Add extracted source directory and README navigation

This commit is contained in:
Shawn Bot
2026-03-31 14:56:06 +00:00
parent 6252bb6eb5
commit 91e01d755b
4757 changed files with 984951 additions and 0 deletions

View File

@@ -0,0 +1,64 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.resolveHttpAuthSchemeConfig = exports.defaultBedrockHttpAuthSchemeProvider = exports.defaultBedrockHttpAuthSchemeParametersProvider = void 0;
const core_1 = require("@aws-sdk/core");
const core_2 = require("@smithy/core");
const util_middleware_1 = require("@smithy/util-middleware");
const defaultBedrockHttpAuthSchemeParametersProvider = async (config, context, input) => {
return {
operation: (0, util_middleware_1.getSmithyContext)(context).operation,
region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) ||
(() => {
throw new Error("expected `region` to be configured for `aws.auth#sigv4`");
})(),
};
};
exports.defaultBedrockHttpAuthSchemeParametersProvider = defaultBedrockHttpAuthSchemeParametersProvider;
function createAwsAuthSigv4HttpAuthOption(authParameters) {
return {
schemeId: "aws.auth#sigv4",
signingProperties: {
name: "bedrock",
region: authParameters.region,
},
propertiesExtractor: (config, context) => ({
signingProperties: {
config,
context,
},
}),
};
}
function createSmithyApiHttpBearerAuthHttpAuthOption(authParameters) {
return {
schemeId: "smithy.api#httpBearerAuth",
propertiesExtractor: ({ profile, filepath, configFilepath, ignoreCache }, context) => ({
identityProperties: {
profile,
filepath,
configFilepath,
ignoreCache,
},
}),
};
}
const defaultBedrockHttpAuthSchemeProvider = (authParameters) => {
const options = [];
switch (authParameters.operation) {
default: {
options.push(createAwsAuthSigv4HttpAuthOption(authParameters));
options.push(createSmithyApiHttpBearerAuthHttpAuthOption(authParameters));
}
}
return options;
};
exports.defaultBedrockHttpAuthSchemeProvider = defaultBedrockHttpAuthSchemeProvider;
const resolveHttpAuthSchemeConfig = (config) => {
const token = (0, core_2.memoizeIdentityProvider)(config.token, core_2.isIdentityExpired, core_2.doesIdentityRequireRefresh);
const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config);
return Object.assign(config_0, {
authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []),
token,
});
};
exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig;

View File

@@ -0,0 +1,18 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.defaultEndpointResolver = void 0;
const util_endpoints_1 = require("@aws-sdk/util-endpoints");
const util_endpoints_2 = require("@smithy/util-endpoints");
const ruleset_1 = require("./ruleset");
const cache = new util_endpoints_2.EndpointCache({
size: 50,
params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"],
});
const defaultEndpointResolver = (endpointParams, context = {}) => {
return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, {
endpointParams: endpointParams,
logger: context.logger,
}));
};
exports.defaultEndpointResolver = defaultEndpointResolver;
util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions;

View File

@@ -0,0 +1,7 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.ruleSet = void 0;
const s = "required", t = "fn", u = "argv", v = "ref";
const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = { [s]: false, "type": "string" }, i = { [s]: true, "default": false, "type": "boolean" }, j = { [v]: "Endpoint" }, k = { [t]: c, [u]: [{ [v]: "UseFIPS" }, true] }, l = { [t]: c, [u]: [{ [v]: "UseDualStack" }, true] }, m = {}, n = { [t]: "getAttr", [u]: [{ [v]: g }, "supportsFIPS"] }, o = { [t]: c, [u]: [true, { [t]: "getAttr", [u]: [{ [v]: g }, "supportsDualStack"] }] }, p = [k], q = [l], r = [{ [v]: "Region" }];
const _data = { version: "1.0", parameters: { Region: h, UseDualStack: i, UseFIPS: i, Endpoint: h }, rules: [{ conditions: [{ [t]: b, [u]: [j] }], rules: [{ conditions: p, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { rules: [{ conditions: q, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: j, properties: m, headers: m }, type: e }], type: f }], type: f }, { rules: [{ conditions: [{ [t]: b, [u]: r }], rules: [{ conditions: [{ [t]: "aws.partition", [u]: r, assign: g }], rules: [{ conditions: [k, l], rules: [{ conditions: [{ [t]: c, [u]: [a, n] }, o], rules: [{ rules: [{ endpoint: { url: "https://bedrock-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: p, rules: [{ conditions: [{ [t]: c, [u]: [n, a] }], rules: [{ rules: [{ endpoint: { url: "https://bedrock-fips.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: q, rules: [{ conditions: [o], rules: [{ rules: [{ endpoint: { url: "https://bedrock.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { rules: [{ endpoint: { url: "https://bedrock.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }], type: f }] };
exports.ruleSet = _data;

