 0;
+const core_1 = require("@aws-sdk/core");
+const protocols_1 = require("@aws-sdk/core/protocols");
+const core_2 = require("@smithy/core");
+const smithy_client_1 = require("@smithy/smithy-client");
+const url_parser_1 = require("@smithy/url-parser");
+const util_base64_1 = require("@smithy/util-base64");
+const util_utf8_1 = require("@smithy/util-utf8");
+const httpAuthSchemeProvider_1 = require("./auth/httpAuthSchemeProvider");
+const endpointResolver_1 = require("./endpoint/endpointResolver");
+const getRuntimeConfig = (config) => {
+    return {
+        apiVersion: "2019-06-10",
+        base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64,
+        base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64,
+        disableHostPrefix: config?.disableHostPrefix ?? false,
+        endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver,
+        extensions: config?.extensions ?? [],
+        httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider,
+        httpAuthSchemes: config?.httpAuthSchemes ?? [
+            {
+                schemeId: "aws.auth#sigv4",
+                identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"),
+                signer: new core_1.AwsSdkSigV4Signer(),
+            },
+            {
+                schemeId: "smithy.api#noAuth",
+                identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})),
+                signer: new core_2.NoAuthSigner(),
+            },
+        ],
+        logger: config?.logger ?? new smithy_client_1.NoOpLogger(),
+        protocol: config?.protocol ?? new protocols_1.AwsRestJsonProtocol({ defaultNamespace: "com.amazonaws.sso" }),
+        serviceId: config?.serviceId ?? "SSO",
+        urlParser: config?.urlParser ?? url_parser_1.parseUrl,
+        utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8,
+        utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8,
+    };
+};
+exports.getRuntimeConfig = getRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/protocol-http/dist-cjs/index.js

@@ -0,0 +1,169 @@
+'use strict';
+
+var types = require('@smithy/types');
+
+const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
+    return {
+        setHttpHandler(handler) {
+            runtimeConfig.httpHandler = handler;
+        },
+        httpHandler() {
+            return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+            runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+            return runtimeConfig.httpHandler.httpHandlerConfigs();
+        },
+    };
+};
+const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
+    return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
+    };
+};
+
+class Field {
+    name;
+    kind;
+    values;
+    constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+    }
+    add(value) {
+        this.values.push(value);
+    }
+    set(values) {
+        this.values = values;
+    }
+    remove(value) {
+        this.values = this.values.filter((v) => v !== value);
+    }
+    toString() {
+        return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
+    }
+    get() {
+        return this.values;
+    }
+}
+
+class Fields {
+    entries = {};
+    encoding;
+    constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+    }
+    setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+    }
+    getField(name) {
+        return this.entries[name.toLowerCase()];
+    }
+    removeField(name) {
+        delete this.entries[name.toLowerCase()];
+    }
+    getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+    }
+}
+
+class HttpRequest {
+    method;
+    protocol;
+    hostname;
+    port;
+    path;
+    query;
+    headers;
+    username;
+    password;
+    fragment;
+    body;
+    constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol
+            ? options.protocol.slice(-1) !== ":"
+                ? `${options.protocol}:`
+                : options.protocol
+            : "https:";
+        this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+    }
+    static clone(request) {
+        const cloned = new HttpRequest({
+            ...request,
+            headers: { ...request.headers },
+        });
+        if (cloned.query) {
+            cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+    }
+    static isInstance(request) {
+        if (!request) {
+            return false;
+        }
+        const req = request;
+        return ("method" in req &&
+            "protocol" in req &&
+            "hostname" in req &&
+            "path" in req &&
+            typeof req["query"] === "object" &&
+            typeof req["headers"] === "object");
+    }
+    clone() {
+        return HttpRequest.clone(this);
+    }
+}
+function cloneQuery(query) {
+    return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+            ...carry,
+            [paramName]: Array.isArray(param) ? [...param] : param,
+        };
+    }, {});
+}
+
+class HttpResponse {
+    statusCode;
+    reason;
+    headers;
+    body;
+    constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+    }
+    static isInstance(response) {
+        if (!response)
+            return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+    }
+}
+
+function isValidHostname(hostname) {
+    const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+    return hostPattern.test(hostname);
+}
+
+exports.Field = Field;
+exports.Fields = Fields;
+exports.HttpRequest = HttpRequest;
+exports.HttpResponse = HttpResponse;
+exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
+exports.isValidHostname = isValidHostname;
+exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/smithy-client/dist-cjs/index.js