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,79 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.getRuntimeConfig = void 0;
const tslib_1 = require("tslib");
const package_json_1 = tslib_1.__importDefault(require("../package.json"));
const core_1 = require("@aws-sdk/core");
const credential_provider_node_1 = require("@aws-sdk/credential-provider-node");
const token_providers_1 = require("@aws-sdk/token-providers");
const util_user_agent_node_1 = require("@aws-sdk/util-user-agent-node");
const config_resolver_1 = require("@smithy/config-resolver");
const core_2 = require("@smithy/core");
const hash_node_1 = require("@smithy/hash-node");
const middleware_retry_1 = require("@smithy/middleware-retry");
const node_config_provider_1 = require("@smithy/node-config-provider");
const node_http_handler_1 = require("@smithy/node-http-handler");
const util_body_length_node_1 = require("@smithy/util-body-length-node");
const util_retry_1 = require("@smithy/util-retry");
const runtimeConfig_shared_1 = require("./runtimeConfig.shared");
const smithy_client_1 = require("@smithy/smithy-client");
const util_defaults_mode_node_1 = require("@smithy/util-defaults-mode-node");
const smithy_client_2 = require("@smithy/smithy-client");
const getRuntimeConfig = (config) => {
(0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version);
const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode);
const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config);
(0, core_1.emitWarningIfUnsupportedVersion)(process.version);
const loaderConfig = {
profile: config?.profile,
logger: clientSharedValues.logger,
signingName: "bedrock",
};
return {
...clientSharedValues,
...config,
runtime: "node",
defaultsMode,
authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig),
bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength,
credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider,
defaultUserAgentProvider: config?.defaultUserAgentProvider ??
(0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }),
httpAuthSchemes: config?.httpAuthSchemes ?? [
{
schemeId: "aws.auth#sigv4",
identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"),
signer: new core_1.AwsSdkSigV4Signer(),
},
{
schemeId: "smithy.api#httpBearerAuth",
identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#httpBearerAuth") ||
(async (idProps) => {
try {
return await (0, token_providers_1.fromEnvSigningName)({ signingName: "bedrock" })();
}
catch (error) {
return await (0, token_providers_1.nodeProvider)(idProps)(idProps);
}
}),
signer: new core_2.HttpBearerAuthSigner(),
},
],
maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config),
region: config?.region ??
(0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }),
requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider),
retryMode: config?.retryMode ??
(0, node_config_provider_1.loadConfig)({
...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS,
default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
}, config),
sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"),
streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector,
useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig),
userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig),
};
};
exports.getRuntimeConfig = getRuntimeConfig;

View File

@@ -0,0 +1,42 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.getRuntimeConfig = void 0;
const core_1 = require("@aws-sdk/core");
const protocols_1 = require("@aws-sdk/core/protocols");
const core_2 = require("@smithy/core");
const smithy_client_1 = require("@smithy/smithy-client");
const url_parser_1 = require("@smithy/url-parser");
const util_base64_1 = require("@smithy/util-base64");
const util_utf8_1 = require("@smithy/util-utf8");
const httpAuthSchemeProvider_1 = require("./auth/httpAuthSchemeProvider");
const endpointResolver_1 = require("./endpoint/endpointResolver");
const getRuntimeConfig = (config) => {
return {
apiVersion: "2023-04-20",
base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64,
base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64,
disableHostPrefix: config?.disableHostPrefix ?? false,
endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver,
extensions: config?.extensions ?? [],
httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultBedrockHttpAuthSchemeProvider,
httpAuthSchemes: config?.httpAuthSchemes ?? [
{
schemeId: "aws.auth#sigv4",
identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"),
signer: new core_1.AwsSdkSigV4Signer(),
},
{
schemeId: "smithy.api#httpBearerAuth",
identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#httpBearerAuth"),
signer: new core_2.HttpBearerAuthSigner(),
},
],
logger: config?.logger ?? new smithy_client_1.NoOpLogger(),
protocol: config?.protocol ?? new protocols_1.AwsRestJsonProtocol({ defaultNamespace: "com.amazonaws.bedrock" }),
serviceId: config?.serviceId ?? "Bedrock",
urlParser: config?.urlParser ?? url_parser_1.parseUrl,
utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8,
utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8,
};
};
exports.getRuntimeConfig = getRuntimeConfig;

View File

@@ -0,0 +1,169 @@
'use strict';
var types = require('@smithy/types');
const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
return {
setHttpHandler(handler) {
runtimeConfig.httpHandler = handler;
},
httpHandler() {
return runtimeConfig.httpHandler;
},
updateHttpClientConfig(key, value) {
runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
},
httpHandlerConfigs() {
return runtimeConfig.httpHandler.httpHandlerConfigs();
},
};
};
const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
return {
httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
};
};
class Field {
name;
kind;
values;
constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
this.name = name;
this.kind = kind;
this.values = values;
}
add(value) {
this.values.push(value);
}
set(values) {
this.values = values;
}
remove(value) {
this.values = this.values.filter((v) => v !== value);
}
toString() {
return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
}
get() {
return this.values;
}
}
class Fields {
entries = {};
encoding;
constructor({ fields = [], encoding = "utf-8" }) {
fields.forEach(this.setField.bind(this));
this.encoding = encoding;
}
setField(field) {
this.entries[field.name.toLowerCase()] = field;
}
getField(name) {
return this.entries[name.toLowerCase()];
}
removeField(name) {
delete this.entries[name.toLowerCase()];
}
getByType(kind) {
return Object.values(this.entries).filter((field) => field.kind === kind);
}
}
class HttpRequest {
method;
protocol;
hostname;
port;
path;
query;
headers;
username;
password;
fragment;
body;
constructor(options) {
this.method = options.method || "GET";
this.hostname = options.hostname || "localhost";
this.port = options.port;
this.query = options.query || {};
this.headers = options.headers || {};
this.body = options.body;
this.protocol = options.protocol
? options.protocol.slice(-1) !== ":"
? `${options.protocol}:`
: options.protocol
: "https:";
this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
this.username = options.username;
this.password = options.password;
this.fragment = options.fragment;
}
static clone(request) {
const cloned = new HttpRequest({
...request,
headers: { ...request.headers },
});
if (cloned.query) {
cloned.query = cloneQuery(cloned.query);
}
return cloned;
}
static isInstance(request) {
if (!request) {
return false;
}
const req = request;
return ("method" in req &&
"protocol" in req &&
"hostname" in req &&
"path" in req &&
typeof req["query"] === "object" &&
typeof req["headers"] === "object");
}
clone() {
return HttpRequest.clone(this);
}
}
function cloneQuery(query) {
return Object.keys(query).reduce((carry, paramName) => {
const param = query[paramName];
return {
...carry,
[paramName]: Array.isArray(param) ? [...param] : param,
};
}, {});
}
class HttpResponse {
statusCode;
reason;
headers;
body;
constructor(options) {
this.statusCode = options.statusCode;
this.reason = options.reason;
this.headers = options.headers || {};
this.body = options.body;
}
static isInstance(response) {
if (!response)
return false;
const resp = response;
return typeof resp.statusCode === "number" && typeof resp.headers === "object";
}
}
function isValidHostname(hostname) {
const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
return hostPattern.test(hostname);
}
exports.Field = Field;
exports.Fields = Fields;
exports.HttpRequest = HttpRequest;
exports.HttpResponse = HttpResponse;
exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
exports.isValidHostname = isValidHostname;
exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;