@@ -0,0 +1,589 @@
+'use strict';
+
+var middlewareStack = require('@smithy/middleware-stack');
+var protocols = require('@smithy/core/protocols');
+var types = require('@smithy/types');
+var schema = require('@smithy/core/schema');
+var serde = require('@smithy/core/serde');
+
+class Client {
+    config;
+    middlewareStack = middlewareStack.constructStack();
+    initConfig;
+    handlers;
+    constructor(config) {
+        this.config = config;
+    }
+    send(command, optionsOrCb, cb) {
+        const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
+        const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
+        const useHandlerCache = options === undefined && this.config.cacheMiddleware === true;
+        let handler;
+        if (useHandlerCache) {
+            if (!this.handlers) {
+                this.handlers = new WeakMap();
+            }
+            const handlers = this.handlers;
+            if (handlers.has(command.constructor)) {
+                handler = handlers.get(command.constructor);
+            }
+            else {
+                handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+                handlers.set(command.constructor, handler);
+            }
+        }
+        else {
+            delete this.handlers;
+            handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
+        }
+        if (callback) {
+            handler(command)
+                .then((result) => callback(null, result.output), (err) => callback(err))
+                .catch(() => { });
+        }
+        else {
+            return handler(command).then((result) => result.output);
+        }
+    }
+    destroy() {
+        this.config?.requestHandler?.destroy?.();
+        delete this.handlers;
+    }
+}
+
+const SENSITIVE_STRING$1 = "***SensitiveInformation***";
+function schemaLogFilter(schema$1, data) {
+    if (data == null) {
+        return data;
+    }
+    const ns = schema.NormalizedSchema.of(schema$1);
+    if (ns.getMergedTraits().sensitive) {
+        return SENSITIVE_STRING$1;
+    }
+    if (ns.isListSchema()) {
+        const isSensitive = !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isMapSchema()) {
+        const isSensitive = !!ns.getKeySchema().getMergedTraits().sensitive || !!ns.getValueSchema().getMergedTraits().sensitive;
+        if (isSensitive) {
+            return SENSITIVE_STRING$1;
+        }
+    }
+    else if (ns.isStructSchema() && typeof data === "object") {
+        const object = data;
+        const newObject = {};
+        for (const [member, memberNs] of ns.structIterator()) {
+            if (object[member] != null) {
+                newObject[member] = schemaLogFilter(memberNs, object[member]);
+            }
+        }
+        return newObject;
+    }
+    return data;
+}
+
+class Command {
+    middlewareStack = middlewareStack.constructStack();
+    schema;
+    static classBuilder() {
+        return new ClassBuilder();
+    }
+    resolveMiddlewareWithContext(clientStack, configuration, options, { middlewareFn, clientName, commandName, inputFilterSensitiveLog, outputFilterSensitiveLog, smithyContext, additionalContext, CommandCtor, }) {
+        for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) {
+            this.middlewareStack.use(mw);
+        }
+        const stack = clientStack.concat(this.middlewareStack);
+        const { logger } = configuration;
+        const handlerExecutionContext = {
+            logger,
+            clientName,
+            commandName,
+            inputFilterSensitiveLog,
+            outputFilterSensitiveLog,
+            [types.SMITHY_CONTEXT_KEY]: {
+                commandInstance: this,
+                ...smithyContext,
+            },
+            ...additionalContext,
+        };
+        const { requestHandler } = configuration;
+        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
+    }
+}
+class ClassBuilder {
+    _init = () => { };
+    _ep = {};
+    _middlewareFn = () => [];
+    _commandName = "";
+    _clientName = "";
+    _additionalContext = {};
+    _smithyContext = {};
+    _inputFilterSensitiveLog = undefined;
+    _outputFilterSensitiveLog = undefined;
+    _serializer = null;
+    _deserializer = null;
+    _operationSchema;
+    init(cb) {
+        this._init = cb;
+    }
+    ep(endpointParameterInstructions) {
+        this._ep = endpointParameterInstructions;
+        return this;
+    }
+    m(middlewareSupplier) {
+        this._middlewareFn = middlewareSupplier;
+        return this;
+    }
+    s(service, operation, smithyContext = {}) {
+        this._smithyContext = {
+            service,