View File

@@ -0,0 +1,589 @@
'use strict';
var middlewareStack = require('@smithy/middleware-stack');
var protocols = require('@smithy/core/protocols');
var types = require('@smithy/types');
var schema = require('@smithy/core/schema');
var serde = require('@smithy/core/serde');
class Client {
config;
middlewareStack = middlewareStack.constructStack();
initConfig;
handlers;
constructor(config) {
this.config = config;
}
send(command, optionsOrCb, cb) {
const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
const useHandlerCache = options === undefined && this.config.cacheMiddleware === true;
let handler;
if (useHandlerCache) {
if (!this.handlers) {
this.handlers = new WeakMap();
}
const handlers = this.handlers;
if (handlers.has(command.constructor)) {
handler = handlers.get(command.constructor);
}
else {
handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
handlers.set(command.constructor, handler);
}
}
else {
delete this.handlers;
handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
}
if (callback) {
handler(command)
.then((result) => callback(null, result.output), (err) => callback(err))
.catch(() => { });
}
else {
return handler(command).then((result) => result.output);
}
}
destroy() {
this.config?.requestHandler?.destroy?.();
delete this.handlers;
}
}
const SENSITIVE_STRING$1 = "***SensitiveInformation***";
function schemaLogFilter(schema$1, data) {
if (data == null) {
return data;
}
const ns = schema.NormalizedSchema.of(schema$1);
if (ns.getMergedTraits().sensitive) {
return SENSITIVE_STRING$1;
}
if (ns.isListSchema()) {
const isSensitive = !!ns.getValueSchema().getMergedTraits().sensitive;
if (isSensitive) {
return SENSITIVE_STRING$1;
}
}
else if (ns.isMapSchema()) {
const isSensitive = !!ns.getKeySchema().getMergedTraits().sensitive || !!ns.getValueSchema().getMergedTraits().sensitive;
if (isSensitive) {
return SENSITIVE_STRING$1;
}
}
else if (ns.isStructSchema() && typeof data === "object") {
const object = data;
const newObject = {};
for (const [member, memberNs] of ns.structIterator()) {
if (object[member] != null) {
newObject[member] = schemaLogFilter(memberNs, object[member]);
}
}
return newObject;
}
return data;
}
class Command {
middlewareStack = middlewareStack.constructStack();
schema;
static classBuilder() {
return new ClassBuilder();
}
resolveMiddlewareWithContext(clientStack, configuration, options, { middlewareFn, clientName, commandName, inputFilterSensitiveLog, outputFilterSensitiveLog, smithyContext, additionalContext, CommandCtor, }) {
for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) {
this.middlewareStack.use(mw);
}
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog,
outputFilterSensitiveLog,
[types.SMITHY_CONTEXT_KEY]: {
commandInstance: this,
...smithyContext,
},
...additionalContext,
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
}
class ClassBuilder {
_init = () => { };
_ep = {};
_middlewareFn = () => [];
_commandName = "";
_clientName = "";
_additionalContext = {};
_smithyContext = {};
_inputFilterSensitiveLog = undefined;
_outputFilterSensitiveLog = undefined;
_serializer = null;
_deserializer = null;
_operationSchema;
init(cb) {
this._init = cb;
}
ep(endpointParameterInstructions) {
this._ep = endpointParameterInstructions;
return this;
}
m(middlewareSupplier) {
this._middlewareFn = middlewareSupplier;
return this;
}
s(service, operation, smithyContext = {}) {
this._smithyContext = {
service,
operation,
...smithyContext,
};
return this;
}
c(additionalContext = {}) {
this._additionalContext = additionalContext;
return this;
}
n(clientName, commandName) {
this._clientName = clientName;
this._commandName = commandName;
return this;
}
f(inputFilter = (_) => _, outputFilter = (_) => _) {
this._inputFilterSensitiveLog = inputFilter;
this._outputFilterSensitiveLog = outputFilter;
return this;
}
ser(serializer) {
this._serializer = serializer;
return this;
}
de(deserializer) {
this._deserializer = deserializer;
return this;
}
sc(operation) {
this._operationSchema = operation;
this._smithyContext.operationSchema = operation;
return this;
}
build() {
const closure = this;
let CommandRef;
return (CommandRef = class extends Command {
input;
static getEndpointParameterInstructions() {
return closure._ep;
}
constructor(...[input]) {
super();
this.input = input ?? {};
closure._init(this);
this.schema = closure._operationSchema;
}
resolveMiddleware(stack, configuration, options) {
const op = closure._operationSchema;
const input = op?.[4] ?? op?.input;
const output = op?.[5] ?? op?.output;
return this.resolveMiddlewareWithContext(stack, configuration, options, {
CommandCtor: CommandRef,
middlewareFn: closure._middlewareFn,
clientName: closure._clientName,
commandName: closure._commandName,
inputFilterSensitiveLog: closure._inputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, input) : (_) => _),
outputFilterSensitiveLog: closure._outputFilterSensitiveLog ?? (op ? schemaLogFilter.bind(null, output) : (_) => _),
smithyContext: closure._smithyContext,
additionalContext: closure._additionalContext,
});
}
serialize = closure._serializer;
deserialize = closure._deserializer;
});
}
}
const SENSITIVE_STRING = "***SensitiveInformation***";
const createAggregatedClient = (commands, Client) => {
for (const command of Object.keys(commands)) {
const CommandCtor = commands[command];
const methodImpl = async function (args, optionsOrCb, cb) {
const command = new CommandCtor(args);
if (typeof optionsOrCb === "function") {
this.send(command, optionsOrCb);
}
else if (typeof cb === "function") {
if (typeof optionsOrCb !== "object")
throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
this.send(command, optionsOrCb || {}, cb);
}
else {
return this.send(command, optionsOrCb);
}
};
const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
Client.prototype[methodName] = methodImpl;
}
};
class ServiceException extends Error {
$fault;
$response;
$retryable;
$metadata;
constructor(options) {
super(options.message);
Object.setPrototypeOf(this, Object.getPrototypeOf(this).constructor.prototype);
this.name = options.name;
this.$fault = options.$fault;
this.$metadata = options.$metadata;
}
static isInstance(value) {
if (!value)
return false;
const candidate = value;
return (ServiceException.prototype.isPrototypeOf(candidate) ||
(Boolean(candidate.$fault) &&
Boolean(candidate.$metadata) &&
(candidate.$fault === "client" || candidate.$fault === "server")));
}
static [Symbol.hasInstance](instance) {
if (!instance)
return false;
const candidate = instance;
if (this === ServiceException) {
return ServiceException.isInstance(instance);
}
if (ServiceException.isInstance(instance)) {
if (candidate.name && this.name) {
return this.prototype.isPrototypeOf(instance) || candidate.name === this.name;
}
return this.prototype.isPrototypeOf(instance);
}
return false;
}
}
const decorateServiceException = (exception, additions = {}) => {
Object.entries(additions)
.filter(([, v]) => v !== undefined)
.forEach(([k, v]) => {
if (exception[k] == undefined || exception[k] === "") {
exception[k] = v;
}
});
const message = exception.message || exception.Message || "UnknownError";
exception.message = message;
delete exception.Message;
return exception;
};
const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
const $metadata = deserializeMetadata(output);
const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