+            operation,
+            ...smithyContext,
+        };
+        return this;
+    }
+    c(additionalContext = {}) {
+        this._additionalContext = additionalContext;
+        return this;
+    }
+    n(clientName, commandName) {
+        this._clientName = clientName;
+        this._commandName = commandName;
+        return this;
+    }
+    f(inputFilter = (_) => _, outputFilter = (_) => _) {
+        this._inputFilterSensitiveLog = inputFilter;
+        this._outputFilterSensitiveLog = outputFilter;
+        return this;
+    }
+    ser(serializer) {
+        this._serializer = serializer;
+        return this;
+    }
+    de(deserializer) {
+        this._deserializer = deserializer;
+        return this;
+    }
+    sc(operation) {
+        this._operationSchema = operation;
+        this._smithyContext.operationSchema = operation;
+        return this;
+    }
+    build() {
+        const closure = this;
+        let CommandRef;
+        return (CommandRef = class extends Command {
+            input;
+            static getEndpointParameterInstructions() {
+                return closure._ep;
+            }
+            constructor(...[input]) {
+                super();
+                this.input = input ?? {};
+                closure._init(this);
+                this.schema = closure._operationSchema;
+            }
+            resolveMiddleware(stack, configuration, options) {
+                const op = closure._operationSchema;
+                const input = op?.[4] ?? op?.input;
+                const output = op?.[5] ?? op?.output;
+                return this.resolveMiddlewareWithContext(stack, configuration, options, {
+                    CommandCtor: CommandRef,
+                    middlewareFn: closure._middlewareFn,
+                    clientName: closure._clientName,
+                    commandName: closure._commandName,
+                    inputFilterSensitiveLog: closure._inputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, input) : (_) => _),
+                    outputFilterSensitiveLog: closure._outputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, output) : (_) => _),
+                    smithyContext: closure._smithyContext,
+                    additionalContext: closure._additionalContext,
+                });
+            }
+            serialize = closure._serializer;
+            deserialize = closure._deserializer;
+        });
+    }
+}
+
+const SENSITIVE_STRING = "***SensitiveInformation***";
+
+const createAggregatedClient = (commands, Client) => {
+    for (const command of Object.keys(commands)) {
+        const CommandCtor = commands[command];
+        const methodImpl = async function (args, optionsOrCb, cb) {
+            const command = new CommandCtor(args);
+            if (typeof optionsOrCb === "function") {
+                this.send(command, optionsOrCb);
+            }
+            else if (typeof cb === "function") {
+                if (typeof optionsOrCb !== "object")
+                    throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
+                this.send(command, optionsOrCb || {}, cb);
+            }
+            else {
+                return this.send(command, optionsOrCb);
+            }
+        };
+        const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
+        Client.prototype[methodName] = methodImpl;
+    }
+};
+
+class ServiceException extends Error {
+    $fault;
+    $response;
+    $retryable;
+    $metadata;
+    constructor(options) {
+        super(options.message);
+        Object.setPrototypeOf(this, Object.getPrototypeOf(this).constructor.prototype);
+        this.name = options.name;
+        this.$fault = options.$fault;
+        this.$metadata = options.$metadata;
+    }
+    static isInstance(value) {
+        if (!value)
+            return false;
+        const candidate = value;
+        return (ServiceException.prototype.isPrototypeOf(candidate) ||
+            (Boolean(candidate.$fault) &&
+                Boolean(candidate.$metadata) &&
+                (candidate.$fault === "client" || candidate.$fault === "server")));
+    }
+    static [Symbol.hasInstance](instance) {
+        if (!instance)
+            return false;
+        const candidate = instance;
+        if (this === ServiceException) {
+            return ServiceException.isInstance(instance);
+        }
+        if (ServiceException.isInstance(instance)) {
+            if (candidate.name && this.name) {
+                return this.prototype.isPrototypeOf(instance) || candidate.name === this.name;
+            }
+            return this.prototype.isPrototypeOf(instance);