const response = new exceptionCtor({
name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || "UnknownError",
$fault: "client",
$metadata,
});
throw decorateServiceException(response, parsedBody);
};
const withBaseException = (ExceptionCtor) => {
return ({ output, parsedBody, errorCode }) => {
throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
};
};
const deserializeMetadata = (output) => ({
httpStatusCode: output.statusCode,
requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
extendedRequestId: output.headers["x-amz-id-2"],
cfId: output.headers["x-amz-cf-id"],
});
const loadConfigsForDefaultMode = (mode) => {
switch (mode) {
case "standard":
return {
retryMode: "standard",
connectionTimeout: 3100,
};
case "in-region":
return {
retryMode: "standard",
connectionTimeout: 1100,
};
case "cross-region":
return {
retryMode: "standard",
connectionTimeout: 3100,
};
case "mobile":
return {
retryMode: "standard",
connectionTimeout: 30000,
};
default:
return {};
}
};
let warningEmitted = false;
const emitWarningIfUnsupportedVersion = (version) => {
if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
warningEmitted = true;
}
};
const getChecksumConfiguration = (runtimeConfig) => {
const checksumAlgorithms = [];
for (const id in types.AlgorithmId) {
const algorithmId = types.AlgorithmId[id];
if (runtimeConfig[algorithmId] === undefined) {
continue;
}
checksumAlgorithms.push({
algorithmId: () => algorithmId,
checksumConstructor: () => runtimeConfig[algorithmId],
});
}
return {
addChecksumAlgorithm(algo) {
checksumAlgorithms.push(algo);
},
checksumAlgorithms() {
return checksumAlgorithms;
},
};
};
const resolveChecksumRuntimeConfig = (clientConfig) => {
const runtimeConfig = {};
clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
});
return runtimeConfig;
};
const getRetryConfiguration = (runtimeConfig) => {
return {
setRetryStrategy(retryStrategy) {
runtimeConfig.retryStrategy = retryStrategy;
},
retryStrategy() {
return runtimeConfig.retryStrategy;
},
};
};
const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
const runtimeConfig = {};
runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
return runtimeConfig;
};
const getDefaultExtensionConfiguration = (runtimeConfig) => {
return Object.assign(getChecksumConfiguration(runtimeConfig), getRetryConfiguration(runtimeConfig));
};
const getDefaultClientConfiguration = getDefaultExtensionConfiguration;
const resolveDefaultRuntimeConfig = (config) => {
return Object.assign(resolveChecksumRuntimeConfig(config), resolveRetryRuntimeConfig(config));
};
const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
const getValueFromTextNode = (obj) => {
const textNodeName = "#text";
for (const key in obj) {
if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
obj[key] = obj[key][textNodeName];
}
else if (typeof obj[key] === "object" && obj[key] !== null) {
obj[key] = getValueFromTextNode(obj[key]);
}
}
return obj;
};
const isSerializableHeaderValue = (value) => {
return value != null;
};
class NoOpLogger {
trace() { }
debug() { }
info() { }
warn() { }
error() { }
}
function map(arg0, arg1, arg2) {
let target;
let filter;
let instructions;
if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
target = {};
instructions = arg0;
}
else {
target = arg0;
if (typeof arg1 === "function") {
filter = arg1;
instructions = arg2;
return mapWithFilter(target, filter, instructions);
}
else {
instructions = arg1;
}
}
for (const key of Object.keys(instructions)) {
if (!Array.isArray(instructions[key])) {
target[key] = instructions[key];
continue;
}
applyInstruction(target, null, instructions, key);
}
return target;
}
const convertMap = (target) => {