+        }
+        return false;
+    }
+}
+const decorateServiceException = (exception, additions = {}) => {
+    Object.entries(additions)
+        .filter(([, v]) => v !== undefined)
+        .forEach(([k, v]) => {
+        if (exception[k] == undefined || exception[k] === "") {
+            exception[k] = v;
+        }
+    });
+    const message = exception.message || exception.Message || "UnknownError";
+    exception.message = message;
+    delete exception.Message;
+    return exception;
+};
+
+const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
+    const $metadata = deserializeMetadata(output);
+    const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
+    const response = new exceptionCtor({
+        name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || "UnknownError",
+        $fault: "client",
+        $metadata,
+    });
+    throw decorateServiceException(response, parsedBody);
+};
+const withBaseException = (ExceptionCtor) => {
+    return ({ output, parsedBody, errorCode }) => {
+        throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
+    };
+};
+const deserializeMetadata = (output) => ({
+    httpStatusCode: output.statusCode,
+    requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
+    extendedRequestId: output.headers["x-amz-id-2"],
+    cfId: output.headers["x-amz-cf-id"],
+});
+
+const loadConfigsForDefaultMode = (mode) => {
+    switch (mode) {
+        case "standard":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "in-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 1100,
+            };
+        case "cross-region":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 3100,
+            };
+        case "mobile":
+            return {
+                retryMode: "standard",
+                connectionTimeout: 30000,
+            };
+        default:
+            return {};
+    }
+};
+
+let warningEmitted = false;
+const emitWarningIfUnsupportedVersion = (version) => {
+    if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
+        warningEmitted = true;
+    }
+};
+
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    for (const id in types.AlgorithmId) {
+        const algorithmId = types.AlgorithmId[id];
+        if (runtimeConfig[algorithmId] === undefined) {
+            continue;
+        }
+        checksumAlgorithms.push({
+            algorithmId: () => algorithmId,
+            checksumConstructor: () => runtimeConfig[algorithmId],
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getRetryConfiguration = (runtimeConfig) => {
+    return {
+        setRetryStrategy(retryStrategy) {
+            runtimeConfig.retryStrategy = retryStrategy;
+        },
+        retryStrategy() {
+            return runtimeConfig.retryStrategy;
+        },
+    };
+};
+const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
+    const runtimeConfig = {};
+    runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
+    return runtimeConfig;
+};
+
+const getDefaultExtensionConfiguration = (runtimeConfig) => {
+    return Object.assign(getChecksumConfiguration(runtimeConfig), getRetryConfiguration(runtimeConfig));
+};
+const getDefaultClientConfiguration = getDefaultExtensionConfiguration;
+const resolveDefaultRuntimeConfig = (config) => {
+    return Object.assign(resolveChecksumRuntimeConfig(config), resolveRetryRuntimeConfig(config));
+};
+
+const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
+
+const getValueFromTextNode = (obj) => {
+    const textNodeName = "#text";
+    for (const key in obj) {
+        if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
+            obj[key] = obj[key][textNodeName];
+        }
+        else if (typeof obj[key] === "object" && obj[key] !== null) {
+            obj[key] = getValueFromTextNode(obj[key]);
+        }
+    }
+    return obj;
+};
+
+const isSerializableHeaderValue = (value) => {
+    return value != null;
+};
+
+class NoOpLogger {
+    trace() { }
+    debug() { }
+    info() { }
+    warn() { }
+    error() { }
+}
+
+function map(arg0, arg1, arg2) {
+    let target;
+    let filter;
+    let instructions;
+    if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
+        target = {};
+        instructions = arg0;
+    }
+    else {
+        target = arg0;
+        if (typeof arg1 === "function") {
+            filter = arg1;
+            instructions = arg2;
+            return mapWithFilter(target, filter, instructions);
+        }
+        else {
+            instructions = arg1;
+        }
+    }
+    for (const key of Object.keys(instructions)) {
+        if (!Array.isArray(instructions[key])) {
+            target[key] = instructions[key];
+            continue;
+        }
+        applyInstruction(target, null, instructions, key);
+    }
+    return target;
+}
+const convertMap = (target) => {
+    const output = {};
+    for (const [k, v] of Object.entries(target || {})) {
+        output[k] = [, v];
+    }
+    return output;
+};
+const take = (source, instructions) => {
+    const out = {};
+    for (const key in instructions) {
+        applyInstruction(out, source, instructions, key);
+    }
+    return out;
+};
+const mapWithFilter = (target, filter, instructions) => {
+    return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
+        if (Array.isArray(value)) {
+            _instructions[key] = value;
+        }
+        else {
+            if (typeof value === "function") {
+                _instructions[key] = [filter, value()];
+            }
+            else {
+                _instructions[key] = [filter, value];
+            }
+        }
+        return _instructions;
+    }, {}));
+};
+const applyInstruction = (target, source, instructions, targetKey) => {
+    if (source !== null) {
+        let instruction = instructions[targetKey];
+        if (typeof instruction === "function") {
+            instruction = [, instruction];
+        }
+        const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
+        if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
+            target[targetKey] = valueFn(source[sourceKey]);
+        }
+        return;
+    }
+    let [filter, value] = instructions[targetKey];
+    if (typeof value === "function") {
+        let _value;
+        const defaultFilterPassed = filter === undefined && (_value = value()) != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed) {
+            target[targetKey] = _value;
+        }
+        else if (customFilterPassed) {
+            target[targetKey] = value();
+        }
+    }
+    else {
+        const defaultFilterPassed = filter === undefined && value != null;
+        const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
+        if (defaultFilterPassed || customFilterPassed) {
+            target[targetKey] = value;
+        }
+    }
+};
+const nonNullish = (_) => _ != null;
+const pass = (_) => _;
+
+const serializeFloat = (value) => {
+    if (value !== value) {
+        return "NaN";
+    }
+    switch (value) {
+        case Infinity:
+            return "Infinity";
+        case -Infinity:
+            return "-Infinity";
+        default:
+            return value;
+    }
+};
+const serializeDateTime = (date) => date.toISOString().replace(".000Z", "Z");
+
+const _json = (obj) => {
+    if (obj == null) {
+        return {};
+    }
+    if (Array.isArray(obj)) {
+        return obj.filter((_) => _ != null).map(_json);
+    }
+    if (typeof obj === "object") {
+        const target = {};
+        for (const key of Object.keys(obj)) {
+            if (obj[key] == null) {
+                continue;
+            }
+            target[key] = _json(obj[key]);
+        }
+        return target;
+    }
+    return obj;
+};
+
+Object.defineProperty(exports, "collectBody", {
+    enumerable: true,
+    get: function () { return protocols.collectBody; }
+});
+Object.defineProperty(exports, "extendedEncodeURIComponent", {
+    enumerable: true,
+    get: function () { return protocols.extendedEncodeURIComponent; }
+});
+Object.defineProperty(exports, "resolvedPath", {
+    enumerable: true,
+    get: function () { return protocols.resolvedPath; }
+});
+exports.Client = Client;
+exports.Command = Command;
+exports.NoOpLogger = NoOpLogger;
+exports.SENSITIVE_STRING = SENSITIVE_STRING;
+exports.ServiceException = ServiceException;
+exports._json = _json;
+exports.convertMap = convertMap;
+exports.createAggregatedClient = createAggregatedClient;
+exports.decorateServiceException = decorateServiceException;
+exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
+exports.getArrayIfSingleItem = getArrayIfSingleItem;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
+exports.getValueFromTextNode = getValueFromTextNode;
+exports.isSerializableHeaderValue = isSerializableHeaderValue;
+exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
+exports.map = map;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
+exports.serializeDateTime = serializeDateTime;
+exports.serializeFloat = serializeFloat;
+exports.take = take;
+exports.throwDefaultError = throwDefaultError;
+exports.withBaseException = withBaseException;
+Object.keys(serde).forEach(function (k) {
+    if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+        enumerable: true,
+        get: function () { return serde[k]; }
+    });
+});