const output = {};
for (const [k, v] of Object.entries(target || {})) {
output[k] = [, v];
}
return output;
};
const take = (source, instructions) => {
const out = {};
for (const key in instructions) {
applyInstruction(out, source, instructions, key);
}
return out;
};
const mapWithFilter = (target, filter, instructions) => {
return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
if (Array.isArray(value)) {
_instructions[key] = value;
}
else {
if (typeof value === "function") {
_instructions[key] = [filter, value()];
}
else {
_instructions[key] = [filter, value];
}
}
return _instructions;
}, {}));
};
const applyInstruction = (target, source, instructions, targetKey) => {
if (source !== null) {
let instruction = instructions[targetKey];
if (typeof instruction === "function") {
instruction = [, instruction];
}
const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
target[targetKey] = valueFn(source[sourceKey]);
}
return;
}
let [filter, value] = instructions[targetKey];
if (typeof value === "function") {
let _value;
const defaultFilterPassed = filter === undefined && (_value = value()) != null;
const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
if (defaultFilterPassed) {
target[targetKey] = _value;
}
else if (customFilterPassed) {
target[targetKey] = value();
}
}
else {
const defaultFilterPassed = filter === undefined && value != null;
const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
if (defaultFilterPassed || customFilterPassed) {
target[targetKey] = value;
}
}
};
const nonNullish = (_) => _ != null;
const pass = (_) => _;
const serializeFloat = (value) => {
if (value !== value) {
return "NaN";
}
switch (value) {
case Infinity:
return "Infinity";
case -Infinity:
return "-Infinity";
default:
return value;
}
};
const serializeDateTime = (date) => date.toISOString().replace(".000Z", "Z");
const _json = (obj) => {
if (obj == null) {
return {};
}
if (Array.isArray(obj)) {
return obj.filter((_) => _ != null).map(_json);
}
if (typeof obj === "object") {
const target = {};
for (const key of Object.keys(obj)) {
if (obj[key] == null) {
continue;
}
target[key] = _json(obj[key]);
}
return target;
}
return obj;
};
Object.defineProperty(exports, "collectBody", {
enumerable: true,
get: function () { return protocols.collectBody; }
});
Object.defineProperty(exports, "extendedEncodeURIComponent", {
enumerable: true,
get: function () { return protocols.extendedEncodeURIComponent; }
});
Object.defineProperty(exports, "resolvedPath", {
enumerable: true,
get: function () { return protocols.resolvedPath; }
});
exports.Client = Client;
exports.Command = Command;
exports.NoOpLogger = NoOpLogger;
exports.SENSITIVE_STRING = SENSITIVE_STRING;
exports.ServiceException = ServiceException;
exports._json = _json;
exports.convertMap = convertMap;
exports.createAggregatedClient = createAggregatedClient;
exports.decorateServiceException = decorateServiceException;
exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
exports.getArrayIfSingleItem = getArrayIfSingleItem;
exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
exports.getValueFromTextNode = getValueFromTextNode;
exports.isSerializableHeaderValue = isSerializableHeaderValue;
exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
exports.map = map;
exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
exports.serializeDateTime = serializeDateTime;
exports.serializeFloat = serializeFloat;
exports.take = take;
exports.throwDefaultError = throwDefaultError;
exports.withBaseException = withBaseException;
Object.keys(serde).forEach(function (k) {
if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
enumerable: true,
get: function () { return serde[k]; }
});
});