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/types/dist-cjs/index.js

@@ -0,0 +1,91 @@
+'use strict';
+
+exports.HttpAuthLocation = void 0;
+(function (HttpAuthLocation) {
+    HttpAuthLocation["HEADER"] = "header";
+    HttpAuthLocation["QUERY"] = "query";
+})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
+
+exports.HttpApiKeyAuthLocation = void 0;
+(function (HttpApiKeyAuthLocation) {
+    HttpApiKeyAuthLocation["HEADER"] = "header";
+    HttpApiKeyAuthLocation["QUERY"] = "query";
+})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
+
+exports.EndpointURLScheme = void 0;
+(function (EndpointURLScheme) {
+    EndpointURLScheme["HTTP"] = "http";
+    EndpointURLScheme["HTTPS"] = "https";
+})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
+
+exports.AlgorithmId = void 0;
+(function (AlgorithmId) {
+    AlgorithmId["MD5"] = "md5";
+    AlgorithmId["CRC32"] = "crc32";
+    AlgorithmId["CRC32C"] = "crc32c";
+    AlgorithmId["SHA1"] = "sha1";
+    AlgorithmId["SHA256"] = "sha256";
+})(exports.AlgorithmId || (exports.AlgorithmId = {}));
+const getChecksumConfiguration = (runtimeConfig) => {
+    const checksumAlgorithms = [];
+    if (runtimeConfig.sha256 !== undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.SHA256,
+            checksumConstructor: () => runtimeConfig.sha256,
+        });
+    }
+    if (runtimeConfig.md5 != undefined) {
+        checksumAlgorithms.push({
+            algorithmId: () => exports.AlgorithmId.MD5,
+            checksumConstructor: () => runtimeConfig.md5,
+        });
+    }
+    return {
+        addChecksumAlgorithm(algo) {
+            checksumAlgorithms.push(algo);
+        },
+        checksumAlgorithms() {
+            return checksumAlgorithms;
+        },
+    };
+};
+const resolveChecksumRuntimeConfig = (clientConfig) => {
+    const runtimeConfig = {};
+    clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
+        runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
+    });
+    return runtimeConfig;
+};
+
+const getDefaultClientConfiguration = (runtimeConfig) => {
+    return getChecksumConfiguration(runtimeConfig);
+};
+const resolveDefaultRuntimeConfig = (config) => {
+    return resolveChecksumRuntimeConfig(config);
+};
+
+exports.FieldPosition = void 0;
+(function (FieldPosition) {
+    FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
+    FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
+})(exports.FieldPosition || (exports.FieldPosition = {}));
+
+const SMITHY_CONTEXT_KEY = "__smithy_context";
+
+exports.IniSectionType = void 0;
+(function (IniSectionType) {
+    IniSectionType["PROFILE"] = "profile";
+    IniSectionType["SSO_SESSION"] = "sso-session";
+    IniSectionType["SERVICES"] = "services";
+})(exports.IniSectionType || (exports.IniSectionType = {}));
+
+exports.RequestHandlerProtocol = void 0;
+(function (RequestHandlerProtocol) {
+    RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
+    RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
+    RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
+})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
+
+exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY;
+exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
+exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/util-base64/dist-cjs/fromBase64.js

@@ -0,0 +1,16 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.fromBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
+const fromBase64 = (input) => {
+    if ((input.length * 3) % 4 !== 0) {
+        throw new TypeError(`Incorrect padding on base64 string.`);
+    }
+    if (!BASE64_REGEX.exec(input)) {
+        throw new TypeError(`Invalid base64 string.`);
+    }
+    const buffer = (0, util_buffer_from_1.fromString)(input, "base64");
+    return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength);
+};
+exports.fromBase64 = fromBase64;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/util-base64/dist-cjs/index.js

@@ -0,0 +1,19 @@
+'use strict';
+
+var fromBase64 = require('./fromBase64');
+var toBase64 = require('./toBase64');
+
+
+
+Object.keys(fromBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return fromBase64[k]; }
+	});
+});
+Object.keys(toBase64).forEach(function (k) {
+	if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
+		enumerable: true,
+		get: function () { return toBase64[k]; }
+	});
+});

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/util-base64/dist-cjs/toBase64.js

@@ -0,0 +1,19 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.toBase64 = void 0;
+const util_buffer_from_1 = require("@smithy/util-buffer-from");
+const util_utf8_1 = require("@smithy/util-utf8");
+const toBase64 = (_input) => {
+    let input;
+    if (typeof _input === "string") {
+        input = (0, util_utf8_1.fromUtf8)(_input);
+    }
+    else {
+        input = _input;
+    }
+    if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") {
+        throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array.");
+    }
+    return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64");
+};
+exports.toBase64 = toBase64;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/dist-cjs/index.js

@@ -0,0 +1,20 @@
+'use strict';
+
+var isArrayBuffer = require('@smithy/is-array-buffer');
+var buffer = require('buffer');
+
+const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => {
+    if (!isArrayBuffer.isArrayBuffer(input)) {
+        throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`);
+    }
+    return buffer.Buffer.from(input, offset, length);
+};
+const fromString = (input, encoding) => {
+    if (typeof input !== "string") {
+        throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`);
+    }
+    return encoding ? buffer.Buffer.from(input, encoding) : buffer.Buffer.from(input);
+};
+
+exports.fromArrayBuffer = fromArrayBuffer;
+exports.fromString = fromString;

extracted-source/node_modules/@aws-sdk/client-sso/node_modules/@smithy/util-base64/node_modules/@smithy/util-buffer-from/node_modules/@smithy/is-array-buffer/dist-cjs/index.js

@@ -0,0 +1,6 @@
+'use strict';
+
+const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
+    Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
+
+exports.isArrayBuffer = isArrayBuffer;