View File

@@ -0,0 +1,91 @@
'use strict';
exports.HttpAuthLocation = void 0;
(function (HttpAuthLocation) {
HttpAuthLocation["HEADER"] = "header";
HttpAuthLocation["QUERY"] = "query";
})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
exports.HttpApiKeyAuthLocation = void 0;
(function (HttpApiKeyAuthLocation) {
HttpApiKeyAuthLocation["HEADER"] = "header";
HttpApiKeyAuthLocation["QUERY"] = "query";
})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
exports.EndpointURLScheme = void 0;
(function (EndpointURLScheme) {
EndpointURLScheme["HTTP"] = "http";
EndpointURLScheme["HTTPS"] = "https";
})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
exports.AlgorithmId = void 0;
(function (AlgorithmId) {
AlgorithmId["MD5"] = "md5";
AlgorithmId["CRC32"] = "crc32";
AlgorithmId["CRC32C"] = "crc32c";
AlgorithmId["SHA1"] = "sha1";
AlgorithmId["SHA256"] = "sha256";
})(exports.AlgorithmId || (exports.AlgorithmId = {}));
const getChecksumConfiguration = (runtimeConfig) => {
const checksumAlgorithms = [];
if (runtimeConfig.sha256 !== undefined) {
checksumAlgorithms.push({
algorithmId: () => exports.AlgorithmId.SHA256,
checksumConstructor: () => runtimeConfig.sha256,
});
}
if (runtimeConfig.md5 != undefined) {
checksumAlgorithms.push({
algorithmId: () => exports.AlgorithmId.MD5,
checksumConstructor: () => runtimeConfig.md5,
});
}
return {
addChecksumAlgorithm(algo) {
checksumAlgorithms.push(algo);
},
checksumAlgorithms() {
return checksumAlgorithms;
},
};
};
const resolveChecksumRuntimeConfig = (clientConfig) => {
const runtimeConfig = {};
clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
});
return runtimeConfig;
};
const getDefaultClientConfiguration = (runtimeConfig) => {
return getChecksumConfiguration(runtimeConfig);
};
const resolveDefaultRuntimeConfig = (config) => {
return resolveChecksumRuntimeConfig(config);
};
exports.FieldPosition = void 0;
(function (FieldPosition) {
FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
})(exports.FieldPosition || (exports.FieldPosition = {}));
const SMITHY_CONTEXT_KEY = "__smithy_context";
exports.IniSectionType = void 0;
(function (IniSectionType) {
IniSectionType["PROFILE"] = "profile";
IniSectionType["SSO_SESSION"] = "sso-session";
IniSectionType["SERVICES"] = "services";
})(exports.IniSectionType || (exports.IniSectionType = {}));
exports.RequestHandlerProtocol = void 0;
(function (RequestHandlerProtocol) {
RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY;
exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;

View File

@@ -0,0 +1,16 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.fromBase64 = void 0;
const util_buffer_from_1 = require("@smithy/util-buffer-from");
const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
const fromBase64 = (input) => {
if ((input.length * 3) % 4 !== 0) {
throw new TypeError(`Incorrect padding on base64 string.`);
}
if (!BASE64_REGEX.exec(input)) {
throw new TypeError(`Invalid base64 string.`);
}
const buffer = (0, util_buffer_from_1.fromString)(input, "base64");
return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength);
};
exports.fromBase64 = fromBase64;

View File

@@ -0,0 +1,19 @@
'use strict';
var fromBase64 = require('./fromBase64');
var toBase64 = require('./toBase64');
Object.keys(fromBase64).forEach(function (k) {
if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
enumerable: true,
get: function () { return fromBase64[k]; }
});
});
Object.keys(toBase64).forEach(function (k) {
if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, {
enumerable: true,
get: function () { return toBase64[k]; }
});
});

View File

@@ -0,0 +1,19 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.toBase64 = void 0;
const util_buffer_from_1 = require("@smithy/util-buffer-from");
const util_utf8_1 = require("@smithy/util-utf8");
const toBase64 = (_input) => {
let input;
if (typeof _input === "string") {
input = (0, util_utf8_1.fromUtf8)(_input);
}
else {
input = _input;
}
if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") {
throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array.");
}
return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64");
};
exports.toBase64 = toBase64;

View File

@@ -0,0 +1,20 @@
'use strict';
var isArrayBuffer = require('@smithy/is-array-buffer');
var buffer = require('buffer');
const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => {
if (!isArrayBuffer.isArrayBuffer(input)) {
throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`);
}
return buffer.Buffer.from(input, offset, length);
};
const fromString = (input, encoding) => {
if (typeof input !== "string") {
throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`);
}
return encoding ? buffer.Buffer.from(input, encoding) : buffer.Buffer.from(input);
};
exports.fromArrayBuffer = fromArrayBuffer;
exports.fromString = fromString;

View File

@@ -0,0 +1,6 @@
'use strict';
const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
exports.isArrayBuffer = isArrayBuffer;